зеркало из
https://github.com/jlind0/multiplex.studio.web.git
synced 2025-10-28 20:54:22 +02:00
1012 строки
232 KiB
Plaintext
1012 строки
232 KiB
Plaintext
define.alias("@glimmer/component/-private/ember-component-manager","article-reader/component-managers/glimmer")
|
|
define("article-reader/components/-dynamic-element-alt",["exports","@glimmer/component"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class r extends t.default{}e.default=r}))
|
|
define("article-reader/components/-dynamic-element",["exports","@glimmer/component"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class r extends t.default{}e.default=r}))
|
|
define("article-reader/components/-private/i18n-strings",["exports","@ember/template-factory","@ember/component/template-only","@ember/component"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const l=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"hz2jFgMn",block:'[[[1,"\\n"],[1," "]],[],false,[]]',moduleName:"article-reader/components/-private/i18n-strings.gts",isStrictMode:!0}),(0,r.default)("i18n-strings","I18nStrings"))
|
|
e.default=l}))
|
|
define.alias("artdeco-button/components/artdeco-button","article-reader/components/artdeco-button")
|
|
define.alias("artdeco-datepicker/components/artdeco-calendar","article-reader/components/artdeco-calendar")
|
|
define.alias("artdeco-card/components/artdeco-card-image","article-reader/components/artdeco-card-image")
|
|
define.alias("artdeco-card/components/artdeco-card","article-reader/components/artdeco-card")
|
|
define.alias("artdeco-carousel/components/artdeco-carousel-item","article-reader/components/artdeco-carousel-item")
|
|
define.alias("artdeco-carousel/components/artdeco-carousel-slider","article-reader/components/artdeco-carousel-slider")
|
|
define.alias("artdeco-carousel/components/artdeco-carousel-title","article-reader/components/artdeco-carousel-title")
|
|
define.alias("artdeco-carousel/components/artdeco-carousel","article-reader/components/artdeco-carousel")
|
|
define.alias("artdeco-completeness-meter-linear/components/artdeco-completeness-meter-linear","article-reader/components/artdeco-completeness-meter-linear")
|
|
define.alias("artdeco-modal/components/artdeco-confirmation-dialog","article-reader/components/artdeco-confirmation-dialog")
|
|
define.alias("artdeco-datepicker/components/artdeco-datepicker-embedded-cal","article-reader/components/artdeco-datepicker-embedded-cal")
|
|
define.alias("artdeco-datepicker/components/artdeco-datepicker","article-reader/components/artdeco-datepicker")
|
|
define.alias("artdeco-datepicker/components/artdeco-daterange-embedded-cal","article-reader/components/artdeco-daterange-embedded-cal")
|
|
define.alias("artdeco-datepicker/components/artdeco-daterange","article-reader/components/artdeco-daterange")
|
|
define.alias("artdeco-dropdown/components/artdeco-dropdown-content","article-reader/components/artdeco-dropdown-content")
|
|
define.alias("artdeco-dropdown/components/artdeco-dropdown-header","article-reader/components/artdeco-dropdown-header")
|
|
define.alias("artdeco-dropdown/components/artdeco-dropdown-item","article-reader/components/artdeco-dropdown-item")
|
|
define.alias("artdeco-dropdown/components/artdeco-dropdown-trigger","article-reader/components/artdeco-dropdown-trigger")
|
|
define.alias("artdeco-dropdown/components/artdeco-dropdown","article-reader/components/artdeco-dropdown")
|
|
define.alias("artdeco-empty-state/components/artdeco-empty-state","article-reader/components/artdeco-empty-state")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-badge","article-reader/components/artdeco-entity-lockup-badge")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-caption","article-reader/components/artdeco-entity-lockup-caption")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-content","article-reader/components/artdeco-entity-lockup-content")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-image","article-reader/components/artdeco-entity-lockup-image")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-metadata","article-reader/components/artdeco-entity-lockup-metadata")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-subtitle","article-reader/components/artdeco-entity-lockup-subtitle")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup-title","article-reader/components/artdeco-entity-lockup-title")
|
|
define.alias("artdeco-entity-lockup/components/artdeco-entity-lockup","article-reader/components/artdeco-entity-lockup")
|
|
define.alias("artdeco-entity-pile/components/artdeco-entity-pile","article-reader/components/artdeco-entity-pile")
|
|
define.alias("artdeco-hoverables/components/artdeco-hoverable-content","article-reader/components/artdeco-hoverable-content")
|
|
define.alias("artdeco-hoverables/components/artdeco-hoverable-trigger","article-reader/components/artdeco-hoverable-trigger")
|
|
define.alias("artdeco-inline-feedback/components/artdeco-inline-feedback","article-reader/components/artdeco-inline-feedback")
|
|
define.alias("artdeco-loader/components/artdeco-loader","article-reader/components/artdeco-loader")
|
|
define.alias("artdeco-modal/components/container","article-reader/components/artdeco-modal-container")
|
|
define.alias("artdeco-modal/components/artdeco-modal-content","article-reader/components/artdeco-modal-content")
|
|
define.alias("artdeco-modal/components/artdeco-modal-footer","article-reader/components/artdeco-modal-footer")
|
|
define.alias("artdeco-modal/components/artdeco-modal-header","article-reader/components/artdeco-modal-header")
|
|
define.alias("artdeco-modal/components/artdeco-modal","article-reader/components/artdeco-modal")
|
|
define.alias("artdeco-notification-badge/components/artdeco-notification-badge","article-reader/components/artdeco-notification-badge")
|
|
define.alias("artdeco-pagination/components/artdeco-pagination-ellipsis","article-reader/components/artdeco-pagination-ellipsis")
|
|
define.alias("artdeco-pagination/components/artdeco-pagination-indicator","article-reader/components/artdeco-pagination-indicator")
|
|
define.alias("artdeco-pagination/components/artdeco-pagination","article-reader/components/artdeco-pagination")
|
|
define.alias("artdeco-pill/components/artdeco-pill-choice-group","article-reader/components/artdeco-pill-choice-group")
|
|
define.alias("artdeco-pill/components/artdeco-pill-choice","article-reader/components/artdeco-pill-choice")
|
|
define.alias("artdeco-pill/components/artdeco-pill-dismiss","article-reader/components/artdeco-pill-dismiss")
|
|
define.alias("artdeco-pill/components/artdeco-pill-input","article-reader/components/artdeco-pill-input")
|
|
define.alias("artdeco-pill/components/artdeco-pill-link","article-reader/components/artdeco-pill-link")
|
|
define.alias("artdeco-pill/components/artdeco-pill-toggle","article-reader/components/artdeco-pill-toggle")
|
|
define.alias("artdeco-slider/components/artdeco-slider","article-reader/components/artdeco-slider")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-spotlight-tab","article-reader/components/artdeco-spotlight-tab")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-spotlight-tablist","article-reader/components/artdeco-spotlight-tablist")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-tab","article-reader/components/artdeco-tab")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-tablist","article-reader/components/artdeco-tablist")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-tabpanel","article-reader/components/artdeco-tabpanel")
|
|
define.alias("ember-cli-artdeco-tabs/components/artdeco-tabs","article-reader/components/artdeco-tabs")
|
|
define.alias("artdeco-text-input/components/artdeco-text-input-multi","article-reader/components/artdeco-text-input-multi")
|
|
define.alias("artdeco-text-input/components/artdeco-text-input-single","article-reader/components/artdeco-text-input-single")
|
|
define.alias("artdeco-text-input/components/artdeco-text-input","article-reader/components/artdeco-text-input")
|
|
define.alias("artdeco-toast/components/artdeco-toast-item","article-reader/components/artdeco-toast-item")
|
|
define.alias("artdeco-toast/components/artdeco-toasts","article-reader/components/artdeco-toasts")
|
|
define.alias("artdeco-toggle/components/artdeco-toggle","article-reader/components/artdeco-toggle")
|
|
define.alias("ember-cli-artdeco-typeahead/components/artdeco-typeahead-input","article-reader/components/artdeco-typeahead-input")
|
|
define.alias("ember-cli-artdeco-typeahead/components/artdeco-typeahead-result","article-reader/components/artdeco-typeahead-result")
|
|
define.alias("ember-cli-artdeco-typeahead/components/artdeco-typeahead-results-list","article-reader/components/artdeco-typeahead-results-list")
|
|
define.alias("ember-cli-artdeco-typeahead/components/artdeco-typeahead","article-reader/components/artdeco-typeahead")
|
|
define("article-reader/components/article-content",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/component","@ember/service","tracked-built-ins","global-utils/utils/url","global-utils/utils/intersection-observer","global-utils/utils/get-asset-url-for-environment","global-utils/utils/is-browser","article-reader/utils/constants","@linkedin/consent-cookie-parser","@glimmer/tracking","@glimmer/component","@ember/object","article-reader/modifiers/manage-article-content","@ember/render-modifiers/modifiers/did-insert","@ember/helper","article-reader/components/content-blocks","article-reader/helpers/html-safe","article-reader/components/follow-button","ember-cli-pemberly-i18n/helpers/t","article-reader/modifiers/track-content-blocks"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A,w,T,k,E){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var C,O,D,S
|
|
const P=/^(https:)?\/\/:0(\/)?$/,I="slate-follow-button"
|
|
e.default=(0,a.setComponentTemplate)((0,n.createTemplateFactory)({id:"wWqemZE3",block:'[[[1,"\\n"],[1," "],[11,0],[4,[32,0],null,[["entityUrn","onDestroy","onArticleUpdate","onArticleInsert"],[[30,1],[30,0,["destroyObserver"]],[30,0,["onUpdate"]],[30,0,["updateArticleContent"]]]]],[4,[32,1],[[30,0,["appendTitleToIframe"]]],null],[12],[1,"\\n "],[11,0],[16,"dir",[29,[[30,2]]]],[16,0,[28,[32,2],["reader-article-content",[52,[30,0,["hasContentBlocks"]]," reader-article-content--content-blocks"," reader-article-content--legacy-html"]],null]],[4,[52,[30,0,["hasContentBlocks"]],[50,[32,3],2,null,[["contentBlocks","state"],[[30,3],[30,4]]]]],null,null],[12],[1,"\\n"],[41,[30,0,["hasContentBlocks"]],[[[1," "],[8,[32,4],null,[["@contentBlocks","@isUsingDashAndGraphQL","@isGatedArticleBannerVisible"],[[30,3],[30,5],[30,6]]],null],[1,"\\n"]],[]],[[[1," "],[1,[28,[32,5],[[30,7]],null]],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n\\n"],[42,[28,[31,3],[[28,[31,3],[[30,0,["scrolledFollowButtons"]]],null]],null],null,[[[1," "],[8,[32,6],null,[["@entityId","@entityType","@destinationElement","@trackingId"],[[30,8,["id"]],[30,8,["type"]],[30,8,["destinationElement"]],[30,9]]],null],[1,"\\n"]],[8]],null],[1,"\\n "],[10,"iframe"],[15,"title",[28,[32,7],["i18n_article_reader_iframe","article-reader/components/article-content"],null]],[14,1,"reader-article-content__chartbeat-iframe"],[14,0,"reader-article-content__chartbeat-iframe"],[12],[13],[1,"\\n "],[13],[1,"\\n "]],["@entityUrn","@textDirection","@content","@state","@isFirstPartyArticleDashAndGqlEnabled","@isGatedArticleBannerVisible","@contentHtml","entity","@trackingId"],false,["if","modifier","each","-track-array"]]',moduleName:"article-reader/components/article-content.gjs",scope:()=>[y.default,v.default,_.concat,E.default,A.default,w.default,T.default,k.default],isStrictMode:!0}),(C=(0,o.inject)("i18n"),O=class e extends b.default{constructor(){super(...arguments);(0,t.default)(this,"i18n",D,this);(0,t.default)(this,"entityUrn",S,this);(0,r.default)(this,"scrolledFollowButtons",new s.TrackedArray)}onUpdate(e,t){if(this._entityUrnCache!==t){this.updateArticleContent(e)
|
|
this._entityUrnCache=t}}destroyObserver(){const e=this._observer
|
|
e&&e.disconnect()}updateArticleContent(e){this._bindEmbedsObserver(e)
|
|
this._updateChartbeat()}appendTitleToIframe(t){const r=t.querySelectorAll("iframe"),i=this.i18n.lookupTranslation(e,"i18n_article_reader_iframe")()
|
|
r.forEach((e=>{e.hasAttribute("title")||e.setAttribute("title",i)}))}get hasContentBlocks(){var e
|
|
return(null===(e=this.args.content)||void 0===e?void 0:e.length)>0}_setupEmbedsLazyloadObserver(e){this.destroyObserver()
|
|
this._observer=new d.default((e=>e.forEach((e=>{if(e.isIntersecting){const{target:t}=e,r=this._isTargetLoaded(t),i=!r&&("IMG"===t.tagName||"IFRAME"===t.tagName),l=!r&&t.classList.contains(I)
|
|
if(i){t.src=jSecure.sanitizeUrl(t.dataset.liSrc)
|
|
this._observer.unobserve(t)}else if(l){t.dataset.loaded=!0
|
|
this.scrolledFollowButtons.push({id:t.dataset.followButtonId,type:t.dataset.followButtonType,destinationElement:t.previousElementSibling})
|
|
this._observer.unobserve(t)}}}))),{threshold:m.IMAGE_EXPOSE_RATIO})
|
|
e.forEach((e=>this._observer.observe(e)))}_isTargetLoaded(e){return"IMG"===e.tagName&&!P.test(e.src)||"IFRAME"===e.tagName&&"about:blank"!==e.src||e.classList.contains(I)&&e.dataset.loaded}_bindEmbedsObserver(e){const t=e.querySelectorAll(`img, iframe, .${I}`)
|
|
t.length&&this._setupEmbedsLazyloadObserver(t)}get _userOptedInToChartbeat(){if(p.default){return(0,f.getCookieConsent)().consent.optedInConsentMap[f.NON_ESSENTIAL_CATEGORIES.ANALYTICS_AND_RESEARCH]}return!1}_updateChartbeat(){if(p.default&&this._userOptedInToChartbeat){const e=window.location.pathname,{title:t}=this,r=document.getElementById(m.CHARTBEAT_IFRAME_ID),i=r.contentWindow.window
|
|
if(i.pSUPERFLY)i.pSUPERFLY.virtualPage(e,t)
|
|
else{const l={uid:m.CHARTBEAT_UID,domain:(0,c.generateUrlByDomain)("linkedin.com"),flickerControl:!1,useCanonical:!0,useCanonicalDomain:!0,authors:this.args.author,noCookies:!0,title:t,path:e}
|
|
i._sf_async_config=l
|
|
i._sf_endpt=(new Date).getTime()
|
|
const n=document.createElement("script")
|
|
n.type="text/javascript"
|
|
n.src=(0,u.default)("assets/src/chartbeat.js")
|
|
n.async=!0
|
|
r.contentWindow.document.body.appendChild(n)}}}},D=(0,i.default)(O.prototype,"i18n",[C],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),S=(0,i.default)(O.prototype,"entityUrn",[h.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),(0,i.default)(O.prototype,"onUpdate",[g.action],Object.getOwnPropertyDescriptor(O.prototype,"onUpdate"),O.prototype),(0,i.default)(O.prototype,"destroyObserver",[g.action],Object.getOwnPropertyDescriptor(O.prototype,"destroyObserver"),O.prototype),(0,i.default)(O.prototype,"updateArticleContent",[g.action],Object.getOwnPropertyDescriptor(O.prototype,"updateArticleContent"),O.prototype),(0,i.default)(O.prototype,"appendTitleToIframe",[g.action],Object.getOwnPropertyDescriptor(O.prototype,"appendTitleToIframe"),O.prototype),O))}))
|
|
define("article-reader/components/article-cover-image",["exports","@ember/template-factory","@ember/component","ember-vector-images/components/lazy-image","@glimmer/component","ember-vector-images/utils/vector-url"],(function(e,t,r,i,l,n){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class a extends l.default{get coverImage(){if(this.args.isFirstPartyArticleDashAndGqlEnabled){var e,t,r,i
|
|
const{vectorImage:l}=(null===(e=this.args.articleCoverMedia)||void 0===e||null===(t=e.originalImage)||void 0===t||null===(r=t.attributes)||void 0===r||null===(i=r[0])||void 0===i?void 0:i.detailData)||{}
|
|
return(0,n.default)(l,1e4)}return this.args.articleCoverMedia.croppedImage}}e.default=a;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"bCVsKAhn",block:'[[[1,"\\n"],[41,[30,1],[[[1," "],[10,"figure"],[14,0,"mt6 relative"],[12],[1,"\\n "],[10,0],[14,0,"reader-cover-image__wrapper"],[12],[1,"\\n "],[8,[32,0],null,[["@class","@image","@alt","@desiredWidth"],["reader-cover-image__img",[30,0,["coverImage"]],[30,1,["caption","text"]],10000]],null],[1,"\\n "],[13],[1,"\\n"],[41,[30,1,["caption","text"]],[[[1," "],[10,"figcaption"],[14,"itemprop","caption"],[14,0,"reader-cover-image__caption"],[12],[1,"\\n "],[1,[30,1,["caption","text"]]],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n"]],[]],null],[1," "]],["@articleCoverMedia"],false,["if"]]',moduleName:"article-reader/components/article-cover-image.gjs",scope:()=>[i.default],isStrictMode:!0}),a)}))
|
|
define("article-reader/components/article-footer-info",["exports","@ember/template-factory","@ember/helper","@ember/component/template-only","@ember/component","ember-engines/components/link-to-external","artdeco-entity-lockup/components/artdeco-entity-lockup","ember-vector-images/components/lazy-image","follows/components/subscribe-button","follows/components/follow-button","hue-web-icons/components/icon","feed-components-shared/components/avatar-image","ember-cli-pemberly-i18n/helpers/t","ember-cli-pemberly-tracking/modifiers/track-interaction"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const f=(0,l.setComponentTemplate)((0,t.createTemplateFactory)({id:"I56i2esm",block:'[[[1,"\\n"],[41,[30,1],[[[1," "],[10,0],[14,0,"display-flex flex-wrap flex-column align-items-center pb4 pt1"],[12],[1,"\\n "],[8,[32,0],[[24,0,"display-flex align-items-center flex-column full-width"],[4,[32,1],["series_info_header"],null]],[["@route","@model"],["publishing-entity.newsletter",[30,2]]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"relative mb4 display-flex justify-center align-items-center full-width"],[12],[1,"\\n "],[8,[32,2],null,[["@size","@class"],[6,"reader-related-content__footer-image-wrapper"]],[["default"],[[[[1,"\\n "],[8,[30,3,["image"]],null,[["@type"],["square"]],[["default"],[[[[1,"\\n "],[8,[32,3],null,[["@classNames","@image","@alt","@ghostType","@desiredWidth"],["reader-related-content__series-logo",[30,4],[30,1,["title"]],"content",88]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[3]]]]],[1,"\\n "],[10,"hr"],[14,0,"reader-related-content__footer-horizontal-line"],[12],[13],[1,"\\n "],[13],[1,"\\n\\n "],[10,0],[14,0,"display-flex"],[12],[1,"\\n "],[10,"h2"],[14,0,"t-16 t-black t-bold"],[12],[1,"\\n "],[1,[30,1,["title"]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n\\n "],[10,"h3"],[14,0,"t-14 t-black--light t-normal"],[12],[1,"\\n "],[1,[30,1,["description"]]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[10,2],[14,0,"t-14 t-black t-bold"],[12],[1,"\\n "],[1,[28,[32,4],["i18n_article_reader_subscriber_count","article-reader/components/article-footer-info"],[["count"],[[30,5]]]]],[1,"\\n "],[13],[1,"\\n\\n"],[1," "],[8,[32,5],[[16,0,[29,["artdeco-button m4\\n ",[52,[30,6],"artdeco-button--secondary artdeco-button--muted","artdeco-button--primary"],"\\n "]]]],[["@controlName","@isFollowing","@showIcon","@showText","@toggleFollow","@onArticleFooterButtonClick","@isArticleFooterButtonClicked"],["series_subscribe_toggle",[30,6],false,true,[30,7],[30,8],[30,9]]],null],[1,"\\n "],[13],[1,"\\n"]],[]],[[[41,[30,10],[[[1," "],[10,0],[14,0,"display-flex flex-wrap flex-column align-items-center pb4 pt1"],[12],[1,"\\n "],[8,[32,0],[[24,0,"reader-related-content__author-image reader-related-content__footer-image-wrapper"],[4,[32,1],["profile_bottom_bar"],null]],[["@route","@model"],[[30,10,["model","profileRoute"]],[30,10,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"relative mb4 display-flex justify-center align-items-center full-width"],[12],[1,"\\n "],[8,[32,6],[[24,0,"reader-related-content__author-image"]],[["@avatar","@alt","@avatarType","@avatarEntityClassSize"],[[30,10,["model","avatar"]],[30,10,["authorName"]],[30,10,["model","actorType"]],5]],null],[1,"\\n "],[10,"hr"],[14,0,"reader-related-content__footer-horizontal-line"],[12],[13],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "],[10,0],[14,0,"display-flex"],[12],[1,"\\n "],[8,[32,0],[[4,[32,1],["profile_bottom_bar"],null]],[["@route","@model"],[[30,10,["model","profileRoute"]],[30,10,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[10,"h2"],[14,0,"t-16 t-black t-bold"],[12],[1,"\\n "],[1,[30,10,["authorName"]]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n"],[41,[30,10,["badges","influencer"]],[[[1," "],[10,1],[14,0,"reader-related-content__author--influencer"],[12],[1,"\\n "],[8,[32,7],null,[["@a11yText","@type","@size","@name"],[[28,[32,4],["is_a_top_voice","article-reader/components/article-footer-info"],[["influencer"],[[30,10,["authorName"]]]]],"system","small","linkedin-bug-influencer-color"]],null],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n\\n"],[41,[30,10,["model","headline"]],[[[1," "],[10,"h3"],[14,0,"t-14 t-black--light t-normal"],[12],[1,"\\n "],[1,[30,10,["model","headline"]]],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1,"\\n"],[41,[51,[30,11]],[[[1," "],[8,[32,8],[[24,0,"artdeco-button artdeco-button--secondary m4"]],[["@showText","@iconType","@controlName","@isFollowing","@toggleFollow"],[true,"add","follow_toggle_bottom_bar",[30,12],[30,13]]],null],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "]],[]],null]],[]]]],["@series","@newsletterId","elements","@seriesLogo","@seriesSubscriberCount","@isSubscribed","@onToggleSubscribeSeries","@onArticleFooterButtonClick","@isArticleFooterButtonClicked","@authorActor","@viewerAllowedToEdit","@isFollowing","@onToggleFollow"],false,["if","unless"]]',moduleName:"article-reader/components/article-footer-info.gjs",scope:()=>[n.default,m.default,a.default,o.default,p.default,s.default,u.default,d.default,c.default],isStrictMode:!0}),(0,i.default)("article-footer-info","ArticleFooterInfo"))
|
|
e.default=f}))
|
|
define("article-reader/components/article-not-found",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","ember-lifeline","@glimmer/component","@glimmer/tracking","@ember/object","@ember/render-modifiers/modifiers/did-insert","ember-cli-pemberly-i18n/helpers/t"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var f,h
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"M4iTNX8V",block:'[[[1,"\\n"],[1," "],[11,0],[24,0,"reader__article-not-found reader-article-not-found__container mt4"],[4,[32,0],[[30,0,["updateTime"]]],null],[12],[1,"\\n "],[10,2],[14,0,"reader-article-not-found__body"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_article_not_found","article-reader/components/article-not-found"],null]],[1,"\\n "],[13],[1,"\\n "],[10,2],[14,0,"reader-article-not-found__body"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_redirect_to_feed","article-reader/components/article-not-found"],[["time"],[[30,0,["time"]]]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "]],[],false,[]]',moduleName:"article-reader/components/article-not-found.gjs",scope:()=>[p.default,m.default],isStrictMode:!0}),(f=class extends c.default{constructor(){super(...arguments);(0,t.default)(this,"time",h,this)}updateTime(){(0,s.runTask)(this,(()=>{this.time-=1
|
|
0===this.time&&"function"==typeof this.args.onTimeEnds?this.args.onTimeEnds():this.time&&this.updateTime()}),1e3)}},h=(0,i.default)(f.prototype,"time",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return 5}}),(0,i.default)(f.prototype,"updateTime",[u.action],Object.getOwnPropertyDescriptor(f.prototype,"updateTime"),f.prototype),f))}))
|
|
define("article-reader/components/author-info",["exports","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@ember/template-factory","@ember/component","@ember/object","@glimmer/component","artdeco-entity-lockup/components/artdeco-entity-lockup","ember-engines/components/link-to-external","ember-cli-pemberly-tracking/modifiers/track-interaction","feed-components-shared/components/avatar-image","hue-web-icons/components/icon","ember-cli-pemberly-i18n/helpers/t","ember-line-clamp/components/line-clamp","follows/components/follow-button","@ember/helper"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var h
|
|
e.default=(0,i.setComponentTemplate)((0,r.createTemplateFactory)({id:"yDRBR7dM",block:'[[[1,"\\n"],[1," "],[10,0],[14,0,"display-flex align-items-center justify-space-between"],[12],[1,"\\n "],[8,[32,0],null,[["@size"],[4]],[["default"],[[[[1,"\\n "],[8,[30,1,["image"]],null,[["@type"],[[30,2]]],[["default"],[[[[1,"\\n "],[8,[32,1],[[24,0,"reader-author-info__meta-image"],[4,[32,2],["read_profile"],null]],[["@route","@model"],[[30,3,["model","profileRoute"]],[30,3,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[8,[32,3],null,[["@alt","@avatar","@avatarEntityClassSize","@avatarType","@miniProfile"],[[30,3,["authorName"]],[30,3,["model","avatar"]],[30,0,["avatarSize"]],[30,3,["model","actorType"]],[30,3,["model","miniProfile"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "],[8,[30,1,["content"]],null,[["@class"],["reader-author-info__content"]],[["default"],[[[[1,"\\n "],[8,[30,1,["title"]],null,[["@class"],["reader-author-info__author-lockup--flex"]],[["default"],[[[[1,"\\n "],[8,[32,1],[[24,0,"reader-author-info__meta-name align-items-center"],[4,[32,2],["read_profile"],null]],[["@route","@model"],[[30,3,["model","profileRoute"]],[30,3,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[10,"h2"],[14,0,"reader-author-info__text reader-author-info__name t-16 t-bold reader-author-info__meta-author-detail--has-hover mr2"],[12],[1,"\\n "],[1,[30,3,["authorName"]]],[1,"\\n"],[41,[30,3,["badges","influencer"]],[[[1," "],[10,1],[14,0,"reader-author-info__meta-author-influencer"],[12],[1,"\\n "],[8,[32,4],null,[["@a11yText","@type","@size","@name"],[[28,[32,5],["is_a_top_voice","article-reader/components/author-info"],[["influencer"],[[30,3,["authorName"]]]]],"system","small","linkedin-bug-influencer-color"]],null],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "],[8,[30,1,["subtitle"]],null,null,[["default"],[[[[1,"\\n"],[41,[30,3,["model","pagePublished"]],[[[1," "],[1,[28,[32,5],["i18n_followers_count","article-reader/components/author-info"],[["count"],[[30,3,["model","followingInfo","followerCount"]]]]]],[1,"\\n"]],[]],[[[1," "],[8,[32,6],[[24,0,"t-black--light break-words"]],[["@text","@lines","@interactive"],[[30,3,["model","headline"]],2,false]],null],[1,"\\n"]],[]]],[1," "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[1]]]]],[1,"\\n\\n "],[10,0],[14,0,"flex-shrink-zero ml2"],[12],[1,"\\n"],[41,[30,4],[[[1," "],[8,[32,1],[[24,0,"reader-author-info__total-articles link-without-visited-state"],[4,[32,2],["read_activity"],null]],[["@route","@model","@query"],["profile.common.recent-activity.posts",[30,3,["model","profileID"]],[28,[32,7],null,[["locale"],[[27]]]]]],[["default"],[[[[1,"\\n "],[1,[28,[32,5],["i18n_article_reader_total_articles","article-reader/components/author-info"],[["count"],[[30,4]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],null],[41,[51,[30,5]],[[[1," "],[8,[32,8],[[24,0,"reader-author-info__follow-button artdeco-button artdeco-button--secondary ml2"]],[["@showText","@iconType","@controlName","@isFollowing","@toggleFollow"],[true,"add","actor_follow_toggle",[30,6],[28,[32,9],[[30,0,["onToggleFollowAction"]],[30,6]],null]]],null],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "],[13],[1,"\\n "]],["elements","@imageType","@authorActor","@totalArticles","@viewerAllowedToEdit","@isFollowing"],false,["if","unless"]]',moduleName:"article-reader/components/author-info.gjs",scope:()=>[a.default,o.default,s.default,c.default,d.default,u.default,p.default,f.hash,m.default,f.fn],isStrictMode:!0}),(h=class extends n.default{get avatarSize(){var e,t
|
|
return null!==(e=this.authorActor)&&void 0!==e&&null!==(t=e.model)&&void 0!==t&&t.pagePublished?5:4}onToggleFollowAction(e){var t,r
|
|
return null===(t=(r=this.args).onToggleFollow)||void 0===t?void 0:t.call(r,e)}},(0,t.default)(h.prototype,"onToggleFollowAction",[l.action],Object.getOwnPropertyDescriptor(h.prototype,"onToggleFollowAction"),h.prototype),h))}))
|
|
define.alias("ember-semaphore/components/block-profile","article-reader/components/block-profile")
|
|
define.alias("ember-semaphore/components/cleared-content-modal-v2","article-reader/components/cleared-content-modal-v2")
|
|
define.alias("ember-semaphore/components/cleared-content-modal","article-reader/components/cleared-content-modal")
|
|
define("article-reader/components/content-blocks",["exports","@ember/template-factory","@ember/component","global-helpers/helpers/eq","global-helpers/helpers/or","article-reader/components/content-blocks/text-block","article-reader/components/content-blocks/image-block","article-reader/components/content-blocks/embed-block","publishing-shared/components/entity-embed","article-reader/components/content-blocks/divider-block","@glimmer/component"],(function(e,t,r,i,l,n,a,o,s,c,d){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class u extends d.default{get contentBlocks(){return this.args.isUsingDashAndGraphQL?this.args.contentBlocks.map((e=>{const t=Object.keys(e.serialize())[0]
|
|
return e[t]})):this.args.contentBlocks}}e.default=u;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"cjPQTwPp",block:'[[[1,"\\n"],[41,[30,1],[[[42,[28,[31,2],[[28,[31,2],[[30,0,["contentBlocks"]]],null]],null],null,[[[41,[28,[32,0],[[28,[32,1],[[30,2,["$type"]],"com.linkedin.voyager.publishing.TextBlock"],null],[28,[32,1],[[30,2,["$type"]],"com.linkedin.voyager.dash.publishing.TextBlock"],null]],null],[[[1," "],[8,[32,2],null,[["@textBlock","@isUsingDashAndGql","@isGatedArticleBannerVisible"],[[30,2],[30,3],[30,1]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[28,[32,0],[[28,[32,1],[[30,2,["$type"]],"com.linkedin.voyager.publishing.EmbedBlock"],null],[28,[32,1],[[30,2,["$type"]],"com.linkedin.voyager.dash.publishing.EmbedBlock"],null]],null],[[[1," "],[8,[32,3],null,[["@embedBlock","@isUsingDashAndGql"],[[30,2],[30,3]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[28,[32,1],[[30,2,["$type"]],"com.linkedin.voyager.dash.publishing.EntityEmbedBlock"],null],[[[1," "],[8,[32,4],null,[["@ctaButton","@description","@destinationUrl","@entityType","@image","@subDescription","@title"],[[30,2,["publishingEntity","ctaButton"]],[30,2,["publishingEntity","description"]],[30,2,["url"]],[30,2,["publishingEntity","type"]],[30,2,["publishingEntity","image"]],[30,2,["publishingEntity","subDescription"]],[30,2,["publishingEntity","title"]]]],null],[1,"\\n"]],[]],null]],[2]],null]],[]],[[[42,[28,[31,2],[[28,[31,2],[[30,0,["contentBlocks"]]],null]],null],null,[[[41,[28,[32,0],[[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.publishing.TextBlock"],null],[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.dash.publishing.TextBlock"],null]],null],[[[1," "],[8,[32,2],null,[["@textBlock","@isUsingDashAndGql"],[[30,4],[30,3]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[51,[30,1]],[[[41,[28,[32,0],[[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.publishing.ImageBlock"],null],[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.dash.publishing.ImageBlock"],null]],null],[[[1," "],[8,[32,5],null,[["@imageBlock","@bemPrefix"],[[30,4],"reader"]],null],[1,"\\n"]],[]],null]],[]],null],[1,"\\n"],[41,[28,[32,0],[[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.publishing.EmbedBlock"],null],[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.dash.publishing.EmbedBlock"],null]],null],[[[1," "],[8,[32,3],null,[["@embedBlock","@isUsingDashAndGql"],[[30,4],[30,3]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.dash.publishing.EntityEmbedBlock"],null],[[[1," "],[8,[32,4],null,[["@ctaButton","@description","@destinationUrl","@entityType","@image","@subDescription","@title"],[[30,4,["publishingEntity","ctaButton"]],[30,4,["publishingEntity","description"]],[30,4,["url"]],[30,4,["publishingEntity","type"]],[30,4,["publishingEntity","image"]],[30,4,["publishingEntity","subDescription"]],[30,4,["publishingEntity","title"]]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[28,[32,0],[[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.publishing.DividerBlock"],null],[28,[32,1],[[30,4,["$type"]],"com.linkedin.voyager.dash.publishing.DividerBlock"],null]],null],[[[1," "],[8,[32,6],null,[["@dividerBlock"],[[30,4]]],null],[1,"\\n"]],[]],null]],[4]],null]],[]]],[1," "]],["@isGatedArticleBannerVisible","contentBlock","@isUsingDashAndGraphQL","contentBlock"],false,["if","each","-track-array","unless"]]',moduleName:"article-reader/components/content-blocks.gjs",scope:()=>[l.default,i.default,n.default,o.default,s.default,a.default,c.default],isStrictMode:!0}),u)}))
|
|
define("article-reader/components/content-blocks/divider-block",["exports","@ember/template-factory","@ember/component/template-only","@ember/component"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const l=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"mpTDhGFO",block:'[[[10,"hr"],[12],[13]],[],false,[]]',moduleName:"article-reader/components/content-blocks/divider-block.gts",isStrictMode:!0}),(0,r.default)("divider-block","DividerBlock"))
|
|
e.default=l}))
|
|
define("article-reader/components/content-blocks/embed-block",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/classPrivateMethodGet","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","@ember/service","global-utils/utils/url","@ember/object","@glimmer/component","article-reader/modifiers/manage-embed-block","article-reader/modifiers/manage-theme-param"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var h,b,g,y
|
|
e.default=(0,s.setComponentTemplate)((0,a.createTemplateFactory)({id:"bB53J40g",block:'[[[1,"\\n "],[11,0],[16,0,[29,[[52,[30,1],"reader-content-blocks__embed"]]]],[4,[32,0],null,[["embedBlock"],[[30,2]]]],[4,[32,1],null,[["onIframeInsert","onThemeChange","theme"],[[30,0,["onIframeInsert"]],[30,0,["onThemeChange"]],[30,0,["themeService","theme"]]]]],[12],[13],[1,"\\n "]],["@isUsingDashAndGql","@embedBlock"],false,["if"]]',moduleName:"article-reader/components/content-blocks/embed-block.gjs",scope:()=>[m.default,f.default],isStrictMode:!0}),(h=(0,c.inject)("global-services@theme"),b=(y=new WeakSet,class extends p.default{constructor(){super(...arguments)
|
|
y.add(this);(0,t.default)(this,"themeService",g,this)}onIframeInsert(e){this.iframe=e.querySelector("iframe")
|
|
this.iframeSrc=this.iframe.getAttribute("src");(0,i.default)(this,y,v).call(this)}onThemeChange(){(0,i.default)(this,y,v).call(this)}}),g=(0,l.default)(b.prototype,"themeService",[h],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),(0,l.default)(b.prototype,"onIframeInsert",[u.action],Object.getOwnPropertyDescriptor(b.prototype,"onIframeInsert"),b.prototype),(0,l.default)(b.prototype,"onThemeChange",[u.action],Object.getOwnPropertyDescriptor(b.prototype,"onThemeChange"),b.prototype),b))
|
|
function v(){const e=(0,d.addQueryParam)(this.iframeSrc,"li_theme",this.themeService.theme)
|
|
this.iframe.setAttribute("src",e)}}))
|
|
define("article-reader/components/content-blocks/image-block",["exports","@ember/template-factory","@ember/component","@glimmer/component","@ember/helper","image-view-model/components/image-view-model","text-view-model/components/text-view-model-v2"],(function(e,t,r,i,l,n,a){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const o={LEFT:"image-block--left-align",RIGHT:"image-block--right-align",RESIZE:"image-block--resize",FULL_WIDTH:"image-block--full-width",BLEED:"image-block--bleed"}
|
|
class s extends i.default{get a11yText(){var e,t
|
|
return(null===(e=this.args.imageBlock)||void 0===e||null===(t=e.content)||void 0===t?void 0:t.accessibilityText)??""}get actionTarget(){var e,t
|
|
return(null===(e=this.args.imageBlock)||void 0===e||null===(t=e.content)||void 0===t?void 0:t.actionTarget)??""}get alignment(){var e
|
|
return(null===(e=this.args.imageBlock)||void 0===e?void 0:e.alignment)??"FULL_WIDTH"}get caption(){var e
|
|
return null===(e=this.args.imageBlock)||void 0===e?void 0:e.caption}get imageAlignmentClassName(){return`reader-${o[this.alignment]}`}}e.default=s;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"vGnHHAb1",block:'[[[1,"\\n "],[10,0],[15,0,[28,[32,0],["reader-image-block ",[30,0,["imageAlignmentClassName"]]],null]],[12],[1,"\\n "],[10,"figure"],[14,0,"reader-image-block__figure"],[12],[1,"\\n"],[41,[30,0,["actionTarget"]],[[[1," "],[10,3],[15,6,[30,0,["actionTarget"]]],[14,"target","_blank"],[14,"rel","noopener noreferrer"],[12],[1,"\\n "],[8,[32,1],null,[["@a11yText","@imgClasses","@images","@desiredWidth","@desiredHeight"],[[30,0,["a11yText"]],"reader-image-block__img",[30,1,["content"]],800,800]],null],[1,"\\n "],[13],[1,"\\n"]],[]],[[[1," "],[8,[32,1],null,[["@a11yText","@imgClasses","@images","@desiredWidth","@desiredHeight"],[[30,0,["a11yText"]],"reader-image-block__img",[30,1,["content"]],800,800]],null],[1,"\\n"]],[]]],[1,"\\n"],[41,[30,0,["caption"]],[[[1," "],[10,"figcaption"],[14,0,"display-block mt2 full-width text-body-small-open t-sans text-align-center t-black--light"],[12],[1,"\\n "],[8,[32,2],null,[["@tvm"],[[30,0,["caption"]]]],null],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "],[13],[1,"\\n "]],["@imageBlock"],false,["if"]]',moduleName:"article-reader/components/content-blocks/image-block.gjs",scope:()=>[l.concat,n.default,a.default],isStrictMode:!0}),s)}))
|
|
define("article-reader/components/content-blocks/text-block",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/component/template-only","@ember/component","global-helpers/helpers/eq","@glimmer/component","text-view-model/helpers/text-view-model","text-view-model/components/text-view-model-v2","global-helpers/helpers/and","@ember/service","ember-element-helper/helpers/element"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var h,b,g
|
|
const y=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"Z+LzrtdE",block:'[[[1,"\\n"],[44,[[28,[32,0],[[30,1]],null]],[[[1," "],[8,[30,2],[[16,0,[29,[[52,[28,[32,1],[[30,1],"p"],null],"reader-content-blocks__paragraph"]]]]],null,[["default"],[[[[1,"\\n"],[41,[30,3],[[[1," "],[8,[32,2],null,[["@tvm","@hyperlinkCompanyName"],[[30,4],true]],null],[1,"\\n"]],[]],[[[1," "],[1,[28,[32,3],[[30,4]],null]],[1,"\\n"]],[]]],[1,"\\n"],[41,[28,[32,4],[[28,[32,1],[[30,4,["text"]],""],null],[28,[32,1],[[30,1],"p"],null]],null],[[[1," "],[10,"br"],[12],[13],[1,"\\n"]],[]],null],[1," "]],[]]]]],[1,"\\n"]],[2]]]],["@tagName","Tag","@isUsingDashAndGql","@content"],false,["let","if"]]',moduleName:"article-reader/components/content-blocks/text-block.gjs",scope:()=>[f.default,s.default,u.default,d.default,p.default],isStrictMode:!0}),(0,a.default)("text-block","Tag"))
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"j7biPt4U",block:'[[[1,"\\n"],[41,[30,1],[[[41,[30,0,["isCharCountWithinLimit"]],[[[41,[28,[32,0],[[30,2,["type"]],"CODE_BLOCK"],null],[[[41,[30,3],[[[1," "],[10,"pre"],[12],[8,[32,1],null,[["@tvm"],[[30,2,["content"]]]],null],[13],[1,"\\n"]],[]],[[[1," "],[10,"pre"],[12],[1,[28,[32,2],[[30,2,["content"]]],null]],[13],[1,"\\n"]],[]]]],[]],[[[1," "],[8,[32,3],null,[["@tagName","@isUsingDashAndGql","@content"],[[30,0,["textBlockTagName"]],[30,3],[30,2,["content"]]]],null],[1,"\\n"]],[]]]],[]],null]],[]],[[[41,[28,[32,0],[[30,2,["type"]],"CODE_BLOCK"],null],[[[41,[30,3],[[[1," "],[10,"pre"],[12],[8,[32,1],null,[["@tvm"],[[30,2,["content"]]]],null],[13],[1,"\\n"]],[]],[[[1," "],[10,"pre"],[12],[1,[28,[32,2],[[30,2,["content"]]],null]],[13],[1,"\\n"]],[]]]],[]],[[[1," "],[8,[32,3],null,[["@tagName","@isUsingDashAndGql","@content"],[[30,0,["textBlockTagName"]],[30,3],[30,2,["content"]]]],null],[1,"\\n"]],[]]]],[]]],[1," "]],["@isGatedArticleBannerVisible","@textBlock","@isUsingDashAndGql"],false,["if"]]',moduleName:"article-reader/components/content-blocks/text-block.gjs",scope:()=>[s.default,u.default,d.default,y],isStrictMode:!0}),(h=(0,m.inject)("article-reader@preview-text-char-counter"),b=class extends c.default{constructor(){super(...arguments);(0,t.default)(this,"previewTextCharCounter",g,this)
|
|
this.args.isGatedArticleBannerVisible&&this._setMaxLimit()}get textBlockTagName(){switch(this.args.textBlock.type){case"HEADING_1":return"h2"
|
|
case"HEADING_2":return"h3"
|
|
case"QUOTE":return"blockquote"
|
|
case"CODE_BLOCK":return"pre"
|
|
default:return"p"}}get isCharCountWithinLimit(){return 1===this.previewTextCharCounter.getParagraphCount()||this.previewTextCharCounter.getPreviewTextCharCount()<=1e3}_setMaxLimit(){const e=this.previewTextCharCounter.getPreviewTextCharCount()+this.args.textBlock.content.text.length
|
|
this.previewTextCharCounter.setPreviewTextCharCount(e)
|
|
this.previewTextCharCounter.incrementParagraphCount()}},g=(0,i.default)(b.prototype,"previewTextCharCounter",[h],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),b))}))
|
|
define.alias("ember-vector-images/components/custom-image","article-reader/components/custom-image")
|
|
define("article-reader/components/draft-preview/draft-preview-content",["exports","@ember/template-factory","@ember/component","@glimmer/component","article-reader/components/content-blocks"],(function(e,t,r,i,l){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class n extends i.default{get hasContentBlocks(){var e
|
|
return(null===(e=this.args.content)||void 0===e?void 0:e.length)>0}}e.default=n;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"IN3mIaXX",block:'[[[1,"\\n "],[10,"section"],[15,"dir",[30,1]],[15,0,[29,["reader-article-preview__content\\n ",[52,[51,[30,0,["hasContentBlocks"]]],"reader-article-content--legacy-html"]]]],[12],[1,"\\n"],[41,[30,0,["hasContentBlocks"]],[[[1," "],[8,[32,0],null,[["@contentBlocks","@isUsingDashAndGraphQL"],[[30,2],true]],null],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "]],["@textDirection","@content"],false,["unless","if"]]',moduleName:"article-reader/components/draft-preview/draft-preview-content.gts",scope:()=>[l.default],isStrictMode:!0}),n)}))
|
|
define("article-reader/components/draft-preview/draft-preview-footer",["exports","@ember/template-factory","@ember/component","article-reader/components/article-footer-info","@glimmer/component","article-reader/components/draft-preview/static-social-details-actions","article-reader/components/draft-preview/static-social-details-comment-group","article-reader/components/ugc-post-bar"],(function(e,t,r,i,l,n,a,o){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class s extends l.default{get seriesLogo(){var e,t,r,i,l
|
|
return null===(e=this.args.series)||void 0===e||null===(t=e.logo)||void 0===t||null===(r=t.attributes)||void 0===r||null===(i=r[0])||void 0===i||null===(l=i.detailData)||void 0===l?void 0:l.vectorImage}}e.default=s;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"1em0rz5E",block:'[[[1,"\\n "],[10,"footer"],[14,0,"reader-article-preview__footer"],[12],[1,"\\n"],[1," "],[8,[32,0],[[24,0,"pt6"]],[["@authorActor","@imageType","@isFollowing","@totalArticles","@viewerAllowedToEdit","@isUsingDashAndGql","@isPreviewOnlyMode"],[[30,1],[30,2],[30,3],[30,4],[30,5],true,true]],null],[1,"\\n\\n "],[10,0],[14,0,"reader-article-preview__footer-series-group"],[12],[1,"\\n "],[8,[32,1],null,null,null],[1,"\\n "],[13],[1,"\\n\\n "],[8,[32,2],null,[["@viewerAllowedToEdit"],[[30,5]]],null],[1,"\\n\\n"],[1," "],[8,[32,3],null,[["@series","@seriesLogo","@newsletterId","@isSubscribed","@seriesSubscriberCount","@viewerAllowedToEdit","@isFollowing","@authorActor"],[[30,6],[30,0,["seriesLogo"]],[30,7],[30,8],[30,9],[30,5],[30,3],[30,1]]],null],[1,"\\n "],[13],[1,"\\n "]],["@authorActor","@imageType","@isFollowing","@totalArticles","@viewerAllowedToEdit","@series","@newsletterId","@isSubscribed","@seriesSubscriberCount"],false,[]]',moduleName:"article-reader/components/draft-preview/draft-preview-footer.gts",scope:()=>[o.default,n.default,a.default,i.default],isStrictMode:!0}),s)}))
|
|
define("article-reader/components/draft-preview/draft-preview-header",["exports","@ember/template-factory","@ember/component","@glimmer/component","article-reader/components/series-reader-header","article-reader/components/article-cover-image","article-reader/utils/shared-article-getters","article-reader/components/author-info"],(function(e,t,r,i,l,n,a,o){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class s extends i.default{get thirdPartyArticleId(){return(0,a.getThirdPartyArticleId)(this.args.linkedInArticleUrn)}}e.default=s;(0,r.setComponentTemplate)((0,t.createTemplateFactory)({id:"XvdS3nm7",block:'[[[1,"\\n "],[10,"header"],[14,0,"reader-article-preview__header"],[12],[1,"\\n"],[41,[30,1],[[[1," "],[8,[32,0],null,[["@newsletterId","@numberOfSubscribers","@series","@thirdPartyArticleId","@viewerAllowedToEdit","@isPreviewOnlyMode","@isUsingDashAndGql"],[[30,2],[30,3],[30,1],[30,0,["thirdPartyArticleId"]],[30,4],true,true]],null],[1,"\\n"]],[]],null],[1,"\\n "],[8,[32,1],null,[["@articleCoverMedia","@isFirstPartyArticleDashAndGqlEnabled"],[[30,5],true]],null],[1,"\\n\\n "],[10,"h1"],[15,"dir",[30,6]],[14,0,"text-display-large-bold mt6"],[12],[1,"\\n "],[1,[30,7]],[1,"\\n "],[13],[1,"\\n\\n "],[10,0],[14,0,"mv6"],[12],[1,"\\n "],[8,[32,2],null,[["@authorActor","@imageType","@isFollowing","@series","@totalArticles","@viewerAllowedToEdit"],[[30,8],[30,9],[30,10],[30,1],[30,11],[30,4]]],null],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "]],["@series","@newsletterId","@seriesSubscriberCount","@viewerAllowedToEdit","@articleCoverMedia","@textDirection","@articleTitle","@authorActor","@imageType","@isFollowing","@totalArticles"],false,["if"]]',moduleName:"article-reader/components/draft-preview/draft-preview-header.gts",scope:()=>[l.default,n.default,o.default],isStrictMode:!0}),s)}))
|
|
define("article-reader/components/draft-preview/share-draft-modal",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","ember-cli-pemberly-i18n/helpers/t","artdeco-button/components/artdeco-button","artdeco-modal/components/artdeco-modal","@glimmer/component","@ember/object","@ember/service","@glimmer/tracking","article-reader/components/-private/i18n-strings","ember-cli-pemberly-tracking/modifiers/track-interaction","@ember/modifier"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var y,v,_,A,w,T,k,E
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"bzRzz9Yt",block:'[[[1,"\\n"],[1," "],[8,[32,0],null,[["@isOpen","@dismissModal","@overlayClasses","@size"],[[30,1],[30,2],"display-flex align-items-center","medium"]],[["default"],[[[[1,"\\n "],[8,[30,3,["artdeco-modal-header"]],[[24,0,"reader-article-preview-share-modal__header"]],null,[["default"],[[[[1,"\\n "],[10,"h1"],[14,1,"share-draft-modal-header"],[14,0,"reader-article-preview-share-modal__header-text"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_share_draft","article-reader/components/draft-preview/share-draft-modal"],null]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[30,3,["artdeco-modal-content"]],[[24,0,"p5"]],[["@hasPadding"],[false]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"reader-article-preview-share-modal__content"],[12],[1,"\\n "],[10,"h1"],[14,0,"text-heading-large"],[12],[1,[28,[32,1],["i18n_draft_url","article-reader/components/draft-preview/share-draft-modal"],null]],[13],[1,"\\n "],[10,2],[14,0,"text-body-small"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_copy_and_send_prompt","article-reader/components/draft-preview/share-draft-modal"],null]],[1,"\\n "],[13],[1,"\\n\\n "],[10,0],[14,0,"reader-article-preview-share-modal__content-link-container"],[12],[1,"\\n "],[10,2],[14,0,"text-body-small"],[12],[1,[30,4]],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[30,3,["artdeco-modal-footer"]],null,null,[["default"],[[[[1,"\\n "],[10,0],[14,0,"reader-article-preview-share-modal__footer"],[12],[1,"\\n "],[8,[32,2],[[4,[32,3],["click",[30,2]],null]],[["@text","@type"],[[28,[32,1],["i18n_cancel","article-reader/components/draft-preview/share-draft-modal"],null],"secondary"]],null],[1,"\\n "],[8,[32,2],[[4,[32,3],["click",[30,0,["onCopyClick"]]],null],[4,[32,4],["share_draft"],null]],[["@text"],[[28,[32,1],["i18n_copy","article-reader/components/draft-preview/share-draft-modal"],null]]],null],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[3]]]]],[1,"\\n "]],["@isOpen","@dismissModal","modal","@shareDraftLink"],false,[]]',moduleName:"article-reader/components/draft-preview/share-draft-modal.gts",scope:()=>[d.default,s.default,c.default,g.on,b.default],isStrictMode:!0}),(y=(0,m.inject)("global-services@clipboard"),v=(0,m.inject)("i18n"),_=(0,m.inject)("persistent-toast-manager@persistent-toast-manager"),A=class extends u.default{constructor(){super(...arguments);(0,t.default)(this,"clipboard",w,this);(0,t.default)(this,"i18n",T,this);(0,t.default)(this,"persistentToastManager",k,this);(0,t.default)(this,"isCopied",E,this)}onCopyClick(){this.clipboard.copyToClipboard(this.args.shareDraftLink)
|
|
this.args.dismissModal()
|
|
const e=this.i18n.lookupTranslation(h.default,"i18n_link_copied_to_clipboard")()
|
|
this.persistentToastManager.success({message:e})}},w=(0,i.default)(A.prototype,"clipboard",[y],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),T=(0,i.default)(A.prototype,"i18n",[v],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),k=(0,i.default)(A.prototype,"persistentToastManager",[_],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),E=(0,i.default)(A.prototype,"isCopied",[f.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),(0,i.default)(A.prototype,"onCopyClick",[p.action],Object.getOwnPropertyDescriptor(A.prototype,"onCopyClick"),A.prototype),A))}))
|
|
define("article-reader/components/draft-preview/static-social-details-actions",["exports","@ember/template-factory","@ember/component/template-only","@ember/component","social-details/components/social-activity-v2","social-share/components/social-share","hue-web-icons/components/icon","ember-cli-pemberly-i18n/helpers/t"],(function(e,t,r,i,l,n,a,o){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const s=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"XPw9jlJw",block:'[[[1,"\\n"],[1," "],[10,0],[14,0,"reader-article-preview__social-bar"],[12],[1,"\\n"],[1," "],[8,[32,0],null,[["@socialDetail"],[null]],[["default"],[[[[1,"\\n "],[8,[30,1,["socialActions"]],[[24,0,"reader-article-preview__social-actions"]],[["@disableAllSocialActions"],[true]],[["default"],[[[[1,"\\n "],[8,[30,2,["reactButton"]],null,null,null],[1,"\\n "],[8,[30,2,["commentButton"]],null,null,null],[1,"\\n"],[1," "],[8,[32,1],null,null,[["default"],[[[[1,"\\n "],[8,[30,3,["dropdown-trigger"]],[[24,"disabled",""]],[["@class"],["social-share__dropdown-trigger artdeco-button artdeco-button--4 artdeco-button--tertiary artdeco-button--muted"]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"display-flex align-items-center"],[12],[1,"\\n "],[8,[32,2],[[24,0,"artdeco-button__icon"],[24,"disabled",""]],[["@type","@name","@size"],["system","share-linkedin","medium"]],null],[1,"\\n "],[10,1],[14,0,"artdeco-button__text"],[14,"disabled",""],[12],[1,[28,[32,3],["i18n_share","article-reader/components/draft-preview/static-social-details-actions"],null]],[13],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[3]]]]],[1,"\\n "]],[2]]]]],[1,"\\n "]],[1]]]]],[1,"\\n "],[13],[1,"\\n"]],["components","actionComponents","dropdown"],false,[]]',moduleName:"article-reader/components/draft-preview/static-social-details-actions.gts",scope:()=>[l.default,n.default,a.default,o.default],isStrictMode:!0}),(0,r.default)("static-social-details-actions","StaticSocialDetailsActions"))
|
|
e.default=s}))
|
|
define("article-reader/components/draft-preview/static-social-details-comment-group",["exports","@ember/template-factory","@ember/component/template-only","@ember/component","social-details/components/social-activity-v2","ember-cli-pemberly-i18n/helpers/t"],(function(e,t,r,i,l,n){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const a=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"DEPOoIdv",block:'[[[1,"\\n"],[1," "],[8,[32,0],null,[["@isCurrentUserAuthor","@isUsingSocialShare"],[[30,1],true]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"pb4"],[12],[1,"\\n "],[10,"h3"],[14,0,"t-18 t-black"],[12],[1,"\\n "],[10,1],[12],[1,"\\n "],[1,[28,[32,1],["i18n_article_num_comments","article-reader/components/draft-preview/static-social-details-comment-group"],[["commentsCount"],[0]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[8,[30,2,["commentBox"]],[[24,0,"reader-article-preview-social-comment-group__comment-box"],[24,"data-scroll-name","comments-anchor"]],[["@shouldShowCommentBoxAvatar","@disabled","@hideDetourButtons"],[true,true,true]],null],[1,"\\n "]],[2]]]]],[1,"\\n"]],["@viewerAllowedToEdit","components"],false,[]]',moduleName:"article-reader/components/draft-preview/static-social-details-comment-group.gts",scope:()=>[l.default,n.default],isStrictMode:!0}),(0,r.default)("static-social-details-comment-group","StaticSocialDetailsCommentGroup"))
|
|
e.default=a}))
|
|
define("article-reader/components/draft-preview/sticky-bar",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component/template-only","@ember/component","global-helpers/helpers/eq","artdeco-button/components/artdeco-button","ember-cli-pemberly-i18n/helpers/t","@glimmer/component","@ember/service","global-helpers/helpers/urn-to-id","@ember/object","article-reader/components/draft-preview/static-social-details-actions","@ember/modifier","ember-cli-pemberly-tracking/modifiers/track-interaction"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var v,_,A
|
|
const w=(0,s.setComponentTemplate)((0,n.createTemplateFactory)({id:"ckZ+o4ar",block:'[[[1,"\\n"],[1," "],[10,0],[14,0,"reader-article-preview__author-toolbar-content"],[12],[1,"\\n "],[8,[32,0],[[4,[32,2],["click",[30,1]],null],[4,[32,3],["back_to_edit_draft"],null]],[["@color","@icon","@text","@type"],["muted","arrow-left-icon",[28,[32,1],["i18n_back_to_edit","article-reader/components/draft-preview/sticky-bar"],null],"secondary"]],null],[1,"\\n "],[10,2],[14,0,"reader-article-preview__toolbar-text reader-article-preview__author-toolbar-text"],[12],[1,[28,[32,1],["i18n_viewing_your_draft","article-reader/components/draft-preview/sticky-bar"],null]],[13],[1,"\\n "],[10,0],[14,0,"reader-article-preview__author-toolbar-controls"],[12],[1,"\\n "],[8,[32,0],[[4,[32,2],["click",[30,2]],null],[4,[32,3],["share_draft_intent"],null]],[["@text","@type"],[[28,[32,1],["i18n_share_draft","article-reader/components/draft-preview/sticky-bar"],null],"secondary"]],null],[1,"\\n "],[8,[32,0],[[4,[32,2],["click",[30,3]],null],[4,[32,3],["publish_draft_intent"],null]],[["@text"],[[28,[32,1],["i18n_publish","article-reader/components/draft-preview/sticky-bar"],null]]],null],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n"]],["@goToEdit","@onShareDraft","@onPublish"],false,[]]',moduleName:"article-reader/components/draft-preview/sticky-bar.gts",scope:()=>[d.default,u.default,g.on,y.default],isStrictMode:!0}),(0,o.default)("sticky-bar","AuthorToolbar")),T=(0,s.setComponentTemplate)((0,n.createTemplateFactory)({id:"hV7iuB5m",block:'[[[1,"\\n"],[1," "],[10,2],[14,0,"reader-article-preview__toolbar-text reader-article-preview__viewer-toolbar-text"],[12],[1,[28,[32,0],["i18n_you_are_viewing_article","article-reader/components/draft-preview/sticky-bar"],[["name"],[[30,1]]]]],[13],[1,"\\n"]],["@authorName"],false,[]]',moduleName:"article-reader/components/draft-preview/sticky-bar.gts",scope:()=>[u.default],isStrictMode:!0}),(0,o.default)("sticky-bar","ViewerToolbar"))
|
|
e.default=(0,s.setComponentTemplate)((0,n.createTemplateFactory)({id:"Nl7C+X13",block:'[[[1,"\\n "],[10,0],[15,0,[29,["reader-article-preview__sticky-bar\\n ",[52,[28,[32,0],[[30,1],"top"],null],"reader-article-preview__sticky-bar--top","reader-article-preview__sticky-bar--bottom"]]]],[12],[1,"\\n"],[41,[28,[32,0],[[30,1],"top"],null],[[[41,[30,2],[[[1," "],[8,[32,1],null,[["@goToEdit","@onPublish","@onShareDraft"],[[30,0,["goToEdit"]],[30,3],[30,4]]],null],[1,"\\n"]],[]],[[[1," "],[8,[32,2],null,[["@authorName"],[[30,5]]],null],[1,"\\n"]],[]]]],[]],[[[1," "],[8,[32,3],null,null,null],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n "]],["@position","@viewerHasAccess","@onPublish","@onShareDraft","@authorName"],false,["if"]]',moduleName:"article-reader/components/draft-preview/sticky-bar.gts",scope:()=>[c.default,w,T,b.default],isStrictMode:!0}),(v=(0,m.inject)("router"),_=class extends p.default{constructor(){super(...arguments);(0,t.default)(this,"router",A,this)}goToEdit(){this.router.transitionTo("article-editor.index.edit",(0,f.urnToId)([this.args.articleUrn]))}},A=(0,i.default)(_.prototype,"router",[v],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),(0,i.default)(_.prototype,"goToEdit",[h.action],Object.getOwnPropertyDescriptor(_.prototype,"goToEdit"),_.prototype),_))}))
|
|
define("article-reader/components/draggable-object-target",["exports","ember-drag-drop/components/draggable-object-target"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default}))
|
|
define("article-reader/components/draggable-object",["exports","ember-drag-drop/components/draggable-object"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default}))
|
|
define.alias("ember-cloud-filepicker/components/dropbox-file-picker","article-reader/components/dropbox-file-picker")
|
|
define.alias("ember-semaphore/components/ember-semaphore","article-reader/components/ember-semaphore")
|
|
define.alias("ember-wormhole/components/ember-wormhole","article-reader/components/ember-wormhole")
|
|
define.alias("ember-cloud-filepicker/components/file-picker","article-reader/components/file-picker")
|
|
define.alias("ember-finite-scroll/components/finite-scroll","article-reader/components/finite-scroll")
|
|
define("article-reader/components/follow-button",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/component","global-utils/utils/urn-converter","graphql-queries/queries/organizations/member-company-by-company-urns.graphql","feed-requests/update-actions","data-layer/utils/organization/resource-to-url-map","@glimmer/tracking","@glimmer/component","@ember/service","@ember/utils","@ember/object","@ember/destroyable","ember-wormhole/components/ember-wormhole","follows/components/follow-button","artdeco-loader/components/artdeco-loader"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var _,A,w,T,k,E,C,O,D,S,P,I
|
|
e.default=(0,a.setComponentTemplate)((0,n.createTemplateFactory)({id:"0HyLr+3S",block:'[[[1,"\\n"],[41,[30,0,["isReadyToRender"]],[[[1," "],[8,[32,0],null,[["@destinationElement"],[[30,1]]],[["default"],[[[[1,"\\n "],[8,[32,1],[[24,0,"slate-resizable-image-embed__follow-button artdeco-button artdeco-button--secondary m4"]],[["@showText","@iconType","@controlName","@isFollowing","@toggleFollow"],[true,"add","follow_toggle_bottom_bar",[30,0,["followingState","following"]],[30,0,["onToggleFollow"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],[[[1," "],[8,[32,0],null,[["@destinationElement"],[[30,1]]],[["default"],[[[[1,"\\n "],[8,[32,2],null,[["@size","@class"],["small","slate-resizable-image-embed__loader"]],null],[1,"\\n "]],[]]]]],[1,"\\n"]],[]]],[1," "]],["@destinationElement"],false,["if"]]',moduleName:"article-reader/components/follow-button.gjs",scope:()=>[g.default,y.default,v.default],isStrictMode:!0}),(_=(0,m.inject)("global-services@store-shim"),A=(0,m.inject)("i18n"),w=(0,m.inject)("@linkedin/ember-restli-graphql@graphql"),T=(0,m.inject)("lix"),k=(0,m.inject)("persistent-toast-manager@persistent-toast-manager"),E=class e extends p.default{constructor(){super(...arguments);(0,t.default)(this,"storeShim",C,this);(0,t.default)(this,"i18n",O,this);(0,t.default)(this,"graphql",D,this);(0,t.default)(this,"lix",S,this);(0,t.default)(this,"persistentToastManager",P,this);(0,t.default)(this,"entityCard",I,this)
|
|
this._setEntity()}get followingState(){var e
|
|
return null===(e=this.entityCard)||void 0===e?void 0:e.followingState}get isFirstPartyArticleDashAndGqlEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.publishing-graphql-first-party-article")}get isReadyToRender(){var e,t
|
|
return!(0,f.isEmpty)(null===(e=this.entityCard)||void 0===e||null===(t=e.followingState)||void 0===t?void 0:t.following)}_setEntity(){if("company"===this.args.entityType){const t=(0,o.toUrn)("fsd_company",this.args.entityId),r=(0,d.buildFullUrl)(d.urlsMap.OrganizationDashCompaniesResource,this.args.entityId)
|
|
this.graphql.executeQuery(s.default,{companyUrns:[t]},{adapterOptions:{url:r}}).catch((t=>{if((0,b.isDestroying)(this))throw t
|
|
const r=this.args.destinationElement.querySelector(".loader")
|
|
r&&this.args.destinationElement.removeChild(r)
|
|
console.error("Failed to toggle follow",t)
|
|
const i=this.i18n.lookupTranslation(e,"i18n_article_reader_follow_state__error")()
|
|
this.persistentToastManager.error({message:i})
|
|
if(t&&t.isAdapterError)return{}
|
|
throw t})).then((e=>{if(!this.isDestroying){var t,r
|
|
this.entityCard=null===(t=e.data)||void 0===t||null===(r=t.organizationDashCompaniesByIds)||void 0===r?void 0:r[0]}}))}}onToggleFollow(){this.storeShim.adapterFor("-ember-m3").ajax(...(0,c.toggleFollowWithFollowingInfoRequest)(this.followingState,"NON_SSU",!0,this.isFirstPartyArticleDashAndGqlEnabled)).catch((t=>{if((0,b.isDestroying)(this))throw t
|
|
console.error("Failed to toggle follow",t)
|
|
const r=this.i18n.lookupTranslation(e,"i18n_article_reader_follow_error")()
|
|
this.persistentToastManager.error({message:r})
|
|
throw t}))}},C=(0,i.default)(E.prototype,"storeShim",[_],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),O=(0,i.default)(E.prototype,"i18n",[A],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),D=(0,i.default)(E.prototype,"graphql",[w],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),S=(0,i.default)(E.prototype,"lix",[T],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),P=(0,i.default)(E.prototype,"persistentToastManager",[k],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),I=(0,i.default)(E.prototype,"entityCard",[u.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),(0,i.default)(E.prototype,"onToggleFollow",[h.action],Object.getOwnPropertyDescriptor(E.prototype,"onToggleFollow"),E.prototype),E))}))
|
|
define("article-reader/components/gated-article-banner",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","ember-cli-pemberly-i18n/helpers/t","@glimmer/component","artdeco-button/components/artdeco-button","@glimmer/tracking","global-utils/utils/is-browser","global-utils/utils/intersection-observer","ember-lifeline","@ember/modifier"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var b,g,y,v
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"Y5wXaubJ",block:'[[[1,"\\n"],[1," "],[10,"section"],[15,0,[29,["reader-gated-article-banner-sticky\\n ",[52,[30,0,["isVisible"]],"reader-gated-article-banner-sticky--visible"]]]],[12],[1,"\\n "],[10,0],[14,0,"ml4 mr9 p4"],[12],[1,"\\n "],[10,"h3"],[14,0,"t-bold"],[12],[1,"\\n "],[1,[28,[32,0],["i18n_gated_article_banner_heading","article-reader/components/gated-article-banner"],null]],[1,"\\n "],[13],[1,"\\n "],[10,2],[14,0,"pt2 t-12 t-black--light"],[12],[1,"\\n "],[1,[28,[32,0],["i18n_gated_article_banner_subheading","article-reader/components/gated-article-banner"],[["authorActor"],[[30,1,["authorName"]]]]]],[1,"\\n "],[13],[1,"\\n "],[10,0],[14,0,"mt5"],[12],[1,"\\n "],[8,[32,1],[[4,[32,2],["click",[30,2]],null]],[["@controlType","@type","@size","@text","@aria-label"],["button","primary",3,[28,[32,0],["i18n_gated_article_banner_primary_button","article-reader/components/gated-article-banner"],null],[28,[32,0],["i18n_gated_article_banner_primary_button","article-reader/components/gated-article-banner"],null]]],null],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[10,0],[14,0,"reader-gated-article-banner-illustration"],[12],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "]],["@authorActor","@onGatedBannerCTAClick"],false,["if"]]',moduleName:"article-reader/components/gated-article-banner.gjs",scope:()=>[s.default,d.default,h.on],isStrictMode:!0}),(b=class extends c.default{constructor(){super(...arguments);(0,t.default)(this,"isReaderArticleContentIntersecting",g,this);(0,t.default)(this,"isBannerVisibleOnce",y,this);(0,t.default)(this,"isScrolled",v,this);(0,r.default)(this,"readerArticleContentObserver",null)
|
|
this._setupEventListeners()
|
|
this._setupIntersectionObservers()}willDestroy(){var e
|
|
super.willDestroy(...arguments)
|
|
null===(e=this.readerArticleContentObserver)||void 0===e||e.disconnect()}get isVisible(){return this.isReaderArticleContentIntersecting||this.isBannerVisibleOnce}_setupEventListeners(){p.default&&(0,f.addEventListener)(this,window,"scroll",(()=>{this.isScrolled=!0}),{once:!0})}_handleReaderArticleContentIntersection(e){this.isReaderArticleContentIntersecting=e[0].isIntersecting
|
|
this.isReaderArticleContentIntersecting&&(this.isBannerVisibleOnce=!0)}_setupIntersectionObservers(){if(p.default){const t=document.querySelector(".reader-article-content")
|
|
this.readerArticleContentObserver=new m.default(this._handleReaderArticleContentIntersection.bind(this),{threshold:.5})
|
|
if(t){var e
|
|
null===(e=this.readerArticleContentObserver)||void 0===e||e.observe(t)}}}},g=(0,i.default)(b.prototype,"isReaderArticleContentIntersecting",[u.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),y=(0,i.default)(b.prototype,"isBannerVisibleOnce",[u.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),v=(0,i.default)(b.prototype,"isScrolled",[u.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),b))}))
|
|
define.alias("ember-cloud-filepicker/components/google-drive-file-picker","article-reader/components/google-drive-file-picker")
|
|
define("article-reader/components/header-subscribe-button",["exports","@ember/template-factory","@ember/helper","@ember/component/template-only","@ember/component","artdeco-button/components/artdeco-button","ember-cli-pemberly-tracking/modifiers/track-interaction","@ember/modifier"],(function(e,t,r,i,l,n,a,o){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const s=(0,l.setComponentTemplate)((0,t.createTemplateFactory)({id:"QiHpZ3PO",block:'[[[1,"\\n"],[41,[30,1],[[[1," "],[8,[32,0],[[24,0,"series-reader-header__subscribe-button flex-shrink-zero"],[4,[32,1],["click",[30,5]],null],[4,[32,2],["series_subscribe_toggle"],null]],[["@color","@icon","@size","@text","@type"],["muted",[52,[30,2],"check","add"],2,[52,[30,2],[30,3],[30,4]],"tertiary"]],null],[1,"\\n"]],[]],[[[1," "],[8,[32,0],[[24,0,"series-reader-header__subscribe-button flex-shrink-zero"],[4,[32,1],["click",[30,5]],null],[4,[32,2],["series_subscribe_toggle"],null]],[["@color","@icon","@size","@text","@type"],["default",[52,[30,2],"check","add"],2,[52,[30,2],[30,3],[30,4]],[52,[30,2],"secondary","primary"]]],null],[1,"\\n"]],[]]]],["@displayTertiaryButtonStyle","@isSubscribedToSeries","@subscribedText","@subscribeText","@onToggleSubscribeSeriesAction"],false,["if"]]',moduleName:"article-reader/components/header-subscribe-button.gjs",scope:()=>[n.default,o.on,a.default],isStrictMode:!0}),(0,i.default)("header-subscribe-button","HeaderSubscribeButton"))
|
|
e.default=s}))
|
|
define.alias("ember-highcharts/components/high-charts","article-reader/components/high-charts")
|
|
define.alias("image-editor/components/image-editor-loader","article-reader/components/image-editor-loader")
|
|
define.alias("image-editor/components/image-editor","article-reader/components/image-editor")
|
|
define.alias("ember-finite-scroll/components/item-container","article-reader/components/item-container")
|
|
define.alias("ember-vector-images/components/lazy-background","article-reader/components/lazy-background")
|
|
define.alias("ember-vector-images/components/lazy-image","article-reader/components/lazy-image")
|
|
define.alias("ember-line-clamp/components/line-clamp","article-reader/components/line-clamp")
|
|
define.alias("artdeco-icons-web/components/linkedin-logo","article-reader/components/linkedin-logo")
|
|
define.alias("ember-cloud-filepicker/components/local-file-input","article-reader/components/local-file-input")
|
|
define.alias("ember-media-player/components/media-player","article-reader/components/media-player")
|
|
define("article-reader/components/object-bin",["exports","ember-drag-drop/components/object-bin"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default}))
|
|
define.alias("ember-cloud-filepicker/components/onedrive-file-picker","article-reader/components/onedrive-file-picker")
|
|
define("article-reader/components/overflow-options",["exports","@ember/template-factory","@ember/helper","@ember/component/template-only","@ember/component","@ember/modifier","ember-cli-pemberly-tracking/modifiers/track-interaction","ember-cli-pemberly-i18n/helpers/t","artdeco-modal/components/artdeco-confirmation-dialog","trust/components/reporting-flow-modal"],(function(e,t,r,i,l,n,a,o,s,c){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const d=(0,l.setComponentTemplate)((0,t.createTemplateFactory)({id:"gkvbOkxu",block:'[[[1,"\\n"],[1," "],[10,0],[14,0,"justify-flex-end mb4 clear-both"],[12],[1,"\\n "],[11,"button"],[24,0,"reader-flag-content"],[24,4,"button"],[4,[32,0],["click",[30,1]],null],[4,[32,1],["click_spam"],null],[12],[1,"\\n "],[1,[28,[32,2],["i18n_report_this","article-reader/components/overflow-options"],null]],[1,"\\n "],[13],[1,"\\n\\n"],[41,[30,2],[[[1," "],[10,0],[14,0,"reader-overflow-options-divider"],[12],[13],[1,"\\n\\n "],[11,"button"],[24,0,"reader-flag-content"],[24,4,"button"],[4,[32,0],["click",[30,3]],null],[4,[32,1],["click_remove_mention"],null],[12],[1,"\\n "],[1,[28,[32,2],["i18n_remove_mention","article-reader/components/overflow-options"],null]],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n\\n "],[8,[32,3],null,[["@content","@isOpen","@onEscape","@onPrimary","@onSecondary","@primaryActionText","@secondaryActionText","@title"],[[28,[32,2],["i18n_remove_mention_dialog_body","article-reader/components/overflow-options"],null],[30,4],[30,5],[30,6],[30,5],[28,[32,2],["i18n_remove_button","article-reader/components/overflow-options"],null],[28,[32,2],["i18n_cancel_button","article-reader/components/overflow-options"],null],[28,[32,2],["i18n_remove_mention_confirmation","article-reader/components/overflow-options"],null]]],null],[1,"\\n\\n"],[41,[30,7],[[[1," "],[8,[32,4],null,[["@entityUrn","@contentSource","@authorUrn","@success","@failure","@cancel","@isDisinterestOptionEnabled"],[[30,8],"PONCHO_ARTICLE",[30,9],[30,10],[30,11],[30,12],false]],null],[1,"\\n"]],[]],null]],["@onReportClick","@isMentionedInArticle","@openRemoveMentionDialog","@showRemoveMentionDialog","@closeRemoveMentionDialog","@removeMention","@isReporting","@articleUrn","@articleAuthorDashProfileUrn","@onReportSuccess","@onReportFailure","@onReportCancel"],false,["if"]]',moduleName:"article-reader/components/overflow-options.gjs",scope:()=>[n.on,a.default,o.default,s.default,c.default],isStrictMode:!0}),(0,i.default)("overflow-options","OverflowOptions"))
|
|
e.default=d}))
|
|
define("article-reader/components/page-post-publish-modal",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/component","global-utils/utils/url","feed-utils/utils/share-via","ember-lifeline","@glimmer/tracking","@glimmer/component","@ember/service","@ember/object","sharing-entry/components/share-button","artdeco-modal/components/artdeco-modal","ember-cli-pemberly-i18n/helpers/t","artdeco-button/components/artdeco-button","artdeco-entity-lockup/components/artdeco-entity-lockup","feed-components-shared/components/avatar-image","@ember/helper","@ember/modifier"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var w,T,k,E,C,O,D,S,P,I
|
|
e.default=(0,a.setComponentTemplate)((0,n.createTemplateFactory)({id:"2GvwW6/x",block:'[[[1,"\\n"],[1," "],[8,[32,0],null,[["@shareOrigin","@urlToShare"],["PUBLISHING",[30,0,["articleUrl"]]]],[["default"],[[[[1,"\\n "],[8,[32,1],null,[["@dismissModal","@headerId","@isOpen","@size"],[[30,0,["closeModal"]],"page-post-publish-modal__header",[30,0,["isOpen"]],"medium"]],[["default"],[[[[1,"\\n "],[8,[30,2,["artdeco-modal-header"]],null,[["@classNames"],["text-align-center"]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"page-post-publish-modal__shooting-star"],[12],[13],[1,"\\n "],[10,"h2"],[14,1,"page-post-publish-modal__header"],[12],[1,"\\n "],[1,[28,[32,2],["i18n_congrats_header","article-reader/components/page-post-publish-modal"],[["pageName"],[[30,3]]]]],[1,"\\n "],[13],[1,"\\n "],[8,[32,3],[[4,[32,4],["click",[30,0,["copyToClipboard"]]],null]],[["@class","@icon","@text","@type"],["mb1","link",[28,[32,2],["i18n_copy_link","article-reader/components/page-post-publish-modal"],null],"tertiary"]],null],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[30,2,["artdeco-modal-content"]],null,[["@classNames"],["display-flex align-items-center ph5 pt4"]],[["default"],[[[[1,"\\n "],[8,[32,5],null,[["@size"],[3]],[["default"],[[[[1,"\\n "],[8,[30,4,["image"]],null,[["@type"],["circle"]],[["default"],[[[[1,"\\n "],[8,[32,6],null,[["@alt","@avatar","@avatarEntityClassSize","@avatarType","@miniProfile"],[[30,0,["authorFullName"]],[30,5,["picture"]],2,"member",[30,5]]],null],[1,"\\n "]],[]]]]],[1,"\\n "],[8,[30,4,["content"]],[[24,0,"align-self-flex-start pl2"]],null,[["default"],[[[[1,"\\n "],[8,[30,4,["title"]],null,null,[["default"],[[[[1,"\\n "],[10,"h3"],[14,0,"t-12"],[12],[1,[28,[32,2],["i18n_increase_shares","article-reader/components/page-post-publish-modal"],null]],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[4]]]]],[1,"\\n "],[8,[32,3],[[4,[32,4],["click",[28,[32,7],[[30,0,["onShareClick"]],[30,1]],null]],null]],[["@text","@type"],[[28,[32,2],["i18n_share","article-reader/components/page-post-publish-modal"],null],"secondary"]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[2]]]]],[1,"\\n "]],[1]]]]],[1,"\\n "]],["openShareboxModal","modal","@pageName","elements","@user"],false,[]]',moduleName:"article-reader/components/page-post-publish-modal.gjs",scope:()=>[f.default,h.default,b.default,g.default,A.on,y.default,v.default,_.fn],isStrictMode:!0}),(w=(0,p.inject)("global-services@clipboard"),T=(0,p.inject)("formatter"),k=(0,p.inject)("i18n"),E=(0,p.inject)("persistent-toast-manager@persistent-toast-manager"),C=class extends u.default{constructor(){super(...arguments);(0,t.default)(this,"clipboard",O,this);(0,t.default)(this,"formatter",D,this);(0,t.default)(this,"i18n",S,this);(0,t.default)(this,"persistentToastManager",P,this);(0,t.default)(this,"isOpen",I,this)}get articleUrl(){const e=this.args.permalink??""
|
|
return(0,o.generateLiExternalUrl)(`/pulse/${e}`)}get authorFullName(){return this.formatter.formatName(this.args.user,"full")}copyToClipboard(){(0,s.default)(this.clipboard,this.i18n,this.persistentToastManager,this.articleUrl)}closeModal(){var e,t
|
|
this.isOpen=!1
|
|
null===(e=(t=this.args).onClose)||void 0===e||e.call(t)}onShareClick(e){this.isOpen=!1;(0,c.scheduleTask)(this,"render",e)}},O=(0,i.default)(C.prototype,"clipboard",[w],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),D=(0,i.default)(C.prototype,"formatter",[T],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),S=(0,i.default)(C.prototype,"i18n",[k],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),P=(0,i.default)(C.prototype,"persistentToastManager",[E],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),I=(0,i.default)(C.prototype,"isOpen",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!0}}),(0,i.default)(C.prototype,"copyToClipboard",[m.action],Object.getOwnPropertyDescriptor(C.prototype,"copyToClipboard"),C.prototype),(0,i.default)(C.prototype,"closeModal",[m.action],Object.getOwnPropertyDescriptor(C.prototype,"closeModal"),C.prototype),(0,i.default)(C.prototype,"onShareClick",[m.action],Object.getOwnPropertyDescriptor(C.prototype,"onShareClick"),C.prototype),C))}))
|
|
define("article-reader/components/post-publish-modal",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/component","social-share/utils/social-share-constants","social-share/utils/social-share-utils","feed-utils/utils/share-via","global-utils/utils/url","global-utils/utils/is-browser","@ember/object","@ember/debug","@ember/service","@glimmer/component","artdeco-modal/components/artdeco-modal","ember-cli-pemberly-i18n/helpers/t","ember-cli-pemberly-i18n/helpers/format-name","@ember/modifier","@ember/helper","hue-web-icons/components/icon","artdeco-button/components/artdeco-button"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A,w){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var T,k,E,C,O,D,S,P,I,N,R
|
|
e.default=(0,a.setComponentTemplate)((0,n.createTemplateFactory)({id:"Rcp0udoQ",block:'[[[1,"\\n"],[1," "],[8,[32,0],null,[["@isOpen","@headerId","@dismissModal","@modalClasses","@size"],[[30,0,["isOpen"]],"post-publish-modal__header",[30,0,["closeModal"]],"post-publish-modal","medium"]],[["default"],[[[[1,"\\n "],[8,[30,1,["artdeco-modal-header"]],null,[["@classNames"],["post-publish-modal__header"]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"post-publish-modal__shooting-star"],[12],[13],[1,"\\n "],[10,"h2"],[14,1,"post-publish-modal__header"],[14,0,"t-24 t-black t-normal text-align-center"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_congrats_header","article-reader/components/post-publish-modal"],[["name"],[[28,[32,2],null,[["firstName","lastName","type"],[[30,2,["model","miniProfile","firstName"]],[30,2,["model","miniProfile","lastName"]],"familiar"]]]]]]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[30,1,["artdeco-modal-content"]],null,[["@classNames"],["post-publish-modal__content ph5 pt4"]],[["default"],[[[[1,"\\n"],[41,[30,3,["series"]],[[[1," "],[10,"h3"],[14,0,"t-16 t-bold post-publish-modal__content-cta"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_grow_your_subscribers","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n"]],[]],[[[1," "],[10,"h3"],[14,0,"t-16 t-bold post-publish-modal__content-cta"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_share_article_more_views","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n"]],[]]],[1,"\\n "],[10,"ul"],[14,0,"display-flex justify-space-between list-style-none mv4"],[12],[1,"\\n "],[10,"li"],[12],[1,"\\n "],[11,"button"],[24,0,"post-publish-modal__share-button t-12 t-bold display-flex align-items-center p1"],[24,4,"button"],[4,[32,3],["click",[28,[32,4],[[30,0,["shareToExternal"]],"facebook"],null]],null],[12],[1,"\\n "],[10,1],[14,0,"post-publish-modal__share-icon flex-shrink-zero"],[12],[1,"\\n "],[8,[32,5],null,[["@type","@size","@name"],["social","medium","facebook-solid"]],null],[1,"\\n "],[13],[1,"\\n "],[10,1],[14,0,"t-black"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_share_facebook","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[10,"li"],[12],[1,"\\n "],[11,"button"],[24,0,"post-publish-modal__share-button t-12 t-bold display-flex align-items-center p1"],[24,4,"button"],[4,[32,3],["click",[28,[32,4],[[30,0,["shareToExternal"]],"twitter"],null]],null],[12],[1,"\\n "],[10,1],[14,0,"post-publish-modal__share-icon flex-shrink-zero"],[12],[1,"\\n "],[8,[32,5],null,[["@type","@size","@name"],["social","medium","twitter-solid"]],null],[1,"\\n "],[13],[1,"\\n "],[10,1],[14,0,"t-black"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_share_twitter","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[10,"li"],[12],[1,"\\n "],[11,"button"],[24,0,"post-publish-modal__share-button t-12 t-bold display-flex align-items-center p1"],[24,4,"button"],[4,[32,3],["click",[30,0,["shareToGroups"]]],null],[12],[1,"\\n "],[10,1],[14,0,"post-publish-modal__share-icon flex-shrink-zero"],[12],[1,"\\n "],[8,[32,5],null,[["@type","@size","@name"],["system","medium","group"]],null],[1,"\\n "],[13],[1,"\\n "],[10,1],[14,0,"t-black"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_share_groups","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n\\n "],[10,"hr"],[14,0,"artdeco-divider"],[12],[13],[1,"\\n\\n "],[10,"h3"],[14,0,"t-16 t-bold"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_message_your_network","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n "],[10,0],[14,0,"display-flex justify-space-between"],[12],[1,"\\n "],[10,2],[14,0,"post-publish-modal__section-copy t-14 mv2"],[12],[1,"\\n "],[1,[28,[32,1],["i18n_message_your_network_blurb","article-reader/components/post-publish-modal"],null]],[1,"\\n "],[13],[1,"\\n "],[8,[32,6],[[24,"role","link"],[4,[32,3],["click",[30,0,["shareToMessaging"]]],null]],[["@type","@text","@class"],["secondary",[28,[32,1],["i18n_message","article-reader/components/post-publish-modal"],null],"post-publish-modal__message-button align-self-flex-start"]],null],[1,"\\n "],[13],[1,"\\n\\n "],[10,"hr"],[14,0,"artdeco-divider"],[12],[13],[1,"\\n\\n "],[8,[32,6],[[4,[32,3],["click",[30,0,["copyToClipboard"]]],null]],[["@type","@text","@icon","@class"],["tertiary",[28,[32,1],["i18n_get_link","article-reader/components/post-publish-modal"],null],"link","post-publish-modal__get-link-button mb1"]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[1]]]]],[1,"\\n "]],["modal","@author","@articleModel"],false,["if"]]',moduleName:"article-reader/components/post-publish-modal.gjs",scope:()=>[b.default,g.default,y.default,v.on,_.fn,A.default,w.default],isStrictMode:!0}),(T=(0,f.inject)("global-services@clipboard"),k=(0,f.inject)("i18n"),E=(0,f.inject)("persistent-toast-manager@persistent-toast-manager"),C=(0,f.inject)("router"),O=(0,f.inject)("global-services@window"),D=class e extends h.default{constructor(){super(...arguments);(0,t.default)(this,"clipboard",S,this);(0,t.default)(this,"i18n",P,this);(0,t.default)(this,"persistentToastManager",I,this);(0,t.default)(this,"router",N,this);(0,t.default)(this,"windowService",R,this);(0,r.default)(this,"isOpen",!0)}get articleUrl(){var e
|
|
const t=(null===(e=this.args.articleModel)||void 0===e?void 0:e.permalink)||""
|
|
return(0,d.generateLiExternalUrl)(`/pulse/${t}`)}get articleTitle(){var e
|
|
return(null===(e=this.args.articleModel)||void 0===e?void 0:e.title)||""}get articleInSeries(){var e
|
|
return!(null===(e=this.args.articleModel)||void 0===e||!e.series)||!1}closeModal(){var e,t
|
|
this.isOpen=!1
|
|
null===(e=(t=this.args).onClose)||void 0===e||e.call(t)}copyToClipboard(){(0,c.default)(this.clipboard,this.i18n,this.persistentToastManager,this.articleUrl)}shareToMessaging(){if(u.default){const t=this.articleInSeries?"i18n_share_message":"i18n_thought_might_like_to_read_article",r=this.i18n.lookupTranslation(e,t)([{articleUrl:this.articleUrl,articleTitle:this.articleTitle}]),i=this.router.urlFor("messaging.compose",{queryParams:{body:r}})
|
|
this.windowService.open(`${(0,d.getDomainUrl)()}${i}`,"_blank")}}shareToGroups(){if(u.default){const e=this.router.urlFor("groups")
|
|
this.windowService.open(`${(0,d.getDomainUrl)()}${e}`,"_blank")}}shareToExternal(t){if(u.default){let r
|
|
t===o.SHARE_OPTIONS.FACEBOOK&&(r={url:this.articleUrl})
|
|
if(t===o.SHARE_OPTIONS.TWITTER){const t=this.articleInSeries?"i18n_twitter_message":"i18n_check_out_latest_article",i=this.i18n.lookupTranslation(e,t)([{articleTitle:this.articleTitle}])
|
|
r={url:this.articleUrl,text:i,via:"LinkedIn"}}const{baseUrl:i,urlParams:l}=(0,s.getBaseUrlParams)(t,this.articleUrl,r)
|
|
this.windowService.open(jSecure.sanitizeUrl((0,d.addQueryParams)(i,l)),"_blank","width=550,height=380,scrollbars=yes,resizable=yes")}}},S=(0,i.default)(D.prototype,"clipboard",[T],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),P=(0,i.default)(D.prototype,"i18n",[k],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),I=(0,i.default)(D.prototype,"persistentToastManager",[E],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),N=(0,i.default)(D.prototype,"router",[C],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),R=(0,i.default)(D.prototype,"windowService",[O],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),(0,i.default)(D.prototype,"closeModal",[p.action],Object.getOwnPropertyDescriptor(D.prototype,"closeModal"),D.prototype),(0,i.default)(D.prototype,"copyToClipboard",[p.action],Object.getOwnPropertyDescriptor(D.prototype,"copyToClipboard"),D.prototype),(0,i.default)(D.prototype,"shareToMessaging",[p.action],Object.getOwnPropertyDescriptor(D.prototype,"shareToMessaging"),D.prototype),(0,i.default)(D.prototype,"shareToGroups",[p.action],Object.getOwnPropertyDescriptor(D.prototype,"shareToGroups"),D.prototype),(0,i.default)(D.prototype,"shareToExternal",[p.action],Object.getOwnPropertyDescriptor(D.prototype,"shareToExternal"),D.prototype),D))}))
|
|
define("article-reader/components/reader-article-header",["exports","@ember/template-factory","@ember/component/template-only","@ember/component","ember-engines/components/link-to-external","ember-cli-pemberly-tracking/modifiers/track-interaction","hue-web-icons/components/icon","ember-cli-pemberly-i18n/helpers/t","global-helpers/helpers/or","@ember/helper"],(function(e,t,r,i,l,n,a,o,s,c){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const d=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"2iM5BSHA",block:'[[[1,"\\n"],[1," "],[10,"ul"],[14,0,"reader-article-header__meta"],[12],[1,"\\n "],[10,"li"],[14,0,"reader-article-header__author-list-item"],[12],[1,"\\n "],[8,[32,0],[[24,0,"text-body-medium-bold artdeco-button artdeco-button--tertiary artdeco-button--1"],[4,[32,3],["read_edit"],null]],[["@model","@query","@onclick","@route"],[[30,1],[28,[32,1],null,[["author"],[[30,2]]]],[28,[32,2],[[30,3],"edit_share","SHARE","read_edit"],null],"publishing.post.edit"]],[["default"],[[[[1,"\\n "],[8,[32,4],[[24,0,"v-align-middle artdeco-button__icon"]],[["@type","@size","@name"],["system","small","edit"]],null],[1,"\\n "],[10,1],[14,0,"artdeco-button__text"],[12],[1,"\\n "],[1,[28,[32,5],["i18n_edit","article-reader/components/reader-article-header"],null]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "],[13],[1,"\\n"],[41,[28,[32,6],[[30,4],[30,5]],null],[[[1," "],[10,"li"],[14,0,"reader-article-header__author-list-item"],[12],[1,"\\n"],[41,[30,4],[[[1," "],[8,[32,0],[[24,0,"text-body-medium-bold artdeco-button artdeco-button--tertiary artdeco-button--1"]],[["@route","@models"],["showcase-admin.admin.post-analytics",[28,[32,7],[[30,6],[30,7]],null]]],[["default"],[[[[1,"\\n "],[8,[32,4],[[24,0,"reader-article-header__analytics-icon v-align-middle artdeco-button__icon"]],[["@type","@size","@name"],["system","medium","analytics"]],null],[1,"\\n "],[10,1],[14,0,"artdeco-button__text"],[12],[1,"\\n "],[1,[28,[32,5],["i18n_stats","article-reader/components/reader-article-header"],null]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],[[[1," "],[8,[32,0],[[24,0,"text-body-medium-bold artdeco-button artdeco-button--tertiary artdeco-button--1"]],[["@route","@models"],["member-analytics.index",[28,[32,7],["post-summary",[30,7]],null]]],[["default"],[[[[1,"\\n "],[8,[32,4],[[24,0,"reader-article-header__analytics-icon v-align-middle artdeco-button__icon"]],[["@type","@size","@name"],["system","medium","analytics"]],null],[1,"\\n "],[10,1],[14,0,"artdeco-button__text"],[12],[1,"\\n "],[1,[28,[32,5],["i18n_stats","article-reader/components/reader-article-header"],null]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n"]],[]],null],[1," "],[10,"li"],[14,0,"reader-article-header__author-list-item"],[12],[1,"\\n "],[8,[32,0],[[24,0,"text-body-medium-bold artdeco-button artdeco-button--tertiary artdeco-button--1"],[4,[32,3],["read_view_post"],null]],[["@model","@route"],[[30,8],"feed.update"]],[["default"],[[[[1,"\\n "],[8,[32,4],[[24,0,"v-align-middle artdeco-button__icon"]],[["@type","@size","@name"],["system","small","visibility"]],null],[1,"\\n "],[10,1],[14,0,"artdeco-button__text"],[12],[1,"\\n "],[1,[28,[32,5],["i18n_view_post","article-reader/components/reader-article-header"],null]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n"]],["@firstPartyArticleId","@companyUrn","@fireFeedActionEvent","@isPageArticle","@showPremiumAnalytics","@companyId","@summaryPageActivityUrn","@updateUrn"],false,["if"]]',moduleName:"article-reader/components/reader-article-header.gjs",scope:()=>[l.default,c.hash,c.fn,n.default,a.default,o.default,s.default,c.array],isStrictMode:!0}),(0,r.default)("reader-article-header","ReaderArticleHeader"))
|
|
e.default=d}))
|
|
define("article-reader/components/reader-social-bar-sticky",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","@ember/utils","@glimmer/tracking","@ember/service","@ember/object","global-utils/utils/is-browser","global-utils/utils/intersection-observer","ember-lifeline","@ember/debug","@glimmer/component","social-details/components/social-activity-v2","ember-cli-pemberly-tracking/modifiers/track-interaction","social-share/components/social-share"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var _,A,w,T,k,E,C,O
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"y0S/SsAu",block:'[[[1,"\\n "],[10,"section"],[15,0,[29,["reader-social-bar-sticky\\n ",[52,[30,0,["isVisible"]],"reader-social-bar-sticky--visible"]]]],[12],[1,"\\n "],[10,0],[14,0,"reader-social-bar-sticky__content"],[12],[1,"\\n "],[8,[32,0],null,[["@a11yContext","@onReactionsTotalClick","@socialDetail","@isCurrentUserAuthor","@isUsingSocialShare"],[[30,0,["a11yContext"]],[30,0,["trackReactionsTotalClick"]],[30,1],[30,2],true]],[["default"],[[[[1,"\\n "],[8,[30,3,["socialModal"]],null,null,null],[1,"\\n "],[10,0],[14,0,"reader-social-bar-sticky__social-activity"],[12],[1,"\\n "],[8,[30,3,["socialActions"]],[[24,0,"reader-social-bar-sticky__social-actions"]],[["@disableCommentButton"],[[30,0,["disableCommentButton"]]]],[["default"],[[[[1,"\\n "],[8,[30,4,["reactButton"]],[[24,0,"reader-social-bar-sticky__button reader-social-bar-sticky__reaction-button"],[4,[32,1],["like_toggle_sticky"],null]],[["@handleReactButtonTracking","@handleReactionsMenuTracking","@socialDetail"],[[30,0,["handleReactButtonTracking"]],[30,0,["handleReactionsMenuTracking"]],[30,1]]],null],[1,"\\n "],[8,[30,4,["commentButton"]],[[24,0,"reader-social-bar-sticky__button reader-social-bar-sticky__comment-button"],[4,[32,1],["comment_sticky"],null]],[["@onAddCommentClick"],[[30,5]]],null],[1,"\\n "],[8,[32,2],[[24,0,"reader-social-bar-sticky__button reader-social-bar-sticky__share-button"],[4,[32,1],["social_share_intent_sticky"],null]],[["@urlToShare","@dropdownPlacementOverride","@enabledSocialMediaOptions","@shareOrigin","@triggerIconSize","@triggerVariantClass"],[[30,6],"top",[30,7],"MEDIA_ENTITY_PAGE","medium","artdeco-button artdeco-button--4 artdeco-button--tertiary artdeco-button--muted"]],null],[1,"\\n "]],[4]]]]],[1,"\\n "],[8,[30,3,["socialCounts"]],[[24,0,"reader-social-bar-sticky__social-counts"]],[["@isAuthorView","@onCommentsTotalClick","@disableSocialProofText"],[[30,2],[30,0,["trackCommentsCountClick"]],true]],null],[1,"\\n "],[13],[1,"\\n "]],[3]]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "]],["@socialDetail","@viewerAllowedToEdit","components","actionComponents","@scrollToComments","@shareUrl","@enabledSocialMediaOptions"],false,["if"]]',moduleName:"article-reader/components/reader-social-bar-sticky.gjs",scope:()=>[g.default,y.default,v.default],isStrictMode:!0}),(_=(0,d.inject)("feed-tracking@feed-action-event"),A=(0,d.inject)("tracking"),w=class extends b.default{get a11yContext(){return{actor:this.args.author,context:"article"}}get disableCommentButton(){return this.args.isCommentingDisabled&&"NONE"===this.args.allowedCommentersScope}get isVisible(){return this.isScrolled&&!1===this.isReaderSocialBarIntersecting&&!1===this.isReaderRelatedContentIntersecting}constructor(){super(...arguments);(0,t.default)(this,"feedActionEvent",T,this);(0,t.default)(this,"tracking",k,this);(0,t.default)(this,"isReaderRelatedContentIntersecting",E,this);(0,t.default)(this,"isReaderSocialBarIntersecting",C,this);(0,t.default)(this,"isScrolled",O,this);(0,r.default)(this,"readerRelatedContentObserver",null);(0,r.default)(this,"readerSocialBarObserver",null)
|
|
this.args.isPreviewMode
|
|
this._setupEventListeners()
|
|
this._setupIntersectionObservers()}willDestroy(){super.willDestroy(...arguments)
|
|
this.readerRelatedContentObserver.disconnect()
|
|
this.readerSocialBarObserver.disconnect()}_fireArticleFeedActionEvent(e){let{actionType:t,actionCategory:r,controlName:i}=e
|
|
const l={moduleKey:"article-reader:desktop",trackingId:this.args.trackingId,updateUrn:this.args.updateUrn}
|
|
this.feedActionEvent.fireFAE({},{controlName:i,actionType:t,actionCategory:r},l)}_handleReaderRelatedContentIntersection(e){this.isReaderRelatedContentIntersecting=e[0].isIntersecting}_handleReaderSocialBarIntersection(e){this.isReaderSocialBarIntersecting=e[0].isIntersecting}_setupEventListeners(){p.default&&(0,f.addEventListener)(this,window,"scroll",(()=>{this.isScrolled=!0}),{once:!0})}_setupIntersectionObservers(){if(p.default){const e=document.querySelector(".reader-related-content"),t=document.querySelector(".reader-social-bar-v2")
|
|
this.readerRelatedContentObserver=new m.default(this._handleReaderRelatedContentIntersection.bind(this),{threshold:0})
|
|
this.readerSocialBarObserver=new m.default(this._handleReaderSocialBarIntersection.bind(this),{threshold:1})
|
|
if(e&&t){this.readerRelatedContentObserver.observe(e)
|
|
this.readerSocialBarObserver.observe(t)}}}handleReactButtonTracking(e){let t,r
|
|
if(e){t="UNREACT"
|
|
r=`un${e.toLowerCase()}Article`}else{t="REACT"
|
|
r="likeArticle"}this._fireArticleFeedActionEvent({actionType:r,actionCategory:t,controlName:"like_toggle_sticky"})}handleReactionsMenuTracking(e,t){const r="select_reaction_sticky"
|
|
this._fireArticleFeedActionEvent({controlName:r,actionCategory:"REACT",actionType:`${e.toLowerCase()}Article`})
|
|
t&&this._fireArticleFeedActionEvent({controlName:r,actionCategory:"UNREACT",actionType:`un${t.toLowerCase()}Article`})
|
|
this.tracking.fireInteractionEvent(r)}trackCommentsCountClick(){var e,t
|
|
null===(e=(t=this.args).scrollToComments)||void 0===e||e.call(t)
|
|
this.tracking.fireInteractionEvent("comments_count_sticky")}trackReactionsTotalClick(){this.tracking.fireInteractionEvent("likes_count_sticky")}},T=(0,i.default)(w.prototype,"feedActionEvent",[_],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),k=(0,i.default)(w.prototype,"tracking",[A],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),E=(0,i.default)(w.prototype,"isReaderRelatedContentIntersecting",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),C=(0,i.default)(w.prototype,"isReaderSocialBarIntersecting",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),O=(0,i.default)(w.prototype,"isScrolled",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),(0,i.default)(w.prototype,"handleReactButtonTracking",[u.action],Object.getOwnPropertyDescriptor(w.prototype,"handleReactButtonTracking"),w.prototype),(0,i.default)(w.prototype,"handleReactionsMenuTracking",[u.action],Object.getOwnPropertyDescriptor(w.prototype,"handleReactionsMenuTracking"),w.prototype),(0,i.default)(w.prototype,"trackCommentsCountClick",[u.action],Object.getOwnPropertyDescriptor(w.prototype,"trackCommentsCountClick"),w.prototype),(0,i.default)(w.prototype,"trackReactionsTotalClick",[u.action],Object.getOwnPropertyDescriptor(w.prototype,"trackReactionsTotalClick"),w.prototype),w))}))
|
|
define.alias("ember-finite-scroll/components/sentinel","article-reader/components/sentinel")
|
|
define("article-reader/components/series-reader-header",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/template-factory","@ember/helper","@ember/component","@glimmer/tracking","global-utils/utils/url","article-reader/utils/tracking-utils","article-reader/utils/series-translation-utils","@ember/service","@ember/object","@ember/debug","@glimmer/component","ember-cli-pemberly-i18n/helpers/t","artdeco-entity-lockup/components/artdeco-entity-lockup","ember-engines/components/link-to-external","ember-cli-pemberly-tracking/modifiers/track-interaction","ember-vector-images/components/lazy-image","hue-web-icons/components/icon","@ember/modifier","article-reader/components/header-subscribe-button","artdeco-inline-feedback/components/artdeco-inline-feedback","publishing-shared/components/subscribers-modal","global-helpers/helpers/and","global-helpers/helpers/not"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A,w,T,k,E,C,O){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var D,S,P,I,N,R,M,x,j,U,F,L,z,B
|
|
e.default=(0,o.setComponentTemplate)((0,n.createTemplateFactory)({id:"v4HmFRYi",block:'[[[1,"\\n"],[1," "],[10,"section"],[14,0,"series-reader-header"],[15,"aria-label",[28,[32,0],["i18n_newsletter_header","article-reader/components/series-reader-header"],null]],[12],[1,"\\n "],[8,[32,1],null,[["@size"],[5]],[["default"],[[[[1,"\\n "],[8,[30,1,["image"]],null,[["@type","@class"],["square","mr1"]],[["default"],[[[[1,"\\n "],[8,[32,2],[[4,[32,3],["series_info_footer"],null]],[["@route","@model"],["publishing-entity.newsletter",[30,2]]],[["default"],[[[[1,"\\n "],[8,[32,4],null,[["@alt","@classNames","@desiredWidth","@desiredHeight","@ghostType","@image"],[[28,[32,0],["i18n_newsletter_logo","article-reader/components/series-reader-header"],null],[52,[30,3,["logo"]],"series-reader-header__transparent-background"],72,72,"content",[30,0,["logoImage"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[30,1,["content"]],null,[["@class"],["series-reader-header__content flex-1 justify-space-between"]],[["default"],[[[[1,"\\n "],[8,[32,2],[[24,0,"display-flex flex-column"],[4,[32,3],["series_info_footer"],null]],[["@route","@model"],["publishing-entity.newsletter",[30,2]]],[["default"],[[[[1,"\\n "],[8,[30,1,["title"]],null,[["@class"],["mb1 v-align-middle"]],[["default"],[[[[1,"\\n "],[1,[30,3,["title"]]],[1,"\\n "]],[]]]]],[1,"\\n "],[8,[30,1,["subtitle"]],null,[["@class"],["series-reader-header__description mb1 mr4 t-14 t-normal"]],[["default"],[[[[1,"\\n "],[1,[30,3,["description"]]],[1,"\\n "]],[]]]]],[1,"\\n "],[8,[30,1,["metadata"]],null,[["@class"],["series-reader-header__metadata align-items-center"]],[["default"],[[[[1,"\\n "],[8,[32,5],[[24,0,"v-align-middle"]],[["@type","@size","@name"],["system","small","calendar"]],null],[1,"\\n "],[10,1],[14,0,"v-align-middle t-14 t-black--light t-normal"],[12],[1,"\\n "],[1,[30,0,["cadence"]]],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[10,0],[14,0,"series-reader-header__subscriber-container"],[12],[1,"\\n"],[41,[30,4],[[[1," "],[11,"button"],[24,0,"series-reader-header__num-subscribers mr2 hoverable-link-text t-14 t-black t-bold"],[24,4,"button"],[4,[32,3],["see_subscribers"],null],[4,[32,6],["click",[30,0,["onShowSubscribersModalAction"]]],null],[12],[1,"\\n "],[1,[28,[32,0],["i18n_number_of_subscribers","article-reader/components/series-reader-header"],[["count"],[[30,5]]]]],[1,"\\n "],[13],[1,"\\n "],[8,[32,7],null,[["@isSubscribedToSeries","@onToggleSubscribeSeriesAction","@displayTertiaryButtonStyle","@subscribedText","@subscribeText"],[[30,0,["isSubscribedToSeries"]],[30,0,["onToggleSubscribeSeriesAction"]],[30,0,["displayTertiaryButtonStyle"]],[28,[32,0],["i18n_subscribed","article-reader/components/series-reader-header"],null],[28,[32,0],["i18n_subscribe","article-reader/components/series-reader-header"],null]]],null],[1,"\\n"]],[]],[[[1," "],[10,1],[14,0,"series-reader-header__num-subscribers mr2 t-14 t-black t-bold"],[12],[1,"\\n "],[1,[28,[32,0],["i18n_number_of_subscribers","article-reader/components/series-reader-header"],[["count"],[[30,5]]]]],[1,"\\n "],[13],[1,"\\n "],[8,[32,7],null,[["@isSubscribedToSeries","@onToggleSubscribeSeriesAction","@displayTertiaryButtonStyle","@subscribedText","@subscribeText"],[[30,0,["isSubscribedToSeries"]],[30,0,["onToggleSubscribeSeriesAction"]],[30,0,["displayTertiaryButtonStyle"]],[28,[32,0],["i18n_subscribed","article-reader/components/series-reader-header"],null],[28,[32,0],["i18n_subscribe","article-reader/components/series-reader-header"],null]]],null],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[1]]]]],[1,"\\n\\n"],[41,[30,0,["shouldRenderFlagWarning"]],[[[1," "],[8,[32,8],null,[["@class","@linkText","@message","@onClick","@type"],["p3",[52,[30,6],[30,3,["annotation","linkText"]],[30,3,["annotation","link","text"]]],[30,3,["annotation","text"]],[30,0,["onLearnMoreClick"]],"yield"]],null],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n\\n"],[41,[28,[32,9],[[28,[32,10],[[30,7]],null],[30,0,["isSubscribersModalOpen"]]],null],[[[1," "],[8,[32,11],null,[["@isSubscribersModalOpen","@model","@contentSeriesUrn","@totalSubscribers","@onCloseSubscribersModal"],[[30,0,["isSubscribersModalOpen"]],[30,8],[30,3,["entityUrn"]],[30,5],[30,0,["onCloseSubscribersModal"]]]],null],[1,"\\n"]],[]],null],[1," "]],["elements","@newsletterId","@series","@viewerAllowedToEdit","@numberOfSubscribers","@isUsingDashAndGql","@isPreviewOnlyMode","@subscribersModel"],false,["if"]]',moduleName:"article-reader/components/series-reader-header.gjs",scope:()=>[b.default,g.default,y.default,v.default,_.default,A.default,w.on,T.default,k.default,C.default,O.default,E.default],isStrictMode:!0}),(D=(0,p.inject)("feed-tracking@feed-action-event"),S=(0,p.inject)("i18n"),P=(0,p.inject)("tracking"),I=(0,p.inject)("global-services@window"),N=(0,p.inject)("watchman-tracking@watchman-tracking"),R=class e extends h.default{constructor(){super(...arguments);(0,t.default)(this,"feedActionEvent",M,this);(0,t.default)(this,"i18n",x,this);(0,t.default)(this,"tracking",j,this);(0,t.default)(this,"windowService",U,this);(0,t.default)(this,"watchmanTracking",F,this);(0,t.default)(this,"isSubscribersModalOpen",L,this);(0,t.default)(this,"subscribedOnLoad",z,this);(0,t.default)(this,"subscribeButtonToggled",B,this)}get displayTertiaryButtonStyle(){return!!this.subscribedOnLoad||this.isSubscribedToSeries&&!this.subscribeButtonToggled}get isSubscribedToSeries(){var e,t,r
|
|
if(this.args.isUsingDashAndGql){var i,l
|
|
return null===(i=this.args.series)||void 0===i||null===(l=i.subscribeAction)||void 0===l?void 0:l.subscribed}return(null===(e=this.args.series)||void 0===e||null===(t=e.followAction)||void 0===t||null===(r=t.followingInfo)||void 0===r?void 0:r.following)??!1}get cadence(){var t
|
|
const r=(0,u.default)(null===(t=this.args.series)||void 0===t?void 0:t.publishFrequency)
|
|
return this.i18n.lookupTranslation(e,r)()}get logoImage(){if(this.args.isUsingDashAndGql){var e,t,r,i
|
|
return null===(e=this.args.series.logo)||void 0===e||null===(t=e.attributes)||void 0===t||null===(r=t[0])||void 0===r||null===(i=r.detailData)||void 0===i?void 0:i.vectorImage}return this.args.series.logo}get shouldRenderFlagWarning(){var e
|
|
return(null===(e=this.args.series)||void 0===e?void 0:e.annotation)&&!this.args.isArticleFlagged}onLearnMoreClick(){let e,t
|
|
if(this.args.isUsingDashAndGql){var r,i,l,n
|
|
e=null===(r=this.args.series)||void 0===r||null===(i=r.annotation)||void 0===i?void 0:i.controlName
|
|
t=null===(l=this.args.series)||void 0===l||null===(n=l.annotation)||void 0===n?void 0:n.linkUrl}else{var a,o,s,d,u
|
|
e=null===(a=this.args.series)||void 0===a||null===(o=a.annotation)||void 0===o?void 0:o.controlName
|
|
t=null===(s=this.args.series)||void 0===s||null===(d=s.annotation)||void 0===d||null===(u=d.link)||void 0===u?void 0:u.url}this.tracking.fireInteractionEvent(e)
|
|
this.windowService.open((0,c.generateUrlByDomain)(t),"_blank")}onToggleSubscribeSeriesAction(){var e,t
|
|
if(this.args.isPreviewOnlyMode)return
|
|
this.watchmanTracking.startInteraction({userInteraction:"subscribe-newsletter-via-article-header",userJourney:"subscribe-to-newsletter",groupName:"publishing-reliability"})
|
|
this.subscribeButtonToggled||(this.subscribedOnLoad=this.isSubscribedToSeries)
|
|
this.subscribeButtonToggled=!0
|
|
const r=this.isSubscribedToSeries;(0,d.fireArticleReaderFeedActionEvent)({actionType:r?"unfollowSeries":"followSeries",actionCategory:"FOLLOW",controlName:"series_subscribe_toggle",feedActionEventService:this.feedActionEvent,legacyTrackingId:this.args.trackingId,update:this.args.feedUpdate,updateUrn:this.args.updateUrn})
|
|
null===(e=(t=this.args).onToggleSubscribeSeries)||void 0===e||e.call(t)}onShowSubscribersModalAction(){if(!this.args.isPreviewOnlyMode){this.args.onShowSubscribersModal()
|
|
this.isSubscribersModalOpen=!0}}onCloseSubscribersModal(){this.isSubscribersModalOpen=!1}},M=(0,i.default)(R.prototype,"feedActionEvent",[D],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),x=(0,i.default)(R.prototype,"i18n",[S],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),j=(0,i.default)(R.prototype,"tracking",[P],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),U=(0,i.default)(R.prototype,"windowService",[I],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),F=(0,i.default)(R.prototype,"watchmanTracking",[N],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),L=(0,i.default)(R.prototype,"isSubscribersModalOpen",[s.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),z=(0,i.default)(R.prototype,"subscribedOnLoad",[s.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),B=(0,i.default)(R.prototype,"subscribeButtonToggled",[s.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),(0,i.default)(R.prototype,"onLearnMoreClick",[m.action],Object.getOwnPropertyDescriptor(R.prototype,"onLearnMoreClick"),R.prototype),(0,i.default)(R.prototype,"onToggleSubscribeSeriesAction",[m.action],Object.getOwnPropertyDescriptor(R.prototype,"onToggleSubscribeSeriesAction"),R.prototype),(0,i.default)(R.prototype,"onShowSubscribersModalAction",[m.action],Object.getOwnPropertyDescriptor(R.prototype,"onShowSubscribersModalAction"),R.prototype),(0,i.default)(R.prototype,"onCloseSubscribersModal",[m.action],Object.getOwnPropertyDescriptor(R.prototype,"onCloseSubscribersModal"),R.prototype),R))}))
|
|
define.alias("ember-cloud-filepicker/components/slideshare-file-picker","article-reader/components/slideshare-file-picker")
|
|
define("article-reader/components/sortable-objects",["exports","ember-drag-drop/components/sortable-objects"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default}))
|
|
define("article-reader/components/ugc-post-bar",["exports","@ember/template-factory","@ember/component/template-only","@ember/component","ember-cli-pemberly-i18n/helpers/t","artdeco-entity-lockup/components/artdeco-entity-lockup","ember-engines/components/link-to-external","ember-cli-pemberly-tracking/modifiers/track-interaction","image-view-model/components/image-view-model","feed-components-shared/components/avatar-image","text-view-model/helpers/text-view-model","update-components/components/text-view","ember-line-clamp/components/line-clamp","global-helpers/helpers/time-ago","@ember/helper","follows/components/follow-button","feed-control-menu/components/control-menu","global-helpers/helpers/and","global-helpers/helpers/not","global-helpers/helpers/or","text-view-model/components/text-view-model-v2"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const A=(0,i.setComponentTemplate)((0,t.createTemplateFactory)({id:"5seGt248",block:'[[[1,"\\n"],[1," "],[11,0],[24,0,"reader-ugc-post-bar reader-ugc-post-bar--expanded"],[17,1],[12],[1,"\\n "],[10,"h3"],[14,0,"mb6 t-sans t-16 t-black"],[12],[1,"\\n "],[1,[28,[32,0],["i18n_published_by","article-reader/components/ugc-post-bar"],null]],[1,"\\n "],[13],[1,"\\n "],[10,0],[14,0,"display-flex justify-space-between align-items-center"],[12],[1,"\\n "],[8,[32,1],null,[["@size","@class"],[3,"display-flex align-items-center"]],[["default"],[[[[1,"\\n"],[41,[30,3,["image"]],[[[1," "],[8,[30,2,["image"]],null,[["@type"],[[30,4]]],[["default"],[[[[1,"\\n "],[8,[32,2],[[4,[32,3],["read_profile"],null]],[["@route","@model"],[[30,5,["model","profileRoute"]],[30,5,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[8,[32,4],null,[["@images","@isPresenceEnabled","@entitySize"],[[30,3,["image"]],true,3]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],[[[41,[28,[32,5],[[30,5,["model","miniProfile"]],[30,5,["model","miniCompany"]]],null],[[[1," "],[8,[30,2,["image"]],null,[["@type"],[[30,4]]],[["default"],[[[[1,"\\n "],[8,[32,2],[[4,[32,3],["read_profile"],null]],[["@route","@model"],[[30,5,["model","profileRoute"]],[30,5,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[8,[32,6],null,[["@alt","@avatar","@avatarEntityClassSize","@avatarType","@miniProfile"],[[30,5,["authorName"]],[30,5,["model","avatar"]],3,[30,5,["model","actorType"]],[30,5,["model","miniProfile"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],[[[41,[28,[32,7],[[30,6],[30,5,["model","miniProfile","profilePicture","displayImageReference","vectorImage"]]],null],[[[1," "],[8,[30,2,["image"]],null,[["@type"],[[30,4]]],[["default"],[[[[1,"\\n "],[8,[32,2],[[4,[32,3],["read_profile"],null]],[["@route","@model"],[[30,5,["model","profileRoute"]],[30,5,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[8,[32,6],null,[["@alt","@avatar","@avatarEntityClassSize","@avatarType","@miniProfile"],[[30,5,["authorName"]],[30,5,["model","avatar"]],3,[30,5,["model","actorType"]],[30,5,["model","miniProfile"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[]],null]],[]]]],[]]],[1," "],[8,[30,2,["content"]],null,[["@class"],["display-flex flex-column"]],[["default"],[[[[1,"\\n "],[8,[30,2,["title"]],null,null,[["default"],[[[[1,"\\n"],[41,[30,3,["name"]],[[[1," "],[8,[32,2],[[24,0,"hoverable-link-text link-without-visited-state t-black t-14"],[4,[32,3],["read_profile"],null]],[["@route","@model"],[[30,5,["model","profileRoute"]],[30,5,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[1,[28,[32,8],[[30,3,["name"]]],null]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],[[[41,[28,[32,7],[[30,5,["model"]],[30,5,["authorName"]]],null],[[[1," "],[8,[32,2],[[24,0,"hoverable-link-text link-without-visited-state t-black t-14"],[4,[32,3],["read_profile"],null]],[["@route","@model"],[[30,5,["model","profileRoute"]],[30,5,["model","profileID"]]]],[["default"],[[[[1,"\\n "],[1,[28,[32,0],["i18n_member_name","article-reader/components/ugc-post-bar"],[["member"],[[30,5,["authorName"]]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[]],null]],[]]],[1," "]],[]]]]],[1,"\\n "],[8,[30,2,["subtitle"]],null,null,[["default"],[[[[1,"\\n"],[41,[30,3,["description"]],[[[1," "],[8,[32,9],[[24,0,"reader-ugc-post-bar__headline t-black--light t-12"]],[["@model","@skipLinkParsing"],[[30,3,["description"]],true]],null],[1,"\\n"]],[]],[[[41,[30,5,["model","headline"]],[[[1," "],[8,[32,10],[[24,0,"reader-ugc-post-bar__headline t-black--light t-12"]],[["@text","@lines","@interactive"],[[30,5,["model","headline"]],2,true]],null],[1,"\\n"]],[]],[[[41,[30,5,["model","miniCompany"]],[[[1," "],[10,1],[14,0,"reader-ugc-post-bar__headline t-black--light t-12"],[12],[1,"\\n "],[1,[28,[32,0],["i18n_followers_count","article-reader/components/ugc-post-bar"],[["count"],[[30,5,["model","followingInfo","followerCount"]]]]]],[1,"\\n "],[13],[1,"\\n "]],[]],null]],[]]]],[]]],[1," "]],[]]]]],[1,"\\n "],[8,[30,2,["metadata"]],null,null,[["default"],[[[[1,"\\n"],[41,[28,[32,7],[[30,7],[28,[32,11],[[30,8]],null]],null],[[[1," "],[10,1],[12],[1,"\\n "],[1,[28,[32,0],["i18n_published_date","article-reader/components/ugc-post-bar"],[["date"],[[28,[32,12],[[30,7],"short"],null]]]]],[1,"\\n "],[13],[1,"\\n"]],[]],null],[1," "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[2]]]]],[1,"\\n\\n "],[10,0],[14,0,"display-flex align-items-flex-start"],[12],[1,"\\n"],[41,[30,9],[[[1," "],[8,[32,2],[[24,0,"reader-ugc-post-bar__total-articles hoverable-link-text link-without-visited-state"],[4,[32,3],["total_articles_link"],null]],[["@route","@model","@query"],["profile.common.recent-activity.posts",[30,5,["model","profileID"]],[28,[32,13],null,[["locale"],[[27]]]]]],[["default"],[[[[1,"\\n "],[1,[28,[32,0],["i18n_total_articles","article-reader/components/ugc-post-bar"],[["count"],[[30,9]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],null],[41,[51,[30,10]],[[[1," "],[8,[32,14],[[24,0,"reader-ugc-post-bar__follow-button artdeco-button artdeco-button--secondary artdeco-button--1 ml4"]],[["@iconSize","@iconType","@isFollowing","@showText","@toggleFollow"],["small","add",[30,11],true,[30,12]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[28,[32,7],[[30,13,["actions"]],[28,[32,11],[[30,8]],null]],null],[[[1," "],[8,[32,15],null,[["@menuActions"],[[30,13,["actions"]]]],null],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "],[13],[1,"\\n\\n"],[41,[28,[32,7],[[30,14],[28,[32,11],[[30,8]],null]],null],[[[1," "],[10,0],[14,0,"pv2 t-14"],[12],[1,"\\n"],[41,[30,6],[[[1," "],[8,[32,16],null,[["@tvm"],[[30,14,["text"]]]],null],[1,"\\n"]],[]],[[[1," "],[8,[32,9],null,[["@model"],[[30,14,["text"]]]],null],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n"]],["&attrs","elements","@actor","@imageType","@authorActor","@isUsingDashAndGql","@publishedAt","@isPreviewOnlyMode","@totalArticles","@viewerAllowedToEdit","@isFollowing","@toggleFollow","@metadata","@commentary"],false,["if","unless"]]',moduleName:"article-reader/components/ugc-post-bar.gjs",scope:()=>[l.default,n.default,a.default,o.default,s.default,v.default,c.default,g.default,d.default,u.default,p.default,y.default,m.default,f.hash,h.default,b.default,_.default],isStrictMode:!0}),(0,r.default)("ugc-post-bar","UgcPostBar"))
|
|
e.default=A}))
|
|
define("article-reader/config/environment",["exports"],(function(e){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
let t
|
|
try{const e="article-reader/config/environment",r=document.querySelector('meta[name="'+e+'"]').getAttribute("content")
|
|
t=JSON.parse(unescape(r))}catch(e){t={}}e.default=t}))
|
|
define("article-reader/controllers/index",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/destroyable","@ember/controller","@ember/object","@ember/service","@glimmer/tracking","article-reader/utils/constants","article-reader/utils/tracking-utils","ember-cli-pemberly-tracking/utils/tracking","voyager-web/config/environment","feed-requests/update-actions","global-utils/utils/profile-id-parser","global-utils/utils/url","global-utils/utils/urn-converter","social-share/utils/social-share-constants","article-reader/utils/get-text-direction","global-helpers/helpers/load","graphql-queries/queries/publishing/gated-article-lead-gen-form-by-id.graphql","article-reader/utils/shared-article-getters","article-reader/utils/get-member-actor-model","feed-utils/utils/article-toast-utils","global-utils/utils/urn-id-helpers","global-utils/utils/get-attributed-link","article-reader/utils/pem"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A,w,T,k,E,C,O){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var D,S,P,I,N,R,M,x,j,U,F,L,z,B,G,q,H,V,W,Y,$,K,X,Q,J,Z,ee,te,re,ie
|
|
e.default=(D=(0,s.inject)("authentication@authenticated-user"),S=(0,s.inject)("feed-tracking@feed-action-event"),P=(0,s.inject)("formatter"),I=(0,s.inject)("i18n"),N=(0,s.inject)("@linkedin/ember-restli-graphql@graphql"),R=(0,s.inject)("global-services@store-shim"),M=(0,s.inject)("persistent-toast-manager@persistent-toast-manager"),x=(0,s.inject)("lix"),j=(0,s.inject)("watchman-tracking@watchman-tracking"),U=(0,s.inject)("pem-tracking"),F=class extends a.default{constructor(){super(...arguments);(0,t.default)(this,"authenticatedUser",L,this);(0,t.default)(this,"feedActionEvent",z,this);(0,t.default)(this,"formatter",B,this);(0,t.default)(this,"i18n",G,this);(0,t.default)(this,"graphql",q,this);(0,t.default)(this,"storeShim",H,this);(0,t.default)(this,"persistentToastManager",V,this);(0,t.default)(this,"lix",W,this);(0,t.default)(this,"watchmanTracking",Y,this);(0,t.default)(this,"pemTracking",$,this);(0,r.default)(this,"queryParams",["published","adTrackingCode","creativeId"]);(0,t.default)(this,"published",K,this);(0,t.default)(this,"shouldScrollToComments",X,this);(0,t.default)(this,"isArticleFooterButtonClicked",Q,this);(0,t.default)(this,"leadGenFormAsyncData",J,this);(0,t.default)(this,"adTrackingCode",Z,this);(0,t.default)(this,"creativeId",ee,this);(0,r.default)(this,"isReporting",!1);(0,r.default)(this,"isShowingShare",!1);(0,r.default)(this,"relatedContent",null);(0,r.default)(this,"scrollToCommentsTop",160);(0,r.default)(this,"showErrorState",!1);(0,t.default)(this,"showRemoveMentionDialog",te,this);(0,r.default)(this,"socialDetail",null);(0,r.default)(this,"totalArticles",null);(0,t.default)(this,"hasSubmittedLeadGenForm",re,this);(0,t.default)(this,"isLeadGenFormModalOpen",ie,this)}get a11yContext(){return{actor:this.authorActor,context:"article"}}get isCommentPermissionDashEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.feed-enable-dash-comment-permissions")}get isFirstPartyArticleDashAndGqlEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.publishing-graphql-first-party-article")}get showLeadGenBanner(){var e,t
|
|
return!(null===(e=this.model)||void 0===e||null===(t=e.gatedArticleMetadata)||void 0===t||!t.bannerCallToAction||this.hasSubmittedLeadGenForm)}get imageType(){var e,t
|
|
return(0,w.getImageType)(null===(e=this.authorActor)||void 0===e||null===(t=e.model)||void 0===t?void 0:t.pagePublished)}get articleUrn(){return`urn:li:linkedInArticle:${this.firstPartyArticleId}`}get articleAnnotationLink(){var e,t,r,i,l,n
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.articleAnnotation)||void 0===r?void 0:r.annotation:null===(i=this.model)||void 0===i||null===(l=i.articleData)||void 0===l||null===(n=l.annotation)||void 0===n?void 0:n.link}get articleAnnotationType(){var e,t,r,i,l,n,a
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?d.ARTICLE_ANNOTATION_TYPE_MAP[null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.articleAnnotation)||void 0===r||null===(i=r.annotation)||void 0===i?void 0:i.type]:d.ARTICLE_ANNOTATION_TYPE_MAP[null===(l=this.model)||void 0===l||null===(n=l.articleData)||void 0===n||null===(a=n.annotation)||void 0===a?void 0:a.type]}get authorActor(){var e,t,r
|
|
let i
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled){var l,n,a,o,s
|
|
i=null===(l=this.model)||void 0===l||null===(n=l.articleData)||void 0===n||null===(a=n.authorsResolutionResults)||void 0===a?void 0:a[0]
|
|
if(null!==(o=i)&&void 0!==o&&o.companyUrn){var c
|
|
return(0,T.getMemberActorFromCompanyAuthor)(null===(c=i)||void 0===c?void 0:c.companyUrn,!0,null)}return(0,T.getMemberActorFromMemberAuthor)(null===(s=i)||void 0===s?void 0:s.profileUrn,!0,null,this.formatter)}i=null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.authors)||void 0===r?void 0:r[0]
|
|
return i.miniCompany?(0,T.getMemberActorFromCompanyAuthor)(i,!1,this.storeShim):(0,T.getMemberActorFromMemberAuthor)(i,!1,this.storeShim,this.formatter)}get authorId(){var e,t,r,i
|
|
const l=(0,g.fromUrn)(null===(e=this.authorActor)||void 0===e||null===(t=e.model)||void 0===t?void 0:t.urn).id
|
|
return null!==(r=this.authorActor)&&void 0!==r&&null!==(i=r.model)&&void 0!==i&&i.miniCompany?parseInt(l,10):(0,h.default)(l)}get authorNormalizedProfileId(){var e,t
|
|
return(0,g.fromUrn)(null===(e=this.authorActor)||void 0===e||null===(t=e.model)||void 0===t?void 0:t.urn).id}get companyId(){return this.companyUrn?(0,g.fromUrn)(this.companyUrn).id:null}get companyUrn(){var e,t,r,i,l,n,a,o,s,c
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.authorsResolutionResults)||void 0===r||null===(i=r[0])||void 0===i||null===(l=i.companyUrn)||void 0===l?void 0:l.objectUrn)||null:(null===(n=this.model)||void 0===n||null===(a=n.articleData)||void 0===a||null===(o=a.authors)||void 0===o||null===(s=o[0])||void 0===s||null===(c=s.miniCompany)||void 0===c?void 0:c.objectUrn)||null}get articleAuthorDashProfileUrn(){var e,t,r,i,l,n,a,o,s,c,d,u
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?(null===(e=this.authorActor)||void 0===e||null===(t=e.model)||void 0===t||null===(r=t.miniCompany)||void 0===r?void 0:r.entityUrn)||(null===(i=this.authorActor)||void 0===i||null===(l=i.model)||void 0===l||null===(n=l.miniProfile)||void 0===n?void 0:n.entityUrn):(null===(a=this.authorActor)||void 0===a||null===(o=a.model)||void 0===o||null===(s=o.miniCompany)||void 0===s?void 0:s.dashCompanyUrn)||(null===(c=this.authorActor)||void 0===c||null===(d=c.model)||void 0===d||null===(u=d.miniProfile)||void 0===u?void 0:u.dashEntityUrn)}get enabledSocialMediaOptions(){var e,t,r,i,l,n
|
|
const a=null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.title,o=this.isFirstPartyArticleDashAndGqlEnabled?null===(r=this.model)||void 0===r||null===(i=r.articleData)||void 0===i?void 0:i.contentDescription:null===(l=this.model)||void 0===l||null===(n=l.articleData)||void 0===n?void 0:n.description
|
|
return{[y.SHARE_OPTIONS.FACEBOOK]:{shareMessage:{title:a,text:o}},[y.SHARE_OPTIONS.TWITTER]:{shareMessage:{text:a}}}}get firstPartyArticleId(){var e,t
|
|
return(0,g.fromUrn)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.entityUrn).id}get isFollowing(){var e,t,r
|
|
return null===(e=this.authorActor)||void 0===e||null===(t=e.model)||void 0===t||null===(r=t.followingInfo)||void 0===r?void 0:r.following}get isLiked(){var e,t
|
|
return null===(e=this.socialDetail)||void 0===e||null===(t=e.totalSocialActivityCounts)||void 0===t?void 0:t.liked}get isMentionedInArticle(){var e,t,r,i
|
|
const l=null===(e=this.authenticatedUser)||void 0===e||null===(t=e.miniProfile)||void 0===t?void 0:t.dashEntityUrn
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled){var n,a
|
|
const e=null===(n=this.model)||void 0===n||null===(a=n.articleData)||void 0===a?void 0:a.contentResolutionResults
|
|
return null==e?void 0:e.some((e=>{var t,r,i
|
|
return null==e||null===(t=e.textBlock)||void 0===t||null===(r=t.content)||void 0===r||null===(i=r.attributesV2)||void 0===i?void 0:i.find((e=>{var t,r
|
|
return(null==e||null===(t=e.detailData)||void 0===t||null===(r=t.profileMention)||void 0===r?void 0:r.entityUrn)===l}))}))}const o=null===(r=this.model)||void 0===r||null===(i=r.articleData)||void 0===i?void 0:i.content
|
|
return null==o?void 0:o.some((e=>{var t,r
|
|
return null===(t=e.content)||void 0===t||null===(r=t.attributes)||void 0===r?void 0:r.find((e=>e.dashProfileUrn===l))}))}get isSubscribed(){var e,t,r,i,l,n,a,o,s
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.series)||void 0===r||null===(i=r.subscribeAction)||void 0===i?void 0:i.subscribed:null===(l=this.model)||void 0===l||null===(n=l.articleData)||void 0===n||null===(a=n.series)||void 0===a||null===(o=a.followAction)||void 0===o||null===(s=o.followingInfo)||void 0===s?void 0:s.following}get newsletterId(){var e,t,r
|
|
return(0,w.getNewsletterId)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.series)||void 0===r?void 0:r.shareableLink)}get seriesSubscribers(){var e,t,r
|
|
return(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.series)||void 0===r?void 0:r.subscribers)||[]}get seriesSubscriberCount(){var e,t,r,i
|
|
return(0,w.getSeriesSubscriberCount)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.series)||void 0===r||null===(i=r.subscribeAction)||void 0===i?void 0:i.subscriberCount)}get showPostPublishingFlow(){var e,t
|
|
return(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.viewerAllowedToEdit)&&!!this.published}get textDirection(){var e,t
|
|
return(0,v.default)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.contentHtml)}get thirdPartyArticleId(){var e,t
|
|
return(0,w.getThirdPartyArticleId)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.linkedInArticleUrn)}get _trackingId(){return this.trackingId||(0,p.generateTrackingId)()}get allowedCommentersScope(){var e
|
|
return null===(e=this.socialDetail)||void 0===e?void 0:e.allowedCommentersScope}get isCommentingDisabled(){var e,t
|
|
return!(null!==(e=this.socialDetail)&&void 0!==e&&null!==(t=e.socialPermissions)&&void 0!==t&&t.canPostComments)}get getArticleContent(){var e,t,r,i
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.contentResolutionResults:null===(r=this.model)||void 0===r||null===(i=r.articleData)||void 0===i?void 0:i.content}get seriesLogo(){var e,t,r,i,l,n,a,o,s,c
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t||null===(r=t.series)||void 0===r||null===(i=r.logo)||void 0===i||null===(l=i.attributes)||void 0===l||null===(n=l[0])||void 0===n||null===(a=n.detailData)||void 0===a?void 0:a.vectorImage:null===(o=this.model)||void 0===o||null===(s=o.articleData)||void 0===s||null===(c=s.series)||void 0===c?void 0:c.logo}get getUgcMetadata(){var e,t,r
|
|
return this.isFirstPartyArticleDashAndGqlEnabled?null===(e=this.model)||void 0===e||null===(t=e.ugcMetadata)||void 0===t?void 0:t.updateActions:null===(r=this.model)||void 0===r?void 0:r.ugcMetadata}closeRemoveMentionDialog(){this.showRemoveMentionDialog=!1}fireFeedActionEvent(e,t,r){(0,u.fireArticleReaderFeedActionEvent)({actionType:e,actionCategory:t,controlName:r,legacyTrackingId:this._trackingId,feedActionEventService:this.feedActionEvent,authorId:this.authorId,updateUrn:this.updateUrn})}openRemoveMentionDialog(){this.showRemoveMentionDialog=!0}removeMention(){var e,t
|
|
const r=(0,b.addQueryParam)(`/${m.default.namespace}/voyagerPublishingDashFirstPartyArticles`,"action","removeMentions"),i=(0,E.extractUrnParts)(null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.entityUrn)[1],l={data:{firstPartyArticleUrn:(0,g.toUrn)("publishing/dash-first-party-article",i)}}
|
|
return this.storeShim.adapterFor("-ember-m3").ajax(r,"POST",l).then((()=>{(0,n.isDestroying)(this)||(this.showRemoveMentionDialog=!1)}))}resetPublished(){this.published=null}resetShouldScrollToComments(){this.shouldScrollToComments=!1}updateCommentRestrictionSettings(e){var t
|
|
const r=null===(t=this.socialDetail)||void 0===t?void 0:t.urn,[i,l,a]=this.isCommentPermissionDashEnabled?(0,f.dashUpdateCommentRestrictionSettingRequest)(this.socialDetail.dashEntityUrn,e):(0,f.updateCommentRestrictionSettingRequest)(r,e)
|
|
return this.storeShim.adapterFor("-ember-m3").ajax(i,l,a).then((()=>{(0,o.set)(this,"socialDetail.allowedCommentersScope",e)
|
|
if("NONE"===e){(0,o.set)(this,"socialDetail.commentingDisabled",!0);(0,o.set)(this,"socialDetail.socialPermissions.canPostComments",!1);(0,o.set)(this,"socialDetail.totalSocialActivityCounts.numComments",0)}else{(0,o.set)(this,"socialDetail.commentingDisabled",!1);(0,o.set)(this,"socialDetail.socialPermissions.canPostComments",!0)}const t=this.i18n.lookupTranslation("components/social-details@comments/comments-settings",{ALL:"article_comment_restriction_success_ALL",CONNECTIONS_ONLY:"article_comment_restriction_success_CONNECTIONS_ONLY"}[e])()
|
|
this.persistentToastManager.success({message:t})})).catch((e=>{if((0,n.isDestroying)(this))throw e
|
|
const t=this.i18n.lookupTranslation("components/feed-control-menu@comment-restriction-settings-modal","comment_restriction_network_error_occurred")()
|
|
t&&this.persistentToastManager.error({message:t})
|
|
throw e}))}onArticleFooterButtonClick(){this.isArticleFooterButtonClicked=!0}openLeadGenForm(){this.isLeadGenFormModalOpen=!0
|
|
this.fetchLeadGenModalData()}fetchLeadGenModalData(){var e,t,r
|
|
const i=null===(e=this.model)||void 0===e||null===(t=e.gatedArticleMetadata)||void 0===t||null===(r=t.leadGenForm)||void 0===r?void 0:r.entityUrn
|
|
this.leadGenFormAsyncData=(0,_.load)(this.graphql.executeQuery(A.default,{urn:i}).then((e=>{if(!(0,n.isDestroying)(this))return e.data.feedDashLeadGenFormById})).catch((e=>{if((0,n.isDestroying)(this))throw e
|
|
this.isLeadGenFormModalOpen=!1
|
|
this.hasSubmittedLeadGenForm=!0})))}get leadGenToastSuccessMessage(){const{i18n:e}=this
|
|
return jSecure.htmlUnencode(e.lookupTranslation("article-reader@index","i18n_article_reader_lgf_form_success_message_v2")([{authorName:this.authorActor.authorName}]))}onToggleSubscribeSeries(){var e,t
|
|
let r,i,l,a
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled){var o,s,c,d
|
|
r=null===(o=this.model)||void 0===o?void 0:o.articleData.series
|
|
i=null===(s=r)||void 0===s?void 0:s.subscribeAction
|
|
l=null===(c=i)||void 0===c?void 0:c.subscribed
|
|
a=null===(d=i)||void 0===d?void 0:d.entityUrn}else{var u,p,f,h,g,y
|
|
r=null===(u=this.model)||void 0===u?void 0:u.articleData.series
|
|
i=null===(p=r)||void 0===p||null===(f=p.followAction)||void 0===f?void 0:f.followingInfo
|
|
l=null===(h=i)||void 0===h?void 0:h.following
|
|
a=null===(g=r)||void 0===g||null===(y=g.subscribeAction)||void 0===y?void 0:y.dashEntityUrn}const v=this.storeShim.adapterFor("-ember-m3"),_=new k.default(this.persistentToastManager,this.i18n),A=(0,b.addQueryParam)(`/${m.default.namespace}/voyagerPublishingDashSeriesSubscribers`,"action",l?"unsubscribe":"subscribeSeries"),w=(0,E.extractUrnParts)(a)[1],T={data:l?{subscribeActionUrn:a}:{contentSeriesUrn:w}},D=(0,O.getPemAdapterOptions)(this.lix,O.DEGRADATION_TRACKING_METADATA.TOGGLE_SUBSCRIBE,null===(e=this.model)||void 0===e||null===(t=e.articleData)||void 0===t?void 0:t.permalink),S=v.ajax(A,"POST",T),P=this.pemTracking.trackFeatureDegradations(A,D.degradedEntityIDsToRemove,D.degradations,S),I=this.isArticleFooterButtonClicked?"subscribe-newsletter-via-article-footer":"subscribe-newsletter-via-article-header"
|
|
this.isArticleFooterButtonClicked=!1
|
|
return P.then((e=>{var t
|
|
if((0,n.isDestroying)(this))return
|
|
this.watchmanTracking.endInteraction({userInteraction:I,userJourney:"subscribe-to-newsletter",groupName:"publishing-reliability"})
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled){this.model.articleData.series.subscribeAction.subscribed=!l
|
|
i.incrementProperty("subscriberCount",l?-1:1)}else{this.model.articleData.series.followAction.followingInfo.following=!l
|
|
i.incrementProperty("followerCount",l?-1:1)}const r=(0,C.default)(null==e||null===(t=e.data)||void 0===t?void 0:t.value)
|
|
_.success(!l,null==r?void 0:r.message,null==r?void 0:r.ctaText,null==r?void 0:r.ctaUrl)})).catch((e=>{if((0,n.isDestroying)(this))throw e
|
|
this.watchmanTracking.endInteractionWithError({userInteraction:I,userJourney:"subscribe-to-newsletter",groupName:"publishing-reliability"})
|
|
_.error()
|
|
console.error("There was an error when toggling follow series: ",e)
|
|
throw e}))}},L=(0,i.default)(F.prototype,"authenticatedUser",[D],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),z=(0,i.default)(F.prototype,"feedActionEvent",[S],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),B=(0,i.default)(F.prototype,"formatter",[P],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),G=(0,i.default)(F.prototype,"i18n",[I],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),q=(0,i.default)(F.prototype,"graphql",[N],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),H=(0,i.default)(F.prototype,"storeShim",[R],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),V=(0,i.default)(F.prototype,"persistentToastManager",[M],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),W=(0,i.default)(F.prototype,"lix",[x],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),Y=(0,i.default)(F.prototype,"watchmanTracking",[j],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),$=(0,i.default)(F.prototype,"pemTracking",[U],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),K=(0,i.default)(F.prototype,"published",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return null}}),X=(0,i.default)(F.prototype,"shouldScrollToComments",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),Q=(0,i.default)(F.prototype,"isArticleFooterButtonClicked",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),J=(0,i.default)(F.prototype,"leadGenFormAsyncData",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),Z=(0,i.default)(F.prototype,"adTrackingCode",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ee=(0,i.default)(F.prototype,"creativeId",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),te=(0,i.default)(F.prototype,"showRemoveMentionDialog",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),re=(0,i.default)(F.prototype,"hasSubmittedLeadGenForm",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),ie=(0,i.default)(F.prototype,"isLeadGenFormModalOpen",[c.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),(0,i.default)(F.prototype,"closeRemoveMentionDialog",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"closeRemoveMentionDialog"),F.prototype),(0,i.default)(F.prototype,"fireFeedActionEvent",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"fireFeedActionEvent"),F.prototype),(0,i.default)(F.prototype,"openRemoveMentionDialog",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"openRemoveMentionDialog"),F.prototype),(0,i.default)(F.prototype,"removeMention",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"removeMention"),F.prototype),(0,i.default)(F.prototype,"resetPublished",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"resetPublished"),F.prototype),(0,i.default)(F.prototype,"resetShouldScrollToComments",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"resetShouldScrollToComments"),F.prototype),(0,i.default)(F.prototype,"updateCommentRestrictionSettings",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"updateCommentRestrictionSettings"),F.prototype),(0,i.default)(F.prototype,"onArticleFooterButtonClick",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"onArticleFooterButtonClick"),F.prototype),(0,i.default)(F.prototype,"openLeadGenForm",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"openLeadGenForm"),F.prototype),(0,i.default)(F.prototype,"fetchLeadGenModalData",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"fetchLeadGenModalData"),F.prototype),(0,i.default)(F.prototype,"onToggleSubscribeSeries",[o.action],Object.getOwnPropertyDescriptor(F.prototype,"onToggleSubscribeSeries"),F.prototype),F)}))
|
|
define("article-reader/controllers/preview",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/controller","@ember/service","article-reader/utils/get-text-direction","article-reader/utils/shared-article-getters","article-reader/utils/get-member-actor-model","@glimmer/tracking","@ember/object","@ember/destroyable","article-reader/components/-private/i18n-strings","rsvp","restli-utils","feed-utils/utils/error-parsing","publishing-shared/utils/data-request","global-utils/utils/url"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var v,_,A,w,T,k,E,C,O,D,S,P,I,N,R,M,x
|
|
e.default=(v=(0,a.inject)("authentication@authenticated-user"),_=(0,a.inject)("formatter"),A=(0,a.inject)("jet"),w=(0,a.inject)("i18n"),T=(0,a.inject)("persistent-toast-manager@persistent-toast-manager"),k=(0,a.inject)("tracking"),E=class extends n.default{constructor(){super(...arguments);(0,r.default)(this,"queryParams",["companyAuthorUrn"]);(0,t.default)(this,"authenticatedUser",C,this);(0,t.default)(this,"formatter",O,this);(0,t.default)(this,"jet",D,this);(0,t.default)(this,"i18n",S,this);(0,t.default)(this,"persistentToastManager",P,this);(0,t.default)(this,"tracking",I,this);(0,t.default)(this,"companyAuthorUrn",N,this);(0,t.default)(this,"hasQueuedSaveRequest",R,this);(0,t.default)(this,"isShareDraftModalOpen",M,this);(0,t.default)(this,"showPublishModal",x,this)}get currentArticle(){return this.model.firstPartyArticle}get dashArticleData(){return this.model.dashFirstPartyArticle}get articleAuthor(){var e
|
|
return null===(e=this.currentArticle.authorsResolutionResults)||void 0===e?void 0:e[0]}get articleAuthorName(){var e,t,r,i
|
|
return(null===(e=this.articleAuthor)||void 0===e||null===(t=e.companyUrn)||void 0===t?void 0:t.name)??(null===(r=this.articleAuthor)||void 0===r||null===(i=r.profileUrn)||void 0===i?void 0:i.firstName)}get isViewerAuthor(){var e,t
|
|
const r=((null===(e=this.articleAuthor)||void 0===e?void 0:e.companyUrn)??(null===(t=this.articleAuthor)||void 0===t?void 0:t.profileUrn))||{}
|
|
return(null==r?void 0:r.entityUrn)===this.authenticatedUser.miniProfile.dashEntityUrn}get isPageAuthor(){return!!this.model.pageAdminOrganization}get viewerHasAccess(){var e
|
|
return null!==(e=this.articleAuthor)&&void 0!==e&&e.companyUrn?this.isPageAuthor:this.isViewerAuthor}get authorActorModel(){var e,t,r
|
|
return null!==(e=this.articleAuthor)&&void 0!==e&&e.companyUrn?(0,c.getMemberActorFromCompanyAuthor)(null===(t=this.articleAuthor)||void 0===t?void 0:t.companyUrn,!0,null):(0,c.getMemberActorFromMemberAuthor)(null===(r=this.articleAuthor)||void 0===r?void 0:r.profileUrn,!0,null,this.formatter)}get publishActor(){var e
|
|
return null!==(e=this.articleAuthor)&&void 0!==e&&e.companyUrn?this.model.pageAdminOrganization:this.authenticatedUser.miniProfile}get textDirection(){return(0,o.default)(this.currentArticle.contentHtml)}get imageType(){var e,t
|
|
return(0,s.getImageType)(null===(e=this.authorActorModel)||void 0===e||null===(t=e.model)||void 0===t?void 0:t.pagePublished)}get isFollowing(){var e,t,r
|
|
return null===(e=this.authorActorModel)||void 0===e||null===(t=e.model)||void 0===t||null===(r=t.followingInfo)||void 0===r?void 0:r.following}get isSubscribed(){var e,t,r
|
|
return null===(e=this.currentArticle)||void 0===e||null===(t=e.series)||void 0===t||null===(r=t.subscribeAction)||void 0===r?void 0:r.subscribed}get newsletterId(){var e,t
|
|
return(0,s.getNewsletterId)(null===(e=this.currentArticle)||void 0===e||null===(t=e.series)||void 0===t?void 0:t.shareableLink)}get seriesSubscriberCount(){var e,t,r
|
|
return(0,s.getSeriesSubscriberCount)(null===(e=this.currentArticle)||void 0===e||null===(t=e.series)||void 0===t||null===(r=t.subscribeAction)||void 0===r?void 0:r.subscriberCount)}get shareDraftLink(){const e=`${(0,y.getDomainUrl)()}/pulse/draft/preview/${this.model.articleId}`
|
|
return this.model.companyAuthorUrn?`${e}/?companyAuthorUrn=${this.model.companyAuthorUrn}`:e}dismissModal(){this.tracking.fireInteractionEvent("cancel_share_draft")
|
|
this.isShareDraftModalOpen=!1}setShareDraftModal(e){this.isShareDraftModalOpen=e}publishArticle(){this.dashArticleData.state="PUBLISHED"
|
|
return this.saveArticle()}saveArticle(){if(this.dashArticleData.contentHtml.length>125e3){this.persistentToastManager.error({message:this.i18n.lookupTranslation(m.default,"i18n_error_max_content_length_exceeded")()})
|
|
return(0,f.reject)("Article has reached the character limit")}const{entityUrn:e,state:t}=this.dashArticleData
|
|
return this.dashArticleData.save(...(0,g.saveArticle)({entityUrn:e,state:t,transformPayload:e=>e,pemProductName:"Voyager - Article Preview"})).catch((e=>{if(!(0,p.isDestroying)(this)){var t,r,i
|
|
if((0,b.isHttpErrorStatus)(e)){const{message:t,status:r}=e.errors[0]
|
|
if(parseInt(r,10)===h.httpStatus.S_400_BAD_REQUEST&&(0,b.isValidVoyagerUserVisibleException)(e))return this.persistentToastManager.error({message:t})}const l=null==e||null===(t=e.errors)||void 0===t||null===(r=t[0])||void 0===r||null===(i=r.meta)||void 0===i?void 0:i.callTreeId
|
|
this.jet.logError(new Error(`Draft failed to save with stack ${l} and Content: ${JSON.stringify(this.dashArticleData.content)}. ContentHtml: ${JSON.stringify(this.dashArticleData.contentHtml)}`),"publishing-save-edit-draft",!1)}throw e}))}},C=(0,i.default)(E.prototype,"authenticatedUser",[v],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),O=(0,i.default)(E.prototype,"formatter",[_],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),D=(0,i.default)(E.prototype,"jet",[A],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),S=(0,i.default)(E.prototype,"i18n",[w],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),P=(0,i.default)(E.prototype,"persistentToastManager",[T],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),I=(0,i.default)(E.prototype,"tracking",[k],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),N=(0,i.default)(E.prototype,"companyAuthorUrn",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return null}}),R=(0,i.default)(E.prototype,"hasQueuedSaveRequest",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),M=(0,i.default)(E.prototype,"isShareDraftModalOpen",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),x=(0,i.default)(E.prototype,"showPublishModal",[d.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),(0,i.default)(E.prototype,"dismissModal",[u.action],Object.getOwnPropertyDescriptor(E.prototype,"dismissModal"),E.prototype),(0,i.default)(E.prototype,"setShareDraftModal",[u.action],Object.getOwnPropertyDescriptor(E.prototype,"setShareDraftModal"),E.prototype),(0,i.default)(E.prototype,"publishArticle",[u.action],Object.getOwnPropertyDescriptor(E.prototype,"publishArticle"),E.prototype),(0,i.default)(E.prototype,"saveArticle",[u.action],Object.getOwnPropertyDescriptor(E.prototype,"saveArticle"),E.prototype),E)}))
|
|
define("article-reader/engine",["exports","@babel/runtime/helpers/esm/defineProperty","@ember/engine","ember-load-initializers","strict-resolver"],(function(e,t,r,i,l){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const n="article-reader",a=class extends r.default{constructor(){super(...arguments);(0,t.default)(this,"Resolver",l.default);(0,t.default)(this,"modulePrefix",n)}};(0,i.default)(a,n)
|
|
e.default=a}))
|
|
define.alias("ember-truth-helpers/helpers/and","article-reader/helpers/and")
|
|
define.alias("artdeco-datepicker/helpers/artdeco-adjust-date-for-timezone","article-reader/helpers/artdeco-adjust-date-for-timezone")
|
|
define.alias("artdeco-datepicker/helpers/artdeco-is-between-dates","article-reader/helpers/artdeco-is-between-dates")
|
|
define.alias("ember-media-player/helpers/autoplay-media","article-reader/helpers/autoplay-media")
|
|
define.alias("artdeco-datepicker/helpers/cal-dates-equal","article-reader/helpers/cal-dates-equal")
|
|
define.alias("ember-element-helper/helpers/element","article-reader/helpers/element")
|
|
define.alias("ember-holy-futuristic-template-namespacing-batman/helpers/-translate-dynamic-2","article-reader/helpers/ember-holy-futuristic-template-namespacing-batman-translate-dynamic-2")
|
|
define("article-reader/helpers/ensure-safe-component",["exports","@embroider/util"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.EnsureSafeComponentHelper}})}))
|
|
define.alias("ember-truth-helpers/helpers/eq","article-reader/helpers/eq")
|
|
define.alias("ember-media-player/helpers/format-autoplay","article-reader/helpers/format-autoplay")
|
|
define.alias("ember-cli-pemberly-i18n/helpers/format-number","article-reader/helpers/format-number")
|
|
define.alias("ember-semaphore/helpers/format-title","article-reader/helpers/format-title")
|
|
define.alias("ember-truth-helpers/helpers/gt","article-reader/helpers/gt")
|
|
define.alias("ember-truth-helpers/helpers/gte","article-reader/helpers/gte")
|
|
define("article-reader/helpers/html-safe",["exports","@babel/runtime/helpers/esm/defineProperty","@ember/component/helper"],(function(e,t,r){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.htmlSafeHelper=l
|
|
class i{constructor(e){(0,t.default)(this,"string",void 0)
|
|
this.string=e}toString(){return`${this.string}`}toHTML(){return this.toString()}}function l(e){let[t=""]=e
|
|
return new i(t)}const n=(0,r.helper)(l)
|
|
e.default=n}))
|
|
define.alias("@linkedin/hue-web-artdeco-migration-runtime/helpers/convert-to-icon-name","article-reader/helpers/hue-web-artdeco-icon-migration-runtime")
|
|
define.alias("@linkedin/hue-web-artdeco-migration-runtime/helpers/convert-to-icon-v2","article-reader/helpers/hue-web-artdeco-li-icon-migration-runtime-v2")
|
|
define.alias("@linkedin/hue-web-artdeco-migration-runtime/helpers/convert-to-icon-path","article-reader/helpers/hue-web-artdeco-li-icon-migration-runtime")
|
|
define.alias("@linkedin/hue-web-artdeco-migration-runtime/helpers/convert-argument","article-reader/helpers/hue-web-artdeco-migration-runtime")
|
|
define.alias("ember-truth-helpers/helpers/is-array","article-reader/helpers/is-array")
|
|
define.alias("ember-truth-helpers/helpers/is-empty","article-reader/helpers/is-empty")
|
|
define.alias("ember-truth-helpers/helpers/is-equal","article-reader/helpers/is-equal")
|
|
define.alias("artdeco-icons-web/helpers/li-icon","article-reader/helpers/li-icon")
|
|
define.alias("ember-async-data/helpers/load","article-reader/helpers/load")
|
|
define.alias("ember-truth-helpers/helpers/lt","article-reader/helpers/lt")
|
|
define.alias("ember-truth-helpers/helpers/lte","article-reader/helpers/lte")
|
|
define.alias("ember-truth-helpers/helpers/not-eq","article-reader/helpers/not-eq")
|
|
define.alias("ember-truth-helpers/helpers/not","article-reader/helpers/not")
|
|
define.alias("ember-truth-helpers/helpers/or","article-reader/helpers/or")
|
|
define("article-reader/helpers/ref-to",["exports","ember-ref-bucket/helpers/ref-to"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.defineProperty(e,"refTo",{enumerable:!0,get:function(){return t.default}})}))
|
|
define.alias("ember-route-action-helper/helpers/route-action","article-reader/helpers/route-action")
|
|
define.alias("ember-app-scheduler/helpers/route-idle","article-reader/helpers/route-idle")
|
|
define.alias("ember-media-player/helpers/seek-media","article-reader/helpers/seek-media")
|
|
define.alias("ember-set-helper/helpers/set","article-reader/helpers/set")
|
|
define.alias("ember-cli-pemberly-i18n/helpers/t","article-reader/helpers/t")
|
|
define.alias("ember-truth-helpers/helpers/xor","article-reader/helpers/xor")
|
|
define.alias("ember-uuid","article-reader/index")
|
|
define("article-reader/initializers/coordinator-setup",["exports","article-reader/models/coordinator"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default={name:"setup coordinator",initialize:function(){let e=arguments[1]||arguments[0]
|
|
e.register("drag:coordinator",t.default)}}}))
|
|
define("article-reader/initializers/icons",["exports","artdeco-icons-web/src/icons","article-reader/config/environment"],(function(e,t,r){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
function i(e){throw e}e.default={name:"icons",initialize:function(){const{environment:e,APP:l}=r.default
|
|
let n,a
|
|
l&&({artdecoCustomSpriteUrl:n,artdecoCustomSpriteName:a}=l)
|
|
const o="test"!==e
|
|
t.default.load(o,n,a).catch(i)}}}))
|
|
define.alias("ember-cli-pemberly-lix/initializers/lix","article-reader/initializers/lix")
|
|
define.alias("ember-m3/initializers/m3-store","article-reader/initializers/m3-store")
|
|
define.alias("ember-ref-bucket/instance-initializers/global-ref-cleanup","article-reader/instance-initializers/global-ref-cleanup")
|
|
define.alias("video/instance-initializers/media-plugins","article-reader/instance-initializers/media-plugins")
|
|
define("article-reader/models/coordinator",["exports","@ember/object","@ember/object/evented","article-reader/models/obj-hash","ember-drag-drop/utils/proxy-unproxy-objects"],(function(e,t,r,i,l){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default.extend(r.default,{objectMap:(0,t.computed)((function(){return i.default.create()})),getObject:function(e,t){t=t||{}
|
|
var r=this.get("objectMap").getObj(e)
|
|
if(r.ops.source&&!r.ops.source.isDestroying&&!r.ops.source.isDestroyed){const e=r.ops.source.action
|
|
"function"==typeof e&&e(r.obj)
|
|
"string"==typeof e&&"function"==typeof r.ops.source.target[e]&&r.ops.source.target[e](r.obj)}if(r.ops.target&&!r.ops.target.isDestroying&&!r.ops.target.isDestroyed){const e=r.ops.target.action
|
|
"function"==typeof e&&e(r.obj)
|
|
"string"==typeof e&&"function"==typeof r.ops.target.source[e]&&r.ops.target.source[e](r.obj)}this.trigger("objectMoved",{obj:(0,l.unwrapper)(r.obj),source:r.ops.source,target:t.target})
|
|
return(0,l.unwrapper)(r.obj)},setObject:function(e,t){t=t||{}
|
|
return this.get("objectMap").add({obj:e,ops:t})}})}))
|
|
define("article-reader/models/obj-hash",["exports","@ember/object","@ember/object/computed","@ember/array"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default.extend({contentLength:0,length:(0,r.alias)("contentLength"),init:function(){this._super()
|
|
this.content={}},add:function(e){var t=this.generateId()
|
|
this.get("content")[t]=e
|
|
this.incrementProperty("contentLength")
|
|
return t},getObj:function(e){var t=this.get("content")[e]
|
|
if(!t)throw new Error("no obj for key "+e)
|
|
return t},generateId:function(){var e=1e12*Math.random()
|
|
return e=""+(e=parseInt(e))},keys:function(){var e=[]
|
|
for(var t in this.get("content"))e.push(t)
|
|
return(0,i.A)(e)}})}))
|
|
define.alias("artdeco-datepicker/modifiers/artdeco-calendar-click-watcher","article-reader/modifiers/artdeco-calendar-click-watcher")
|
|
define.alias("ember-ref-bucket/modifiers/create-ref","article-reader/modifiers/create-ref")
|
|
define.alias("ember-css-transitions/modifiers/css-transition","article-reader/modifiers/css-transition")
|
|
define.alias("@ember/render-modifiers/modifiers/did-insert","article-reader/modifiers/did-insert")
|
|
define.alias("ember-scroll-modifiers/modifiers/did-intersect","article-reader/modifiers/did-intersect")
|
|
define.alias("ember-resize-modifier/modifiers/did-resize","article-reader/modifiers/did-resize")
|
|
define.alias("@ember/render-modifiers/modifiers/did-update","article-reader/modifiers/did-update")
|
|
define.alias("ember-finite-scroll/modifiers/ember-finite-scroll/focus","article-reader/modifiers/ember-finite-scroll/focus")
|
|
define.alias("image-editor/modifiers/fabric","article-reader/modifiers/fabric")
|
|
define("article-reader/modifiers/manage-article-content",["exports","@babel/runtime/helpers/esm/classPrivateFieldSet","@babel/runtime/helpers/esm/classPrivateFieldGet","@ember/destroyable","ember-modifier"],(function(e,t,r,i,l){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var n=new WeakMap,a=new WeakMap,o=new WeakMap
|
|
class s extends l.default{constructor(){super(...arguments)
|
|
n.set(this,{writable:!0,value:""})
|
|
a.set(this,{writable:!0,value:!1})
|
|
o.set(this,{writable:!0,value:null});(0,i.registerDestructor)(this,(()=>{var e
|
|
null===(e=(0,r.default)(this,o))||void 0===e||e.call(this)}))}modify(e,i,l){const{entityUrn:s,onArticleUpdate:c,onDestroy:d}=l
|
|
if((0,r.default)(this,a)){if((0,r.default)(this,n)!==s){null==c||c(e,s);(0,t.default)(this,n,s)}}else{var u;(0,t.default)(this,a,!0);(0,t.default)(this,n,s)
|
|
null===(u=l.onArticleInsert)||void 0===u||u.call(l,e)}(0,t.default)(this,o,d)}}e.default=s}))
|
|
define("article-reader/modifiers/manage-embed-block",["exports","@linkedin/jsecure","ember-modifier"],(function(e,t,r){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const i=(0,r.modifier)(((e,r,i)=>{let{embedBlock:l}=i
|
|
if(l){const r=new t.default.UnsafeString(l.content,{allowTags:["iframe"]})
|
|
e.innerHTML=r}}),{eager:!1})
|
|
e.default=i}))
|
|
define("article-reader/modifiers/manage-theme-param",["exports","@babel/runtime/helpers/esm/classPrivateFieldSet","@babel/runtime/helpers/esm/classPrivateFieldGet","ember-modifier"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var l=new WeakMap,n=new WeakMap
|
|
class a extends i.default{constructor(){super(...arguments)
|
|
l.set(this,{writable:!0,value:!1})
|
|
n.set(this,{writable:!0,value:null})}modify(e,i,a){let{onIframeInsert:o,theme:s,onThemeChange:c}=a
|
|
if((0,r.default)(this,l)){if((0,r.default)(this,n)!==s){null==c||c();(0,t.default)(this,n,s)}}else{(0,t.default)(this,l,!0);(0,t.default)(this,n,s)
|
|
null==o||o(e)}}}e.default=a}))
|
|
define.alias("ember-prop-modifier","article-reader/modifiers/prop")
|
|
define.alias("ember-scroll-modifiers/modifiers/scroll-into-view","article-reader/modifiers/scroll-into-view")
|
|
define("article-reader/modifiers/smooth-scroll-to",["exports","@ember/debug","ember-batcher","ember-modifier","ember-test-waiters","voyager-web/config/environment"],(function(e,t,r,i,l,n){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const a=(0,l.buildWaiter)("smooth-scroll-waiter"),o=Object.freeze({xxfast:52,xfast:84,fast:132,moderate:216,slow:336,xslow:560,xxslow:916}),s=Object.freeze({linear:e=>e,easeInQuad:e=>e**2,easeOutQuad:e=>1-(1-e)**2,easeInOutQuad:e=>e<.5?(2*e)**2/2:(1-(1-(2*e-1))**2)/2+.5,easeInCubic:e=>e**3,easeOutCubic:e=>1-(1-e)**3,easeInOutCubic:e=>e<.5?(2*e)**3/2:(1-(1-(2*e-1))**3)/2+.5,easeInQuart:e=>e**4,easeOutQuart:e=>1-(1-e)**4,easeInOutQuart:e=>e<.5?(2*e)**4/2:(1-(1-(2*e-1))**4)/2+.5,easeInQuint:e=>e**5,easeOutQuint:e=>1-(1-e)**5,easeInOutQuint:e=>e<.5?(2*e)**5/2:(1-(1-(2*e-1))**5)/2+.5})
|
|
function c(){return"test"===n.default.environment?document.querySelector("#ember-testing-container"):document.scrollingElement}function d(e){const t=Math.min((performance.now()-e.startTime)/e.duration,1),r=e.easing(t)
|
|
let i=e.startPosition+(e.targetPosition-e.startPosition)*r
|
|
const l=e.startPosition<=e.targetPosition
|
|
i=Math[l?"min":"max"](i,e.targetPosition)
|
|
c().scrollTo(0,i)
|
|
if(l&&i<e.targetPosition||!l&&i>e.targetPosition)window.requestAnimationFrame(d.bind(this,e))
|
|
else{var n
|
|
e.waiter.endAsync(e.waiterToken)
|
|
e.resetShouldScroll()
|
|
null===(n=document.querySelector(e.elementToFocusAfterScroll))||void 0===n||n.focus()}}const u=(0,i.modifier)(((e,t,i)=>{let{resetShouldScroll:l,shouldScroll:n,duration:u="xslow",easing:p="easeInOutCubic",elementToFocusAfterScroll:m,target:f,top:h=0}=i
|
|
n&&(0,r.readDOM)((()=>{const t=f?e.querySelector(f):e
|
|
if(t){const e=function(e){let t=arguments.length>1&&void 0!==arguments[1]?arguments[1]:0
|
|
const r=c(),i="ember-testing-container"===r.getAttribute("id")
|
|
let l=t
|
|
i&&(l+=r.getBoundingClientRect().top+r.clientTop)
|
|
return e.getBoundingClientRect().top+r.scrollTop-l}(t,h),r=a.beginAsync()
|
|
d({duration:o[u],easing:s[p],elementToFocusAfterScroll:m,resetShouldScroll:l,startPosition:window.pageYOffset,startTime:performance.now(),targetPosition:e,waiter:a,waiterToken:r})}}))}),{eager:!1})
|
|
e.default=u}))
|
|
define.alias("ember-sortable/modifiers/sortable-group","article-reader/modifiers/sortable-group")
|
|
define.alias("ember-sortable/modifiers/sortable-handle","article-reader/modifiers/sortable-handle")
|
|
define.alias("ember-sortable/modifiers/sortable-item","article-reader/modifiers/sortable-item")
|
|
define("article-reader/modifiers/track-content-blocks",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/service","ember-modifier"],(function(e,t,r,i,l,n,a){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var o,s,c
|
|
const d=["com.linkedin.voyager.publishing.TextBlock","com.linkedin.voyager.publishing.EmbedBlock","com.linkedin.voyager.publishing.ImageBlock","com.linkedin.voyager.publishing.DividerBlock"],u=["SCHEDULED","PUBLISHED"]
|
|
e.default=(o=(0,n.inject)("client-sensor-web@client-sensor"),s=class extends a.default{constructor(){super(...arguments);(0,t.default)(this,"clientSensor",c,this)}modify(e,t,r){let{contentBlocks:i=[],state:l=""}=r
|
|
if(i&&i.length>0){if(i.some((e=>{const t=Object.keys(e)
|
|
return!!(1===t.length)&&d.includes(t[0])}))){const e=!u.includes(l)
|
|
this.clientSensor.incrementMetricCounter({groupName:"publishing",metricName:e?"draft-article-content-not-rendered":"published-article-content-not-rendered"})}}}},c=(0,i.default)(s.prototype,"clientSensor",[o],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),s)}))
|
|
define.alias("@ember/render-modifiers/modifiers/will-destroy","article-reader/modifiers/will-destroy")
|
|
define.alias("ember-cloud-filepicker/providers/base-provider","article-reader/providers/base-provider")
|
|
define.alias("ember-cloud-filepicker/providers/dropbox-provider","article-reader/providers/dropbox-provider")
|
|
define.alias("ember-cloud-filepicker/providers/onedrive-provider","article-reader/providers/onedrive-provider")
|
|
define("article-reader/providers/slideshare-provider",["exports","ember-cloud-filepicker/providers/slideshare-provider"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define("article-reader/routes/application",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/routing/route","@ember/service"],(function(e,t,r,i,l,n,a){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var o,s,c
|
|
e.default=(o=(0,a.inject)("router"),s=class extends n.default{constructor(){super(...arguments);(0,t.default)(this,"router",c,this)}beforeModel(e){var t
|
|
if("article-reader-legacy"===(null===(t=e.to)||void 0===t?void 0:t.name)){const{articlePermalink:t}=e.to.params
|
|
this.router.transitionTo("article-reader.index",t)}}},c=(0,i.default)(s.prototype,"router",[o],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),s)}))
|
|
define("article-reader/routes/index",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/destroyable","@ember/debug","@ember/service","@ember/object","@ember/routing/route","@ember/utils","article-reader/utils/build-pulse-url","article-reader/utils/constants","article-reader/utils/dwelltime","article-reader/utils/has-user-error","article-reader/utils/tracking-utils","feed-requests/update-actions","feed-utils/utils/gdpr","feed-utils/utils/like-handler","global-utils/utils/url","lego/utils/lego-page-content","publishing-shared/utils/constants","publishing-shared/utils/data-request","publishing-shared/utils/utils","reactions/utils/reaction-update-helper","rsvp","article-reader/utils/pem","global-utils/utils/html-safe","@glimmer/tracking","global-utils/utils/is-browser","@linkedin/ember-restli-graphql","graphql-queries/queries/publishing/fetch-related-articles-for-url.graphql","graphql-queries/queries/publishing/fetch-articles-for-url.graphql","graphql-queries/queries/publishing/fetch-updates-by-urn-or-nss.graphql","article-reader/utils/data-requests"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f,h,b,g,y,v,_,A,w,T,k,E,C,O,D,S,P,I,N,R,M){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var x,j,U,F,L,z,B,G,q,H,V,W,Y,$,K,X,Q,J,Z,ee,te,re,ie,le,ne,ae,oe,se,ce,de,ue,pe,me
|
|
const fe="article-reader@index",he=["AUTO_PUBLISHED_AI_ARTICLE","REVIEWED_AI_ARTICLE"]
|
|
e.default=(x=(0,o.inject)("authentication@authenticated-user"),j=(0,o.inject)("profile-services@identity-store"),U=(0,o.inject)("feed-tracking@feed-action-event"),F=(0,o.inject)("gdpr-notice@gdpr-notice"),L=(0,o.inject)("global-services@window"),z=(0,o.inject)("social-counts-service@social-counts"),B=(0,o.inject)("i18n"),G=(0,o.inject)("jet"),q=(0,o.inject)("lix"),H=(0,o.inject)("persistent-toast-manager@persistent-toast-manager"),V=(0,o.inject)("router"),W=(0,o.inject)("global-services@store-shim"),Y=(0,o.inject)("tracking"),$=(0,o.inject)("pem-tracking"),K=(0,o.inject)("@linkedin/ember-restli-graphql@graphql"),X=class extends c.default{constructor(){super(...arguments);(0,t.default)(this,"authenticatedUser",Q,this);(0,t.default)(this,"identityStore",J,this);(0,t.default)(this,"feedActionEvent",Z,this);(0,t.default)(this,"gdprNotice",ee,this);(0,t.default)(this,"windowService",te,this);(0,t.default)(this,"socialCountsService",re,this);(0,t.default)(this,"i18n",ie,this);(0,t.default)(this,"jet",le,this);(0,t.default)(this,"lix",ne,this);(0,t.default)(this,"persistentToastManager",ae,this);(0,t.default)(this,"router",oe,this);(0,t.default)(this,"storeShim",se,this);(0,t.default)(this,"tracking",ce,this);(0,t.default)(this,"pemTracking",de,this);(0,t.default)(this,"graphql",ue,this);(0,r.default)(this,"_likeHandler",null);(0,t.default)(this,"showErrorState",pe,this);(0,t.default)(this,"seriesCollection",me,this);(0,r.default)(this,"queryParams",{trackingId:{refreshModel:!1},likeFromLogin:{refreshModel:!1},published:{refreshModel:!1},customModuleKey:{refreshModel:!1},creativeId:{refreshModel:!1},adTrackingCode:{refreshModel:!1}})
|
|
this.dwelltimeTracking=new m.default(this.tracking)
|
|
const e={authenticatedUser:this.authenticatedUser,gdprNotice:this.gdprNotice,i18n:this.i18n,jet:this.jet,store:this.storeShim,persistentToastManager:this.persistentToastManager,tracking:this.tracking,pemTracking:this.pemTracking},i={authenticatedActor:this.authenticatedActor,likeNetworkErrorMessage:this.likeNetworkErrorMessage};(0,s.setProperties)(this,{_likeHandler:new y.default(e,i),initialCommentSortOrderType:p.COMMENT_SORT_TYPES.RELEVANCE});(0,s.set)(this,"_likeHandler",new y.default(e,i))}willDestroy(){this.dwelltimeTracking.destroy()
|
|
super.willDestroy(...arguments)}getCriticalData(e){const{storeShim:t}=this,r=isNaN(e.creativeId)?void 0:e.creativeId,i={q:"url",url:(0,u.default)((0,v.getDomainUrl)(),e.articlePermalink)},l=this.isFirstPartyArticleDashAndGqlEnabled?"/voyager/api/graphql":"publishing/firstPartyContent",a=`${l}|${i.q}|${i.url}`,o=(0,C.getPemAdapterOptions)(this.lix,C.DEGRADATION_TRACKING_METADATA.LOAD_FIRST_PARTY_CONTENT,e.articlePermalink)
|
|
let s
|
|
s=this.isFirstPartyArticleDashAndGqlEnabled?this.graphql.executeQuery(N.default,{url:i.url,creativeId:r},{adapterOptions:o,cacheKey:a,reload:!0}):t.queryURL(l,{adapterOptions:o,cacheKey:a,params:i,reload:!0})
|
|
return s.catch((e=>{if((0,n.isDestroying)(this))throw e;(0,f.hasUserError)(e)||this.tracking.fireTrackingPayload({topicName:"OopsPageViewEvent",eventName:"PageViewEvent"},{})
|
|
throw e}))}get isFirstPartyArticleDashAndGqlEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.publishing-graphql-first-party-article")}get isPageContentGraphQLEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.hiring-lego-page-content-graphql-migration")}getNonCriticalData(e,t){var r
|
|
const{storeShim:i}=this,l={q:"relatedContent",url:(0,u.default)((0,v.getDomainUrl)(),e.articlePermalink)},a=`${this.isFirstPartyArticleDashAndGqlEnabled?"/voyager/api/graphql":"publishing/firstPartyArticles"}|${l.q}|${e.articlePermalink}`
|
|
l.recipe="com.linkedin.voyager.deco.publishing.FirstPartyArticleRelatedContent"
|
|
const o=this.initialCommentSortOrderType,s=null==t||null===(r=t.model)||void 0===r?void 0:r.initialUpdateUrn,c=(0,C.getPemAdapterOptions)(this.lix,C.DEGRADATION_TRACKING_METADATA.LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT,e.articlePermalink)
|
|
let d
|
|
d=this.isFirstPartyArticleDashAndGqlEnabled?this.graphql.executeQuery(I.default,{count:5,url:l.url},{adapterOptions:c,cacheKey:a,reload:!0}):this.storeShim.queryURL("publishing/firstPartyArticles",{adapterOptions:c,cacheKey:a,params:l,reload:!0})
|
|
return{relatedContent:d,socialDetail:i.findRecord(...(0,C.socialDetailRequestwithDegradationInstrumentation)(s,2,o,this.lix,C.DEGRADATION_TRACKING_METADATA.LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT_SOCIAL_DETAIL)).then((e=>{if(!(0,n.isDestroying)(this)){this.socialCountsService.registerSocialCounts(e)
|
|
return e}}))}}async getArticleList(e){const t=(0,M.getArticleList)(e,this.lix),r=await this.identityStore.queryURL(...t)
|
|
if(!(0,n.isDestroying)(this)){this.socialCountsService.registerElementsList(r.elements)
|
|
return r}}getRelatedArticleCarouselTitle(e,t){var r
|
|
if(!e||!t)return""
|
|
const i=e.toJSON()
|
|
return((null===(r=t.series)||void 0===r?void 0:r.issueCount)??0)>=2?this.i18n.lookupTranslation(fe,"i18n_more_from_this_newsletter")():(0,O.default)(this.i18n.lookupTranslation(fe,"i18n_more_from_author_with_full_name")([{member:i}]))}loadNewsletterAccess(e){this._fetchNewslettersAndAccess().then((e=>{let{isSeriesEnabled:t,seriesCollection:r}=e
|
|
if(!(0,n.isDestroying)(this)){this.seriesCollection=r
|
|
return!!t&&this._fetchLegoPageData()}})).then((t=>{var r,i
|
|
if((0,n.isDestroying)(this))return
|
|
if(!t)return
|
|
const l=(0,T.getNewsletterBannerLegoData)(this.isPageContentGraphQLEnabled?null==t||null===(r=t.elements)||void 0===r?void 0:r[0]:t,this.isPageContentGraphQLEnabled)
|
|
l&&(0,s.setProperties)(e,{shouldShowNewsletterBanner:(0,T.shouldShowNewsletterBanner)(!0,this.isPageContentGraphQLEnabled?null==t||null===(i=t.elements)||void 0===i?void 0:i[0]:t,this.seriesCollection.length,this.isPageContentGraphQLEnabled),newsletterLegoTrackingToken:l.trackingToken})})).catch((e=>{if((0,n.isDestroying)(this))throw e
|
|
this.jet.logError(new Error("Error fetching newsletter data in article-reader"),"article-reader-newsletter-failure",!1)
|
|
if(!e||!(e.isAdapterError||e instanceof P.GraphQLQueryError))throw e}))}loadComments(e,t,r){var i
|
|
const{trackingId:l}=t,a=null==r||null===(i=r.model)||void 0===i?void 0:i.initialUpdateUrn,o=this.initialCommentSortOrderType
|
|
return this.storeShim.findRecord(...(0,C.socialDetailRequestwithDegradationInstrumentation)(a,2,o,this.lix,C.DEGRADATION_TRACKING_METADATA.LOAD_SOCIAL_DETAIL)).then((t=>{if((0,n.isDestroying)(this))return
|
|
const{totalSocialActivityCounts:i}=t,a=(0,k.getReactionTypeSelected)(i)
|
|
this.socialCountsService.registerSocialCounts(t);(0,s.setProperties)(r,{initialReactionTypeSelected:a,initialCommentSortOrderType:this.initialCommentSortOrderType,socialDetail:t,trackingId:l})
|
|
this.fireArticleViewEvent(e,r)
|
|
return r}))}loadCommentsAndRelatedArticles(e,t,r){var i,l,a,o,c,d,u,p,m,f
|
|
const{trackingId:h}=t
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled?null===(i=e.authorsResolutionResults)||void 0===i||null===(l=i[0])||void 0===l?void 0:l.companyUrn:null===(a=e.authors)||void 0===a||null===(o=a[0])||void 0===o?void 0:o.miniCompany){r.relatedContent=null
|
|
return this.loadComments(e,t,r)}const b=this.isFirstPartyArticleDashAndGqlEnabled?null===(c=e.authorsResolutionResults)||void 0===c||null===(d=c[0])||void 0===d||null===(u=d.profileUrn)||void 0===u?void 0:u.publicIdentifier:null===(p=e.authors)||void 0===p||null===(m=p[0])||void 0===m||null===(f=m.miniProfile)||void 0===f?void 0:f.publicIdentifier
|
|
return this.getArticleList(b).then((i=>{if(!(0,n.isDestroying)(this))return(0,E.hashSettled)(this.getNonCriticalData(t,r)).then((e=>{if(!(0,n.isDestroying)(this))return Object.keys(e).reduce(((t,r)=>{"fulfilled"===e[r].state&&(t[r]=e[r].value)
|
|
return t}),{})})).then((t=>{var l,a,o,c,d
|
|
if((0,n.isDestroying)(this))return
|
|
const u=this.isFirstPartyArticleDashAndGqlEnabled?null===(l=t.relatedContent)||void 0===l||null===(a=l.data)||void 0===a||null===(o=a.publishingDashFirstPartyArticlesByRelatedContent)||void 0===o?void 0:o.elements:null===(c=t.relatedContent)||void 0===c?void 0:c.elements,p=null===(d=i.paging)||void 0===d?void 0:d.total,m=t.socialDetail??{},{totalSocialActivityCounts:f}=m,b=(0,k.getReactionTypeSelected)(f),g=this.getRelatedArticleCarouselTitle(r.get("authorActor.model.miniProfile"),e);(0,s.setProperties)(r,{initialReactionTypeSelected:b,initialCommentSortOrderType:this.initialCommentSortOrderType,relatedContent:u,socialDetail:m,totalArticles:p,trackingId:h,relatedCarouselTitle:g})
|
|
this.fireArticleViewEvent(e,r)
|
|
return r}))}))}model(e){if((0,n.isDestroying)(this))return
|
|
const{customModuleKey:t}=e
|
|
t&&this.feedActionEvent.setCustomModuleKey(t)
|
|
return this.getCriticalData(e).then((t=>{var r,i
|
|
if((0,n.isDestroying)(this))return
|
|
if(this.isFirstPartyArticleDashAndGqlEnabled){var l,a,o
|
|
const r=null==t||null===(l=t.data)||void 0===l||null===(a=l.publishingDashFirstPartyArticlesByUrl)||void 0===a||null===(o=a.elements)||void 0===o?void 0:o[0]
|
|
if(!r){this.showErrorState=!0
|
|
return}return this.graphql.executeQuery(R.default,{urnOrNss:null==r?void 0:r.initialUpdateUrn}).then((t=>{var i,l,a,o,c,d,u,p,m,f,h,b,g
|
|
if((0,n.isDestroying)(this))return
|
|
const y=r.activityUrn,v=null===(i=r.socialDetail)||void 0===i?void 0:i.showPremiumAnalytics
|
|
return s.default.create({articleData:r,ugcActor:null==t||null===(l=t.data)||void 0===l||null===(a=l.feedDashUpdatesByBackendUrnOrNss)||void 0===a||null===(o=a.elements)||void 0===o||null===(c=o[0])||void 0===c?void 0:c.actor,ugcCommentary:null==t||null===(d=t.data)||void 0===d||null===(u=d.feedDashUpdatesByBackendUrnOrNss)||void 0===u||null===(p=u.elements)||void 0===p||null===(m=p[0])||void 0===m?void 0:m.commentary,ugcMetadata:null==t||null===(f=t.data)||void 0===f||null===(h=f.feedDashUpdatesByBackendUrnOrNss)||void 0===h||null===(b=h.elements)||void 0===b||null===(g=b[0])||void 0===g?void 0:g.ugcMetadata,shareUrl:r.shareUrl,trackingId:e.trackingId,initialUpdateUrn:r.initialUpdateUrn,summaryPageActivityUrn:y,showPremiumAnalytics:v,gatedArticleMetadata:r.gatedArticleMetadata})}))}const c=(null===(r=t.elements)||void 0===r?void 0:r[0])??{},u=c.content;(0,d.isEmpty)(u)&&(this.showErrorState=!0)
|
|
const p=c.activityUrn,m=null===(i=c.socialDetail)||void 0===i?void 0:i.showPremiumAnalytics
|
|
return s.default.create({articleData:u,ugcActor:c.actor,ugcCommentary:c.commentary,ugcMetadata:c.updateMetadata,shareUrl:c.shareUrl,trackingId:e.trackingId,initialUpdateUrn:c.initialUpdateUrn,summaryPageActivityUrn:p,showPremiumAnalytics:m})}))}afterModel(e,t){var r
|
|
if(!(0,n.isDestroying)(this)&&S.default&&he.includes(null==e||null===(r=e.articleData)||void 0===r?void 0:r.articleType)){const e=this.paramsFor(this.routeName)
|
|
this.windowService.getLocation().replace(`${(0,v.getDomainUrl)()}/advice/${e.articlePermalink}`)
|
|
t.abort()}}setupController(e,t){if(!(0,n.isDestroying)(this)){super.setupController(...arguments)
|
|
if(this.showErrorState)e.set("showErrorState",this.showErrorState)
|
|
else{const r=this.paramsFor(this.routeName),{initialUpdateUrn:i}=t;(0,s.set)(e,"initialUpdateUrn",i)
|
|
this.loadCommentsAndRelatedArticles(t.articleData,r,e)
|
|
r.likeFromLogin&&(0,g.showGdprLikeCreatedNotice)(this.i18n,this.gdprNotice)
|
|
const l=e.get("model.ugcMetadata"),n=l?l.urn:e.get("model.articleData.linkedInArticleUrn"),a=t.get("trackingId")
|
|
e.setProperties({trackingId:a,updateUrn:n})
|
|
this.dwelltimeTracking.populateArticleData(e.get("authorId"),e.get("thirdPartyArticleId"),e.get("_trackingId"))
|
|
this.loadNewsletterAccess(e)}}}fireArticleViewEvent(e,t){this.tracking.fireTrackingPayload(p.TRACKING.VIEW_EVENT.EVENT_NAME,{authorId:t.get("authorId"),totalLikes:t.get("socialDetail.totalSocialActivityCounts.numLikes"),totalComments:t.get("socialDetail.totalSocialActivityCounts.numComments"),totalShares:t.get("socialDetail.totalSocialActivityCounts.numShares")||0,linkedInArticleUrn:`urn:li:linkedInArticle:${t.get("firstPartyArticleId")}`,articleId:0})}getGenericTrackingInformation(){const e=this.controllerFor(this.routeName)
|
|
return{feedActionEventService:this.feedActionEvent,authorId:e.authorId,updateUrn:e.updateUrn}}hideSemaphore(){this.controllerFor(this.routeName).set("isReporting",!1)}willTransition(){this.dwelltimeTracking.recordDwelltime()}toggleCommentSettings(){var e
|
|
const t=this.controllerFor(this.routeName)
|
|
if(null==t||null===(e=t.socialDetail)||void 0===e?void 0:e.commentingDisabled){(0,s.set)(t,"socialDetail.allowedCommentersScope","NONE");(0,s.set)(t,"socialDetail.commentingDisabled",!0);(0,s.set)(t,"socialDetail.socialPermissions.canPostComments",!1)}else{(0,s.set)(t,"socialDetail.allowedCommentersScope","ALL");(0,s.set)(t,"socialDetail.commentingDisabled",!1);(0,s.set)(t,"socialDetail.socialPermissions.canPostComments",!0)}}onShowShare(){this.controllerFor(this.routeName).set("isShowingShare",!0)}onToggleFollow(e){var t
|
|
const r=this.controllerFor(this.routeName),i=null===(t=r.authorActor)||void 0===t?void 0:t.model,{followingInfo:l}=i,n=(0,C.getPemAdapterOptions)(this.lix,C.DEGRADATION_TRACKING_METADATA.TOGGLE_FOLLOW,this.currentModel.articleData.permalink),[a,o,s]=(0,b.toggleFollowWithFollowingInfoRequest)(l,void 0,this.isFirstPartyArticleDashAndGqlEnabled,this.isFirstPartyArticleDashAndGqlEnabled),c=this.storeShim.adapterFor("-ember-m3").ajax(a,o,s)
|
|
this.pemTracking.trackFeatureDegradations(a,n.degradedEntityIDsToRemove,n.degradations,c)
|
|
const{actionCategory:d,actionType:u,controlName:p}=e?{actionCategory:"UNFOLLOW",controlName:"actor_follow_toggle",actionType:"unfollowMember"}:{actionCategory:"FOLLOW",controlName:"actor_follow_toggle",actionType:"followMember"};(0,h.fireArticleReaderFeedActionEvent)({actionType:u,actionCategory:d,controlName:p,legacyTrackingId:r._trackingId,...this.getGenericTrackingInformation()})}onReport(){this.controllerFor(this.routeName).set("isReporting",!0)}onReportSuccess(){this.hideSemaphore()}onReportFailure(){const e=this.i18n.lookupTranslation(fe,"report_update_error")()
|
|
this.persistentToastManager.error({message:e})
|
|
this.hideSemaphore()}onReportCancel(){this.hideSemaphore()}onArticleNotFound(){this.replaceWithExternal("feed.index")}onShowSubscribersModal(){this.controllerFor(this.routeName).set("showSubscribersModal",!0)}onClickAuthorAnnotationFeedback(){const{tracking:e,windowService:t,"controller._trackingId":r,"controller.updateUrn":i,"controller.model.articleData.annotationActionType":l,"controller.model.articleData.annotation.controlName":n,"controller.model.articleData.annotation.link.url":a}=(0,s.getProperties)(this,"tracking","windowService","controller._trackingId","controller.updateUrn","controller.model.articleData.annotationActionType","controller.model.articleData.annotation.controlName","controller.model.articleData.annotation.link.url")
|
|
t.open((0,v.generateUrlByDomain)(a),"_blank")
|
|
e.fireInteractionEvent(n)
|
|
e.fireTrackingPayload(p.TRACKING.ACTION_EVENTS.EVENT_NAME,{actionType:l,actionCategory:"VIEW",controlUrn:e.generateControlUrn(n),topic:p.TRACKING.ACTION_EVENTS.EVENT_NAME,trackablePulseObject:{trackingId:r,objectUrn:i}})}onClickGraphqlAuthorAnnotationFeedback(){const{tracking:e,windowService:t,"controller._trackingId":r,"controller.updateUrn":i,"controller.model.articleData.articleAnnotation.annotationTrackingActionType":l,"controller.model.articleData.articleAnnotation.annotation.controlName":n,"controller.model.articleData.articleAnnotation.annotation.linkUrl":a}=(0,s.getProperties)(this,"tracking","windowService","controller._trackingId","controller.updateUrn","controller.model.articleData.articleAnnotation.annotationTrackingActionType","controller.model.articleData.articleAnnotation.annotation.controlName","controller.model.articleData.articleAnnotation.annotation.linkUrl")
|
|
t.open((0,v.generateUrlByDomain)(a),"_blank")
|
|
e.fireInteractionEvent(n)
|
|
e.fireTrackingPayload(p.TRACKING.ACTION_EVENTS.EVENT_NAME,{actionType:l,actionCategory:"VIEW",controlUrn:e.generateControlUrn(n),topic:p.TRACKING.ACTION_EVENTS.EVENT_NAME,trackablePulseObject:{trackingId:r,objectUrn:i}})}transitionToPublishingEditor(){this.router.transitionTo("publishing.post.new.index")}_fetchNewslettersAndAccess(){return this.storeShim.queryURL(...(0,w.fetchNewslettersAndAccess)()).then((e=>{var t
|
|
if(!(0,n.isDestroying)(this))return{isSeriesEnabled:null===(t=e.metadata)||void 0===t?void 0:t.creationEnabled,seriesCollection:e.elements}})).catch((e=>{if((0,n.isDestroying)(this))throw e
|
|
this.jet.logError(new Error("Network request failed while attempting to verify user access to newsletter creation"),"publishing-verify-newsletter-access",!1)
|
|
throw e}))}_fetchLegoPageData(){const{PAGE_KEY:e,SLOT_ID:t}=A.ARTICLE_READER_LEGO_CONFIGS
|
|
return(this.isPageContentGraphQLEnabled?(0,_.getLegoDataGraphQL)(this.graphql,e,t):(0,_.getLegoData)(this.storeShim,e,t)).catch((r=>{if((0,n.isDestroying)(this))throw r
|
|
this.jet.logError(new Error(`Error fetching lego data in article-reader, pageKey=${e}, slotId=${t}`),"article-reader-lego-failure",!1)
|
|
throw r}))}error(e,t){if(!(0,n.isDestroying)(this)){(0,f.hasUserError)(e)||this.pemTracking.trackOopsPage(e,t)
|
|
return!0}}resetController(e,t){super.resetController(...arguments)
|
|
if(t){e.published=null
|
|
e.adTrackingCode=void 0
|
|
e.creativeId=void 0}}},Q=(0,i.default)(X.prototype,"authenticatedUser",[x],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),J=(0,i.default)(X.prototype,"identityStore",[j],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),Z=(0,i.default)(X.prototype,"feedActionEvent",[U],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ee=(0,i.default)(X.prototype,"gdprNotice",[F],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),te=(0,i.default)(X.prototype,"windowService",[L],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),re=(0,i.default)(X.prototype,"socialCountsService",[z],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ie=(0,i.default)(X.prototype,"i18n",[B],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),le=(0,i.default)(X.prototype,"jet",[G],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ne=(0,i.default)(X.prototype,"lix",[q],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ae=(0,i.default)(X.prototype,"persistentToastManager",[H],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),oe=(0,i.default)(X.prototype,"router",[V],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),se=(0,i.default)(X.prototype,"storeShim",[W],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ce=(0,i.default)(X.prototype,"tracking",[Y],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),de=(0,i.default)(X.prototype,"pemTracking",[$],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),ue=(0,i.default)(X.prototype,"graphql",[K],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),pe=(0,i.default)(X.prototype,"showErrorState",[D.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return!1}}),me=(0,i.default)(X.prototype,"seriesCollection",[D.tracked],{configurable:!0,enumerable:!0,writable:!0,initializer:function(){return null}}),(0,i.default)(X.prototype,"willTransition",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"willTransition"),X.prototype),(0,i.default)(X.prototype,"toggleCommentSettings",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"toggleCommentSettings"),X.prototype),(0,i.default)(X.prototype,"onShowShare",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onShowShare"),X.prototype),(0,i.default)(X.prototype,"onToggleFollow",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onToggleFollow"),X.prototype),(0,i.default)(X.prototype,"onReport",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onReport"),X.prototype),(0,i.default)(X.prototype,"onReportSuccess",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onReportSuccess"),X.prototype),(0,i.default)(X.prototype,"onReportFailure",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onReportFailure"),X.prototype),(0,i.default)(X.prototype,"onReportCancel",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onReportCancel"),X.prototype),(0,i.default)(X.prototype,"onArticleNotFound",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onArticleNotFound"),X.prototype),(0,i.default)(X.prototype,"onShowSubscribersModal",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onShowSubscribersModal"),X.prototype),(0,i.default)(X.prototype,"onClickAuthorAnnotationFeedback",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onClickAuthorAnnotationFeedback"),X.prototype),(0,i.default)(X.prototype,"onClickGraphqlAuthorAnnotationFeedback",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"onClickGraphqlAuthorAnnotationFeedback"),X.prototype),(0,i.default)(X.prototype,"transitionToPublishingEditor",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"transitionToPublishingEditor"),X.prototype),(0,i.default)(X.prototype,"error",[s.action],Object.getOwnPropertyDescriptor(X.prototype,"error"),X.prototype),X)}))
|
|
define("article-reader/routes/index/index",["exports","@babel/runtime/helpers/esm/defineProperty","@ember/routing/route","article-reader/utils/constants"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class l extends r.default{constructor(){super(...arguments);(0,t.default)(this,"pageKey",i.PAGEKEY)}}e.default=l}))
|
|
define("article-reader/routes/preview",["exports","@babel/runtime/helpers/esm/initializerDefineProperty","@babel/runtime/helpers/esm/defineProperty","@babel/runtime/helpers/esm/classPrivateMethodGet","@babel/runtime/helpers/esm/applyDecoratedDescriptor","@babel/runtime/helpers/esm/initializerWarningHelper","@ember/routing/route","@ember/service","@ember/destroyable","article-reader/utils/data-requests","publishing-shared/utils/data-request","global-utils/utils/urn-converter","article-reader/utils/retry-op","restli-utils","global-utils/utils/is-network-error"],(function(e,t,r,i,l,n,a,o,s,c,d,u,p,m,f){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
var h,b,g,y,v,_,A,w,T,k,E,C,O,D,S,P,I
|
|
e.default=(h=(0,o.inject)("@linkedin/ember-restli-graphql@graphql"),b=(0,o.inject)("profile-services@identity-store"),g=(0,o.inject)("jet"),y=(0,o.inject)("lix"),v=(0,o.inject)("router"),_=(0,o.inject)("social-counts-service@social-counts"),A=(0,o.inject)("global-services@store-shim"),w=(P=new WeakSet,I=new WeakSet,class extends a.default{constructor(){super(...arguments)
|
|
I.add(this)
|
|
P.add(this);(0,r.default)(this,"pageKey","flagship3_pulse_draft_preview");(0,t.default)(this,"graphql",T,this);(0,t.default)(this,"identityStore",k,this);(0,t.default)(this,"jet",E,this);(0,t.default)(this,"lix",C,this);(0,t.default)(this,"router",O,this);(0,t.default)(this,"socialCountsService",D,this);(0,t.default)(this,"storeShim",S,this)}get isArticlePreviewEnabled(){return this.lix.getTreatmentIsEnabled("voyager.web.article-preview")}beforeModel(){this.isArticlePreviewEnabled||this.router.transitionTo("article-editor.index.new")}resetController(e,t){super.resetController(...arguments)
|
|
t&&(e.companyAuthorUrn=null)}setupController(e,t){if(!(0,s.isDestroying)(this)){super.setupController(...arguments)
|
|
t.pageAdminOrganization||(e.companyAuthorUrn=null)}}async model(e){if(!(0,s.isDestroying)(this))try{var t,r,l,n,a,o,d,h,b
|
|
const m=(0,c.getDashSharedDraftArticleData)(e),{url:f,options:g}=m,y=await(0,p.default)((()=>this.storeShim.queryURL(f,g)),3)
|
|
if((0,s.isDestroying)(this))return
|
|
const v=await(0,p.default)((()=>this.graphql.executeQuery(...(0,c.getGqlSharedDraftArticleData)(e))),3)
|
|
if((0,s.isDestroying)(this))return
|
|
const _=await Promise.all([y,v])
|
|
if((0,s.isDestroying)(this))return
|
|
const A=_[0],w=null===(t=_[1].data)||void 0===t||null===(r=t.publishingDashFirstPartyArticlesBySharedLatestDraftById)||void 0===r||null===(l=r.elements)||void 0===l?void 0:l[0]
|
|
"PUBLISHED"===w.state&&this.router.transitionTo("article-reader.index",w.permalink)
|
|
const T=e.companyAuthorUrn||""
|
|
let k
|
|
if(T.includes("company")){const e=(0,u.convertUrnType)("organization/dash-company",T)
|
|
k=await(0,i.default)(this,P,N).call(this,e)
|
|
if((0,s.isDestroying)(this))return}const E=null==w||null===(n=w.authorsResolutionResults)||void 0===n||null===(a=n[0])||void 0===a||null===(o=a.profileUrn)||void 0===o?void 0:o.publicIdentifier
|
|
let C
|
|
if(E){C=await(0,i.default)(this,I,R).call(this,E)
|
|
if((0,s.isDestroying)(this))return}return{firstPartyArticle:w,dashFirstPartyArticle:null==A||null===(d=A.elements)||void 0===d?void 0:d[0],pageAdminOrganization:k,totalArticles:(null===(h=C)||void 0===h||null===(b=h.paging)||void 0===b?void 0:b.total)??0,articleId:null==e?void 0:e.articleId,companyAuthorUrn:T}}catch(e){var g,y
|
|
if((0,s.isDestroying)(this))throw e;(0,f.default)(e)&&this.jet.logError(new Error("Network request failed while attempting to fetch draft article data in preview route."),"publishing-preview-fetch-article",!1);(e&&parseInt(null===(g=e.errors)||void 0===g||null===(y=g[0])||void 0===y?void 0:y.status,10))===m.httpStatus.S_404_NOT_FOUND&&this.router.transitionTo("article-editor.index.new")
|
|
throw e}}}),T=(0,l.default)(w.prototype,"graphql",[h],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),k=(0,l.default)(w.prototype,"identityStore",[b],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),E=(0,l.default)(w.prototype,"jet",[g],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),C=(0,l.default)(w.prototype,"lix",[y],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),O=(0,l.default)(w.prototype,"router",[v],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),D=(0,l.default)(w.prototype,"socialCountsService",[_],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),S=(0,l.default)(w.prototype,"storeShim",[A],{configurable:!0,enumerable:!0,writable:!0,initializer:null}),w)
|
|
async function N(e){var t
|
|
const r=await(0,d.getOrganizationDataGraphQL)(e,this.jet,this.graphql,"Voyager - Article Preview")
|
|
if((0,s.isDestroying)(this))return
|
|
const i=null===(t=r.data.organizationDashCompaniesByIds)||void 0===t?void 0:t[0]
|
|
return i.viewerPermissions.canCreateOrganicShare?i:void 0}function R(e){const t=(0,c.getArticleList)(e,this.lix)
|
|
return this.identityStore.queryURL(...t).then((e=>{if(!(0,s.isDestroying)(this)){this.socialCountsService.registerElementsList(e.elements)
|
|
return e}})).catch((e=>{if((0,s.isDestroying)(this))throw e;(0,f.default)(e)&&this.jet.logError(new Error("Network request failed while attempting to fetch draft article list elements."),"publishing-preview-fetch-article-list",!1)
|
|
throw e}))}}))
|
|
define.alias("@embroider/util/services/ensure-registered","article-reader/services/-ensure-registered")
|
|
define.alias("artdeco-hoverables/services/artdeco-hoverable","article-reader/services/artdeco-hoverable")
|
|
define.alias("artdeco-modal/services/artdeco-modal","article-reader/services/artdeco-modal")
|
|
define.alias("artdeco-toast/services/artdeco-toast","article-reader/services/artdeco-toast")
|
|
define.alias("client-sensor-web/services/client-sensor","article-reader/services/client-sensor")
|
|
define.alias("ember-date-service/services/date","article-reader/services/date")
|
|
define("article-reader/services/drag-coordinator",["exports","ember-drag-drop/services/drag-coordinator"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=t.default}))
|
|
define.alias("@linkedin/ember-restli-graphql/services/graphql","article-reader/services/graphql")
|
|
define.alias("image-editor/services/image-editor-loader","article-reader/services/image-editor-loader")
|
|
define.alias("@linkedin/ember-pem/services/internal-event-utils","article-reader/services/internal-event-utils")
|
|
define.alias("@linkedin/ember-pem/services/internal-pem-tracking","article-reader/services/internal-pem-tracking")
|
|
define.alias("ember-cli-pemberly-lix/services/lix","article-reader/services/lix")
|
|
define.alias("ember-m3/services/m3-schema-manager","article-reader/services/m3-schema-manager")
|
|
define.alias("ember-media-player/services/media-player","article-reader/services/media-player")
|
|
define.alias("@linkedin/ember-pem/services/pem-response-metadata","article-reader/services/pem-response-metadata")
|
|
define.alias("@linkedin/ember-pem/services/pem-tracking","article-reader/services/pem-tracking")
|
|
define.alias("persistent-toast-manager/services/persistent-toast-manager","article-reader/services/persistent-toast-manager")
|
|
define("article-reader/services/preview-text-char-counter",["exports","@babel/runtime/helpers/esm/defineProperty","@ember/service"],(function(e,t,r){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
class i extends r.default{constructor(){super(...arguments);(0,t.default)(this,"previewCharCount",0);(0,t.default)(this,"paragraphCount",0)}setPreviewTextCharCount(e){this.previewCharCount=e}incrementParagraphCount(){this.paragraphCount+=1}getPreviewTextCharCount(){return this.previewCharCount}getParagraphCount(){return this.paragraphCount}}e.default=i}))
|
|
define.alias("@linkedin/ember-qualtrics/services/qualtrics-surveys","article-reader/services/qualtrics-surveys")
|
|
define.alias("ember-media-player/services/static-asset-loader","article-reader/services/static-asset-loader")
|
|
define.alias("ember-cli-pemberly-m3/services/store","article-reader/services/store")
|
|
define.alias("ember-cli-pemberly-litms/services/tag-manager","article-reader/services/tag-manager")
|
|
define.alias("@linkedin/ember-pem/services/tracer","article-reader/services/tracer")
|
|
define.alias("ember-cli-pemberly-litms/services/tracking-adapter-for-tag-manager","article-reader/services/tracking-adapter-for-tag-manager")
|
|
define("article-reader/template-registry",[],(function(){}))
|
|
define("article-reader/templates/application",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"FdoHSXJZ",block:'[[[46,[28,[37,1],null,null],null,null,null],[1,"\\n\\n"],[8,[39,2],[[24,0,"reader-footer"],[16,"aria-label",[28,[37,3],["i18n_reader_footer","article-reader/templates/application"],null]]],null,null]],[],false,["component","-outlet","global-footer@global-footer","t"]]',moduleName:"article-reader/templates/application.hbs",isStrictMode:!1})}))
|
|
define("article-reader/templates/components/draggable-object-target",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"bCq1Na1x",block:'[[[41,[30,1],[[[1," "],[11,3],[24,6,"#"],[4,[38,1],[[30,0,["acceptForDrop"]]],null],[12],[1,"\\n "],[18,2,null],[1,"\\n "],[13],[1,"\\n"]],[]],[[[1," "],[18,2,null],[1,"\\n"]],[]]]],["@enableClicking","&default"],false,["if","fn","yield"]]',moduleName:"article-reader/templates/components/draggable-object-target.hbs",isStrictMode:!1})}))
|
|
define("article-reader/templates/components/draggable-object",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"r+fBy/jH",block:'[[[41,[30,1],[[[1," "],[11,3],[24,6,"#"],[4,[38,1],[[30,0,["selectForDrag"]]],null],[12],[1,"\\n "],[18,2,null],[1,"\\n "],[13],[1,"\\n"]],[]],[[[1," "],[18,2,null],[1,"\\n"]],[]]]],["@enableClicking","&default"],false,["if","fn","yield"]]',moduleName:"article-reader/templates/components/draggable-object.hbs",isStrictMode:!1})}))
|
|
define("article-reader/templates/components/sortable-objects",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"XdRSQFs1",block:'[[[18,1,null]],["&default"],false,["yield"]]',moduleName:"article-reader/templates/components/sortable-objects.hbs",isStrictMode:!1})}))
|
|
define("article-reader/templates/index",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"va9EsybR",block:'[[[1,"\\n"],[1,[28,[35,0],[[30,0,["model","articleData","title"]]],null]],[1,"\\n\\n"],[10,0],[14,0,"reader"],[12],[1,"\\n "],[8,[39,1],[[24,0,"mh1"]],[["@template"],["main"]],[["main"],[[[[1,"\\n"],[41,[30,0,["showErrorState"]],[[[1," "],[8,[39,3],null,[["@onTimeEnds"],[[28,[37,4],["onArticleNotFound"],null]]],null],[1,"\\n"]],[]],[[[41,[30,0,["shouldShowNewsletterBanner"]],[[[1," "],[8,[39,5],null,[["@headlineText","@messageText","@legoTrackingToken","@onDismiss","@onPrimaryAction"],[[28,[37,6],["i18n_newsletter_banner_header_article_reader","article-reader/templates/index"],null],[28,[37,6],["i18n_newsletter_banner_message_article_reader","article-reader/templates/index"],null],[30,0,["newsletterLegoTrackingToken"]],[28,[37,7],[[30,0],"shouldShowNewsletterBanner",false],null],[28,[37,4],["transitionToPublishingEditor"],null]]],null],[1,"\\n"]],[]],null],[1," "],[8,[39,8],null,null,[["default"],[[[[1,"\\n "],[11,"article"],[24,0,"reader__content"],[24,"itemtype","http://schema.org/NewsArticle"],[4,[38,9],null,[["elementToFocusAfterScroll","resetShouldScroll","shouldScroll","target","top"],[".comments-comment-box__form .ql-editor[role=\\"textbox\\"]",[30,0,["resetShouldScrollToComments"]],[30,0,["shouldScrollToComments"]],".reader-social-details__comments",[30,0,["scrollToCommentsTop"]]]]],[4,[38,10],null,null],[12],[1,"\\n"],[41,[30,0,["showPostPublishingFlow"]],[[[41,[30,0,["authorActor","model","pagePublished"]],[[[1," "],[8,[39,11],null,[["@onClose","@pageName","@permalink","@user"],[[30,0,["resetPublished"]],[30,0,["authorActor","authorName"]],[30,0,["model","articleData","permalink"]],[30,0,["authenticatedUser","miniProfile"]]]],null],[1,"\\n"]],[]],[[[1," "],[8,[39,12],null,[["@onClose","@articleModel","@author"],[[30,0,["resetPublished"]],[30,0,["model","articleData"]],[30,0,["authorActor"]]]],null],[1,"\\n"]],[]]]],[]],null],[1,"\\n"],[41,[30,0,["model","articleData","series"]],[[[1," "],[8,[39,13],null,[["@class","@feedUpdate","@isArticleFlagged","@newsletterId","@numberOfSubscribers","@onShowSubscribersModal","@onToggleSubscribeSeries","@series","@subscribersModel","@thirdPartyArticleId","@trackingId","@updateUrn","@viewerAllowedToEdit","@isUsingDashAndGql"],["display-flex justify-center",[30,0,["feedUpdate"]],[30,0,["isArticleFlagged"]],[30,0,["newsletterId"]],[30,0,["seriesSubscriberCount"]],[28,[37,4],["onShowSubscribersModal"],null],[30,0,["onToggleSubscribeSeries"]],[30,0,["model","articleData","series"]],[30,0,["seriesSubscribers"]],[30,0,["thirdPartyArticleId"]],[30,0,["_trackingId"]],[30,0,["updateUrn"]],[30,0,["model","articleData","viewerAllowedToEdit"]],[30,0,["isFirstPartyArticleDashAndGqlEnabled"]]]],null],[1,"\\n"]],[]],null],[1,"\\n "],[10,"header"],[12],[1,"\\n"],[41,[30,0,["model","articleData","viewerAllowedToEdit"]],[[[1," "],[8,[39,14],null,[["@companyId","@companyUrn","@fireFeedActionEvent","@firstPartyArticleId","@isPageArticle","@showPremiumAnalytics","@summaryPageActivityUrn","@updateUrn"],[[30,0,["companyId"]],[30,0,["companyUrn"]],[30,0,["fireFeedActionEvent"]],[30,0,["firstPartyArticleId"]],[30,0,["authorActor","model","pagePublished"]],[30,0,["model","showPremiumAnalytics"]],[30,0,["model","summaryPageActivityUrn"]],[30,0,["updateUrn"]]]],null],[1,"\\n"]],[]],null],[1,"\\n "],[8,[39,15],null,[["@articleCoverMedia","@isFirstPartyArticleDashAndGqlEnabled"],[[30,0,["model","articleData","coverMedia"]],[30,0,["isFirstPartyArticleDashAndGqlEnabled"]]]],null],[1,"\\n "],[10,"h1"],[15,"dir",[30,0,["textDirection"]]],[14,0,"text-display-large-bold pt6"],[12],[1,"\\n "],[8,[30,1,["Title"]],null,null,[["default"],[[[[1,[30,0,["model","articleData","title"]]]],[]]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n\\n "],[10,0],[14,0,"relative reader__grid mt6"],[12],[1,"\\n "],[10,0],[14,0,"reader-author-info__container"],[12],[1,"\\n "],[8,[39,16],null,[["@authorActor","@imageType","@isFollowing","@onToggleFollow","@publishedAt","@series","@totalArticles","@viewerAllowedToEdit"],[[30,0,["authorActor"]],[30,0,["imageType"]],[30,0,["isFollowing"]],[28,[37,4],["onToggleFollow"],null],[30,0,["model","articleData","publishedAt"]],[30,0,["model","articleData","series"]],[30,0,["totalArticles"]],[30,0,["model","articleData","viewerAllowedToEdit"]]]],null],[1,"\\n "],[10,0],[14,0,"mt3"],[12],[1,"\\n "],[10,"time"],[14,0,"text-body-small-open t-black--light"],[12],[1,"\\n "],[1,[28,[35,17],[[30,0,["model","articleData","publishedAt"]]],[["format","useTimeZone"],["fmt_mdy_long",true]]]],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n "],[13],[1,"\\n\\n"],[41,[30,0,["isFirstPartyArticleDashAndGqlEnabled"]],[[[41,[30,0,["model","articleData","articleAnnotation","annotation"]],[[[1," "],[8,[39,18],null,[["@class","@type","@message","@linkText","@onClick"],["mt4 mb5",[30,0,["articleAnnotationType"]],[30,0,["model","articleData","articleAnnotation","annotation","text"]],[52,[30,0,["articleAnnotationLink"]],[30,0,["articleAnnotationLink","linkText"]]],[52,[30,0,["articleAnnotationLink"]],[28,[37,4],["onClickGraphqlAuthorAnnotationFeedback"],null]]]],null],[1,"\\n"]],[]],null]],[]],[[[41,[30,0,["model","articleData","annotation"]],[[[1," "],[8,[39,18],null,[["@class","@type","@message","@linkText","@onClick"],["mt4 mb5",[30,0,["articleAnnotationType"]],[30,0,["model","articleData","annotation","text"]],[52,[30,0,["articleAnnotationLink"]],[30,0,["articleAnnotationLink","text"]]],[52,[30,0,["articleAnnotationLink"]],[28,[37,4],["onClickAuthorAnnotationFeedback"],null]]]],null],[1,"\\n"]],[]],null]],[]]],[1,"\\n "],[10,0],[14,0,"mv5"],[12],[1,"\\n "],[8,[30,1,["Button"]],null,[["@controlName"],["open_immersive_reader"]],null],[1,"\\n "],[13],[1,"\\n\\n "],[8,[30,1,["Content"]],null,null,[["default"],[[[[1,"\\n "],[8,[39,19],null,[["@contentHtml","@content","@entityUrn","@title","@state","@author","@trackingId","@textDirection","@isFirstPartyArticleDashAndGqlEnabled","@isGatedArticleBannerVisible"],[[30,0,["model","articleData","contentHtml"]],[30,0,["getArticleContent"]],[30,0,["model","articleData","entityUrn"]],[30,0,["model","articleData","title"]],[30,0,["model","articleData","state"]],[30,0,["authorActor","authorName"]],[30,0,["_trackingId"]],[30,0,["textDirection"]],[30,0,["isFirstPartyArticleDashAndGqlEnabled"]],[30,0,["showLeadGenBanner"]]]],null],[1,"\\n "]],[]]]]],[1,"\\n\\n"],[41,[51,[30,0,["model","articleData","viewerAllowedToEdit"]]],[[[1," "],[8,[39,21],null,[["@articleUrn","@authorNormalizedProfileId","@articleAuthorDashProfileUrn","@closeRemoveMentionDialog","@isMentionedInArticle","@isReporting","@openRemoveMentionDialog","@onReportClick","@onReportCancel","@onReportFailure","@onReportSuccess","@removeMention","@showRemoveMentionDialog"],[[30,0,["articleUrn"]],[30,0,["authorNormalizedProfileId"]],[30,0,["articleAuthorDashProfileUrn"]],[30,0,["closeRemoveMentionDialog"]],[30,0,["isMentionedInArticle"]],[30,0,["isReporting"]],[30,0,["openRemoveMentionDialog"]],[28,[37,4],["onReport"],null],[28,[37,4],["onReportCancel"],null],[28,[37,4],["onReportFailure"],null],[28,[37,4],["onReportSuccess"],null],[30,0,["removeMention"]],[30,0,["showRemoveMentionDialog"]]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[51,[30,0,["showLeadGenBanner"]]],[[[41,[30,0,["socialDetail"]],[[[1," "],[8,[39,22],[[24,0,"pv6"]],[["@actor","@authorActor","@commentary","@imageType","@isFollowing","@metadata","@publishedAt","@toggleFollow","@totalArticles","@viewerAllowedToEdit","@isUsingDashAndGql"],[[30,0,["model","ugcActor"]],[30,0,["authorActor"]],[30,0,["model","ugcCommentary"]],[30,0,["imageType"]],[30,0,["isFollowing"]],[30,0,["getUgcMetadata"]],[30,0,["model","articleData","publishedAt"]],[28,[37,4],["onToggleFollow",[30,0,["isFollowing"]]],null],[30,0,["totalArticles"]],[30,0,["model","articleData","viewerAllowedToEdit"]],[30,0,["isFirstPartyArticleDashAndGqlEnabled"]]]],null],[1,"\\n "],[8,[39,23],null,[["@allowedCommentersScope","@articleId","@articleUrn","@author","@authorId","@commentingDisabled","@contentType","@commentSortType","@displayedComments","@enabledSocialMediaOptions","@fromArticleReader","@initialReactionTypeSelected","@isAuthorView","@isCommentingDisabled","@isLiked","@onAddCommentClick","@onCommentsTotalClick","@onLikesTotalClick","@onReactionClick","@onReactionsTotalClick","@onShowShare","@resetShouldScrollComments","@shouldScrollToComments","@socialDetail","@toggleCommentSettings","@trackingId","@updateCommentRestrictionSettings","@updateUrn","@shareUrl"],[[30,0,["allowedCommentersScope"]],[30,0,["thirdPartyArticleId"]],[30,0,["articleUrn"]],[30,0,["authorActor","model"]],[30,0,["authorId"]],[30,0,["commentingDisabled"]],"Article",[30,0,["initialCommentSortOrderType"]],[30,0,["socialDetail","comments","elements"]],[30,0,["enabledSocialMediaOptions"]],true,[30,0,["initialReactionTypeSelected"]],[30,0,["model","articleData","viewerAllowedToEdit"]],[30,0,["isCommentingDisabled"]],[30,0,["isLiked"]],[28,[37,7],[[30,0],"shouldScrollToComments",true],null],[28,[37,7],[[30,0],"shouldScrollToComments",true],null],[30,0,["onLikesTotalClick"]],[30,0,["onReactionClick"]],[30,0,["onReactionsTotalClick"]],[28,[37,4],["onShowShare"],null],[28,[37,7],[[30,0],"shouldScrollToComments",false],null],[30,0,["shouldScrollToComments"]],[30,0,["socialDetail"]],[28,[37,4],["toggleCommentSettings"],null],[30,0,["_trackingId"]],[30,0,["updateCommentRestrictionSettings"]],[30,0,["updateUrn"]],[30,0,["model","shareUrl"]]]],null],[1,"\\n"]],[]],null],[1,"\\n "],[10,"footer"],[14,0,"reader-related-content"],[15,"aria-label",[28,[37,6],["i18n_newsletter_related_content","article-reader/templates/index"],null]],[12],[1,"\\n "],[8,[39,24],null,[["@series","@seriesLogo","@authorActor","@isFollowing","@newsletterId","@isSubscribed","@viewerAllowedToEdit","@seriesSubscriberCount","@onArticleFooterButtonClick","@onToggleSubscribeSeries","@onToggleFollow"],[[30,0,["model","articleData","series"]],[30,0,["seriesLogo"]],[30,0,["authorActor"]],[30,0,["isFollowing"]],[30,0,["newsletterId"]],[30,0,["isSubscribed"]],[30,0,["model","articleData","viewerAllowedToEdit"]],[30,0,["seriesSubscriberCount"]],[30,0,["onArticleFooterButtonClick"]],[30,0,["onToggleSubscribeSeries"]],[28,[37,4],["onToggleFollow",[30,0,["isFollowing"]]],null]]],null],[1,"\\n"],[41,[30,0,["relatedContent"]],[[[1," "],[8,[39,25],null,[["@carouselItems","@hidePrevNextBtns","@hidePagination","@title","@cardWidth"],[5,true,true,[30,0,["relatedCarouselTitle"]],"230px"]],[["default"],[[[[1,"\\n "],[8,[30,2,["slider"]],[[24,0,"reader-related-content__carousel-slider"]],null,[["default"],[[[[1,"\\n"],[42,[28,[37,27],[[28,[37,27],[[30,0,["relatedContent"]]],null]],null],null,[[[41,[51,[28,[37,28],[[30,4],4],null]],[[[1," "],[8,[30,2,["item"]],null,[["@myIndex","@classNames"],[[30,4],"reader-related-content__carousel-item"]],[["default"],[[[[1,"\\n "],[8,[39,29],[[24,0,"reader-related-content__link"],[4,[38,30],["read_related"],null]],[["@route","@model"],["index",[30,3,["permalink"]]]],[["default"],[[[[1,"\\n "],[8,[39,31],null,[["@classNames"],["reader-related-content__card overflow-hidden"]],[["default"],[[[[1,"\\n "],[10,0],[14,0,"reader-related-content__image-container relative"],[12],[1,"\\n"],[41,[30,0,["isFirstPartyArticleDashAndGqlEnabled"]],[[[1," "],[8,[39,32],null,[["@image","@class","@alt","@desiredWidth","@ghostType"],[[30,3,["coverMedia","originalImage","attributes","firstObject","detailData","vectorImage"]],"reader-related-content__image block","",214,"content"]],null],[1,"\\n"]],[]],[[[1," "],[8,[39,32],null,[["@image","@class","@alt","@desiredWidth","@ghostType"],[[30,3,["coverMedia","croppedImage"]],"reader-related-content__image block","",214,"content"]],null],[1,"\\n"]],[]]],[1," "],[13],[1,"\\n "],[10,0],[14,0,"reader-related-content__container"],[12],[1,"\\n "],[8,[39,33],[[24,0,"reader-related-content__title t-14 t-black t-bold"]],[["@text","@lines","@showMoreButton"],[[30,3,["title"]],3,false]],null],[1,"\\n"],[41,[30,0,["isFirstPartyArticleDashAndGqlEnabled"]],[[[42,[28,[37,27],[[28,[37,27],[[30,3,["authorsResolutionResults"]]],null]],null],null,[[[1," "],[8,[39,33],[[24,0,"reader-related-content__author t-14 t-black--light t-normal pt2"]],[["@text","@lines","@tagName","@showMoreButton"],[[28,[37,6],["published_by","article-reader/templates/index"],[["member"],[[28,[37,34],[[30,5,["profileUrn"]]],null]]]],1,"p",false]],null],[1,"\\n"]],[5]],null]],[]],[[[42,[28,[37,27],[[28,[37,27],[[30,3,["authors"]]],null]],null],null,[[[1," "],[8,[39,33],[[24,0,"reader-related-content__author t-14 t-black--light t-normal pt2"]],[["@text","@lines","@tagName","@showMoreButton"],[[28,[37,6],["published_by","article-reader/templates/index"],[["member"],[[28,[37,34],[[30,6,["miniProfile"]]],null]]]],1,"p",false]],null],[1,"\\n"]],[6]],null]],[]]],[1," "],[13],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],null]],[3,4]],null],[1," "]],[]]]]],[1,"\\n\\n"],[41,[28,[37,28],[[30,0,["totalArticles"]],5],null],[[[41,[51,[28,[37,28],[[30,0,["model","articleData","series","issueCount"]],2],null]],[[[1," "],[8,[39,35],[[24,0,"reader-related-content__total-articles link mt4 inline-block"],[4,[38,30],["read_activity"],null]],[["@route","@model","@query"],["profile.common.recent-activity.posts",[30,0,["authorActor","model","profileID"]],[28,[37,36],null,[["locale"],[[27]]]]]],[["default"],[[[[1,"\\n "],[1,[28,[35,6],["i18n_article_reader_see_total_articles","article-reader/templates/index"],[["count"],[[30,0,["totalArticles"]]]]]],[1,"\\n "]],[]]]]],[1,"\\n"]],[]],null]],[]],null],[1," "]],[2]]]]],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n"]],[]],null],[1," "],[13],[1,"\\n "],[13],[1,"\\n "]],[1]]]]],[1,"\\n"]],[]]],[1," "]],[]]]]],[1,"\\n\\n"],[41,[51,[28,[37,37],[[30,0,["showErrorState"]],[30,0,["showLeadGenBanner"]]],null]],[[[41,[30,0,["socialDetail"]],[[[1," "],[8,[39,38],null,[["@allowedCommentersScope","@articleId","@author","@enabledSocialMediaOptions","@isCommentingDisabled","@scrollToComments","@shareUrl","@socialDetail","@trackingId","@updateUrn","@viewerAllowedToEdit"],[[30,0,["allowedCommentersScope"]],[30,0,["thirdPartyArticleId"]],[30,0,["authorActor","model"]],[30,0,["enabledSocialMediaOptions"]],[30,0,["isCommentingDisabled"]],[28,[37,7],[[30,0],"shouldScrollToComments",true],null],[30,0,["model","shareUrl"]],[30,0,["socialDetail"]],[30,0,["_trackingId"]],[30,0,["updateUrn"]],[30,0,["model","articleData","viewerAllowedToEdit"]]]],null],[1,"\\n"]],[]],null]],[]],null],[1,"\\n"],[41,[30,0,["showLeadGenBanner"]],[[[1," "],[8,[39,39],null,[["@gatedArticleMetadata","@onGatedBannerCTAClick","@authorActor"],[[30,0,["model","gatedArticleMetadata"]],[30,0,["openLeadGenForm"]],[30,0,["authorActor"]]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[41,[30,0,["isLeadGenFormModalOpen"]],[[[1," "],[8,[39,40],null,[["@isLeadGenFormModalOpen","@leadGenFormAsyncData","@fetchLeadGenModalData","@closeLeadGenModal","@leadGenToastSuccessMessage","@setSuccessfulSubmissionState","@gatedArticleLeadGenFormTrackingUrl"],[[30,0,["isLeadGenFormModalOpen"]],[30,0,["leadGenFormAsyncData"]],[30,0,["fetchLeadGenModalData"]],[28,[37,7],[[30,0],"isLeadGenFormModalOpen",false],null],[30,0,["leadGenToastSuccessMessage"]],[28,[37,7],[[30,0],"hasSubmittedLeadGenForm",true],null],[30,0,["adTrackingCode"]]]],null],[1,"\\n"]],[]],null],[1,"\\n"],[1," "],[46,[28,[37,42],null,null],null,null,null],[1,"\\n"],[13]],["Reader","carousel","relatedArticle","index","author","author"],false,["ember-page-title@page-title","scaffold-layout@layout","if","article-reader@article-not-found","ember-route-action-helper@route-action","publishing-shared@newsletter-access-banner","t","ember-set-helper@set","scaffold-immersive-reader@immersive-reader","article-reader@smooth-scroll-to","publishing-shared@reload-page-on-cookie-consent-accept","article-reader@page-post-publish-modal","article-reader@post-publish-modal","article-reader@series-reader-header","article-reader@reader-article-header","article-reader@article-cover-image","article-reader@author-info","ember-cli-pemberly-i18n@format-date","artdeco-inline-feedback@artdeco-inline-feedback","article-reader@article-content","unless","article-reader@overflow-options","article-reader@ugc-post-bar","social-details@social-activity-types/article-reader-social-activity","article-reader@article-footer-info","artdeco-carousel@artdeco-carousel","each","-track-array","global-helpers@gte","link-to","ember-cli-pemberly-tracking@track-interaction","artdeco-card@artdeco-card","ember-vector-images@lazy-image","ember-line-clamp@line-clamp","global-helpers@name","ember-engines@link-to-external","hash","global-helpers@or","article-reader@reader-social-bar-sticky","article-reader@gated-article-banner","lead-gen-wrapper@lead-gen-modal-wrapper","component","-outlet"]]',moduleName:"article-reader/templates/index.hbs",isStrictMode:!1})}))
|
|
define("article-reader/templates/preview",["exports","@ember/template-factory"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=(0,t.createTemplateFactory)({id:"kBsan2Xz",block:'[[[10,0],[14,0,"reader-article-preview__container"],[12],[1,"\\n "],[8,[39,0],null,[["@position","@viewerHasAccess","@articleUrn","@authorName","@onPublish","@onShareDraft"],["top",[30,0,["viewerHasAccess"]],[30,0,["currentArticle","entityUrn"]],[30,0,["articleAuthorName"]],[28,[37,1],[[30,0],"showPublishModal",true],null],[28,[37,1],[[30,0],"isShareDraftModalOpen",true],null]]],null],[1,"\\n\\n "],[8,[39,2],null,[["@template"],["main"]],[["main"],[[[[1,"\\n "],[10,"article"],[14,0,"reader-article-preview__main-content"],[12],[1,"\\n "],[8,[39,3],null,[["@series","@viewerAllowedToEdit","@linkedinArticleUrn","@articleCoverMedia","@articleTitle","@textDirection","@seriesSubscriberCount","@newsletterId","@authorActor","@imageType","@isFollowing","@totalArticles"],[[30,0,["currentArticle","series"]],[30,0,["currentArticle","viewerAllowedToEdit"]],[30,0,["currentArticle","linkedinArticleUrn"]],[30,0,["currentArticle","coverMedia"]],[30,0,["currentArticle","title"]],[30,0,["textDirection"]],[30,0,["seriesSubscriberCount"]],[30,0,["newsletterId"]],[30,0,["authorActorModel"]],[30,0,["imageType"]],[30,0,["isFollowing"]],[30,0,["model","totalArticles"]]]],null],[1,"\\n "],[8,[39,4],null,[["@content","@textDirection"],[[30,0,["currentArticle","contentResolutionResults"]],[30,0,["textDirection"]]]],null],[1,"\\n "],[8,[39,5],null,[["@series","@newsletterId","@isSubscribed","@seriesSubscriberCount","@viewerAllowedToEdit","@isFollowing","@authorActor","@totalArticles","@imageType"],[[30,0,["currentArticle","series"]],[30,0,["newsletterId"]],[30,0,["isSubscribed"]],[30,0,["seriesSubscriberCount"]],[30,0,["currentArticle","viewerAllowedToEdit"]],[30,0,["isFollowing"]],[30,0,["authorActorModel"]],[30,0,["model","totalArticles"]],[30,0,["imageType"]]]],null],[1,"\\n "],[13],[1,"\\n "]],[]]]]],[1,"\\n\\n "],[8,[39,0],null,[["@position"],["bottom"]],null],[1,"\\n"],[13],[1,"\\n\\n"],[8,[39,6],null,[["@isOpen","@dismissModal","@shareDraftLink"],[[30,0,["isShareDraftModalOpen"]],[30,0,["dismissModal"]],[30,0,["shareDraftLink"]]]],null],[1,"\\n\\n"],[8,[39,7],null,[["@currentAuthor","@currentArticle","@currentNewsletter","@isOpen","@isPageAuthor","@onClose","@publishArticle","@isUsingDashAndGql"],[[30,0,["publishActor"]],[30,0,["currentArticle"]],[30,0,["currentArticle","series"]],[30,0,["showPublishModal"]],[30,0,["isPageAuthor"]],[28,[37,1],[[30,0],"showPublishModal",false],null],[30,0,["publishArticle"]],true]],null]],[],false,["article-reader@draft-preview/sticky-bar","ember-set-helper@set","scaffold-layout@layout","article-reader@draft-preview/draft-preview-header","article-reader@draft-preview/draft-preview-content","article-reader@draft-preview/draft-preview-footer","article-reader@draft-preview/share-draft-modal","publishing-shared@publish-modal"]]',moduleName:"article-reader/templates/preview.hbs",isStrictMode:!1})}))
|
|
define.alias("ember-async-data/tracked-async-data","article-reader/tracked-async-data")
|
|
define("article-reader/utils/asset-utils",["exports","ember-cloud-filepicker/utils/asset-utils"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define.alias("ember-highcharts/utils/build-options","article-reader/utils/build-options")
|
|
define("article-reader/utils/build-pulse-url",["exports","global-utils/utils/is-browser"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=function(){let e=arguments.length>0&&void 0!==arguments[0]?arguments[0]:"",l=arguments.length>1&&void 0!==arguments[1]?arguments[1]:""
|
|
if(t.default){const t=i(e),n=r(i(l)),a=document.createElement("a")
|
|
a.href=`/${n}`
|
|
return`${t}/pulse/${r(i(a.pathname))}`}return""}
|
|
function r(e){return e.replace(/^\/+/,"")}function i(e){return e.replace(/\/+$/,"")}}))
|
|
define("article-reader/utils/constants",["exports","voyager-web/config/environment"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.TRACKING=e.PAGEKEY=e.MEMBER_URN_PREFIX=e.LIXES=e.IMAGE_EXPOSE_RATIO=e.COMMENT_SORT_TYPES=e.CHARTBEAT_UID=e.CHARTBEAT_IFRAME_ID=e.ARTICLE_URN_PREFIX=e.ARTICLE_ANNOTATION_TYPE_MAP=void 0
|
|
const r=e.ARTICLE_URN_PREFIX="urn:li:article:",i=e.MEMBER_URN_PREFIX="urn:li:member:"
|
|
e.PAGEKEY="flagship3_pulse_read",e.CHARTBEAT_IFRAME_ID="reader-article-content__chartbeat-iframe",e.CHARTBEAT_UID=29139,e.IMAGE_EXPOSE_RATIO=.2,e.COMMENT_SORT_TYPES={REV_CHRON:"REV_CHRON",RELEVANCE:"RELEVANCE"},e.LIXES={SHOULD_USE_CHIPOTLE_SHAREBOX:"voyager.web.publishing.should-use-chipotle-sharebox"},e.ARTICLE_ANNOTATION_TYPE_MAP=Object.freeze({NOTICE:"note",SUCCESS:"success",WARNING:"yield",ERROR:"error"}),e.TRACKING={URL:t.default.tracking.trackingRelativePath,APP_ID:{appId:"com.linkedin.flagship3.d_web"},READ_EVENT:{EVENT_NAME:"ArticleReadEvent",OBJECT_URN_PREFIX:r},VIEW_EVENT:{EVENT_NAME:"ArticleViewEvent",OBJECT_URN_PREFIX:r},REC_IMPRESSION_EVENT:{EVENT_NAME:"PulseStoryRecImpressionEvent",OBJECT_URN_PREFIX:r},ACTION_EVENTS:{EVENT_NAME:"PulseStoryActionEvent",PROFILE:{ACTION_TYPE:"viewMemberProfile",ACTION_CATEGORY:"VIEW",EVENT_NAME:"PROFILE",CONTROL_URN:"profile",OBJECT_URN_PREFIX:i},FOLLOW:{ACTION_TYPE:"followMember",ACTION_CATEGORY:"FOLLOW",EVENT_NAME:"FOLLOW",CONTROL_URN:"actor_follow_toggle",OBJECT_URN_PREFIX:i},UNFOLLOW:{ACTION_TYPE:"unfollowMember",ACTION_CATEGORY:"UNFOLLOW",EVENT_NAME:"UNFOLLOW",CONTROL_URN:"actor_follow_toggle",OBJECT_URN_PREFIX:i},LIKE:{ACTION_TYPE:"likeArticle",ACTION_CATEGORY:"LIKE",EVENT_NAME:"LIKE",CONTROL_URN:"like",OBJECT_URN_PREFIX:r},UNLIKE:{ACTION_TYPE:"unlikeArticle",ACTION_CATEGORY:"UNLIKE",EVENT_NAME:"UNLIKE",CONTROL_URN:"unlike",OBJECT_URN_PREFIX:r},EXPAND_SHARE:{ACTION_TYPE:"expandShare",ACTION_CATEGORY:"EXPAND",EVENT_NAME:"EXPAND_SHARE",CONTROL_URN:"share-intent",OBJECT_URN_PREFIX:r},VIEW_ACTIVITY:{ACTION_TYPE:"viewMemberActivity",ACTION_CATEGORY:"VIEW",EVENT_NAME:"VIEW_ACTIVITY",CONTROL_URN:"activity",OBJECT_URN_PREFIX:i},REPORT:{ACTION_TYPE:"expandReportArticle",ACTION_CATEGORY:"EXPAND",EVENT_NAME:"REPORT",CONTROL_URN:"report",OBJECT_URN_PREFIX:r},RELATED_ARTICLE:{ACTION_TYPE:"clickRelated",ACTION_CATEGORY:"SELECT",EVENT_NAME:"RELATED_ARTICLE",CONTROL_URN:"related",OBJECT_URN_PREFIX:r},AUTHOR_ANALYTICS:{ACTION_TYPE:"viewPostAnalytics",ACTION_CATEGORY:"VIEW",EVENT_NAME:"AUTHOR_ANALYTICS",CONTROL_URN:"analytics",OBJECT_URN_PREFIX:r},WRITE_ARTICLE:{ACTION_TYPE:"viewWritePost",ACTION_CATEGORY:"VIEW",EVENT_NAME:"WRITE_ARTICLE",CONTROL_URN:"write",OBJECT_URN_PREFIX:r},EDIT_ARTICLE:{ACTION_TYPE:"viewEditPost",ACTION_CATEGORY:"VIEW",EVENT_NAME:"EDIT_ARTICLE",CONTROL_URN:"edit",OBJECT_URN_PREFIX:r},SHARE_EXTERNAL:{ACTION_TYPE:"shareExternal",ACTION_CATEGORY:"SHARE",EVENT_NAME:"SHARE_EXTERNAL",CONTROL_URNS:{FACEBOOK:"share_fb",TWITTER:"share_twitter"},OBJECT_URN_PREFIX:r},SHARE_INTERNAL:{ACTION_TYPE:"shareInternal",ACTION_CATEGORY:"SHARE",EVENT_NAME:"SHARE_INTERNAL",CONTROL_URN:"share_internal",SHARE_ID:"linkedin",OBJECT_URN_PREFIX:r},CAROUSEL_CLICK:{ACTION_TYPE:"carouselClick",ACTION_CATEGORY:"VIEW",EVENT_NAME:"CAROUSEL_CLICK",CONTROL_URN:"carousel_click",OBJECT_URN_PREFIX:r},COMMENT_INTENT:{ACTION_TYPE:"expandCommentBox",ACTION_CATEGORY:"EXPAND",EVENT_NAME:"COMMENT_INTENT",CONTROL_URN:"comment_intent",OBJECT_URN_PREFIX:r}}}}))
|
|
define("article-reader/utils/data-requests",["exports","@linkedin/ember-pem/utils/failure-tracking-metadata","global-utils/utils/urn-converter","graphql-queries/queries/publishing/fetch-shared-latest-draft-article-by-urn.graphql","global-utils/utils/url","voyager-web/config/environment","article-reader/utils/pem"],(function(e,t,r,i,l,n,a){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.getGqlSharedDraftArticleData=e.getDashSharedDraftArticleData=e.getArticleList=void 0
|
|
e.getDashSharedDraftArticleData=e=>{const{articleId:i}=e||{},a=(0,r.toUrn)("publishing/dash-first-party-article",i),o=(0,l.addQueryParams)(`/${n.default.namespace}/voyagerPublishingDashFirstPartyArticles`,{q:"sharedLatestDraftById",firstPartyArticleUrn:a})
|
|
return{url:o,options:{reload:!0,adapterOptions:{url:o,failures:[new t.default("fetch-dash-preview-draft-article","failed",{productName:"Voyager - Article Preview"})],degradedEntityIDsToRemove:[i]}}}}
|
|
e.getGqlSharedDraftArticleData=e=>{const{articleId:l}=e||{},n=(0,r.toUrn)("publishing/dash-first-party-article",l)
|
|
return[i.default,{firstPartyArticleUrn:n},{reload:!0,adapterOptions:{failures:[new t.default("fetch-gql-preview-draft-article","failed",{productName:"Voyager - Article Preview"})],degradedEntityIDsToRemove:[l]}}]}
|
|
e.getArticleList=(e,t)=>["com.linkedin.voyager.identity.profile.PostCollection",e,{adapterOptions:(0,a.getPemAdapterOptions)(t,a.DEGRADATION_TRACKING_METADATA.LOAD_ARTICLE_LIST,e)}]}))
|
|
define("article-reader/utils/dwelltime",["exports","@ember/debug","global-utils/utils/is-browser","article-reader/utils/constants"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=class{constructor(e){this.trackingService=e}populateArticleData(e,t,r){this._setupDwelltime()
|
|
this.trackingData={articleTrackingId:r,articleUrn:`urn:li:article:${t}`}}recordDwelltime(){this.hasReadEventFired||this._fireArticleReadEvent()
|
|
this.destroy()}_setupDwelltime(){r.default&&this._addBeforeUnloadListener()
|
|
this.startTime=Date.now()
|
|
this.hasReadEventFired=!1}destroy(){this._removeBeforeUnloadListener()}_fireArticleReadEvent(){this.hasReadEventFired=!0
|
|
const e=Date.now()-this.startTime
|
|
this.trackingService.fireTrackingPayload(i.TRACKING.READ_EVENT.EVENT_NAME,{dwellTime:e,...this.trackingData})}_addBeforeUnloadListener(){if(r.default){this.boundUnloadHandler=this._beforeUnloadHandler.bind(this)
|
|
window.addEventListener("beforeunload",this.boundUnloadHandler)}}_removeBeforeUnloadListener(){r.default&&window.removeEventListener("beforeunload",this.boundUnloadHandler)}_beforeUnloadHandler(){this.hasReadEventFired||this._fireArticleReadEvent()
|
|
this.destroy()}}}))
|
|
define("article-reader/utils/file-error",["exports","ember-cloud-filepicker/utils/file-error"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define("article-reader/utils/file-result",["exports","ember-cloud-filepicker/utils/file-result"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define("article-reader/utils/get-app-config",["exports","ember-cloud-filepicker/utils/get-app-config"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define.alias("ember-cli-artdeco-tabs/utils/get-box-model-width","article-reader/utils/get-box-model-width")
|
|
define("article-reader/utils/get-member-actor-model",["exports"],(function(e){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.getMemberActorFromMemberAuthor=e.getMemberActorFromCompanyAuthor=void 0
|
|
e.getMemberActorFromMemberAuthor=(e,t,r,i)=>{let l,n
|
|
if(t){var a,o
|
|
l={urn:e.entityUrn,followingInfo:e.followingState,showFollowAction:!0}
|
|
n={followingInfo:l.followingInfo,miniProfile:e,pagePublished:!1,showFollowAction:l.showFollowAction,urn:l.urn,avatar:null===(a=e.profilePicture)||void 0===a||null===(o=a.displayImageReferenceResolutionResult)||void 0===o?void 0:o.vectorImage,headline:e.headline,profileID:e.publicIdentifier,profileRoute:"profile.common.profile"}}else{var s
|
|
l={urn:null===(s=e.miniProfile)||void 0===s?void 0:s.entityUrn,followingInfo:e.followingInfo,showFollowAction:!0}
|
|
n=r.createRecord("com.linkedin.voyager.feed.MemberActor",{followingInfo:l.followingInfo,miniProfile:e.miniProfile,pagePublished:!1,showFollowAction:l.showFollowAction,urn:l.urn})}return{authorName:t?i.formatName(e,"full"):i.formatName(e.miniProfile,"full"),badges:{influencer:e.influencer},model:n}}
|
|
e.getMemberActorFromCompanyAuthor=(e,t,r)=>{var i
|
|
let l
|
|
if(t){var n
|
|
l={followingInfo:e.followingState,miniCompany:e,pagePublished:!0,profileID:e.universalName,showFollowAction:!0,urn:e.objectUrn,displayName:e.name,fullName:e.name,profileRoute:"companies.company",avatar:null==e||null===(n=e.logoResolutionResult)||void 0===n?void 0:n.vectorImage}}else{var a,o
|
|
l=r.createRecord("com.linkedin.voyager.feed.CompanyActor",{followingInfo:e.followingInfo,miniCompany:e.miniCompany,pagePublished:!0,profileID:null===(a=e.miniCompany)||void 0===a?void 0:a.universalName,showFollowAction:!0,urn:null===(o=e.miniCompany)||void 0===o?void 0:o.objectUrn})}return{authorName:t?e.name:null===(i=e.miniCompany)||void 0===i?void 0:i.name,badges:{influencer:!1},model:l}}}))
|
|
define("article-reader/utils/get-text-direction",["exports","ember-cli-pemberly-i18n/helpers/bidi-dir","global-utils/utils/is-browser"],(function(e,t,r){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
e.default=e=>{if(r.default){const r=document.createElement("div")
|
|
r.innerHTML=e
|
|
return(0,t.bidiDir)(r.innerText.trim())}return(0,t.bidiDir)(e.replace(/(<([^>]+)>)/gi,""))}}))
|
|
define("article-reader/utils/has-user-error",["exports","restli-utils"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.hasUserError=function(e){var r,i
|
|
const l=[t.httpStatus.S_401_UNAUTHORIZED,t.httpStatus.S_403_FORBIDDEN,t.httpStatus.S_429_TOO_MANY_REQUESTS]
|
|
if(!e)return!1
|
|
if(e.isAdapterError&&l.includes(parseInt(null==e||null===(r=e.errors)||void 0===r||null===(i=r[0])||void 0===i?void 0:i.status,10)))return!0
|
|
if(e&&e.message)return l.some((t=>{const r=`returned a ${t}`
|
|
return-1!==e.message.indexOf(r)}))
|
|
return!1}}))
|
|
define.alias("client-sensor-web/utils/helpers","article-reader/utils/helpers")
|
|
define.alias("@linkedin/hue-web-artdeco-migration-runtime/utils/mapping-data","article-reader/utils/mapping-data")
|
|
define("article-reader/utils/mime-type-utils",["exports","ember-cloud-filepicker/utils/mime-type-utils"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define("article-reader/utils/pem",["exports","@linkedin/ember-pem/utils/degradation-tracking-metadata","feed-requests/update-actions","@ember/debug"],(function(e,t,r,i){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.DEGRADATION_TRACKING_METADATA=void 0
|
|
e.getPemAdapterOptions=a
|
|
e.socialDetailRequestwithDegradationInstrumentation=function(e,t,i,l,n){const o=a(l,n,e),[s,c,d]=(0,r.socialDetailRequest)(e,t,i)
|
|
d.adapterOptions={...d.adapterOptions,...o}
|
|
return[s,c,d]}
|
|
const l=Object.freeze({LOAD_FIRST_PARTY_CONTENT:"load-first-party-content",LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT:"load-first-party-article-related-content",LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT_SOCIAL_DETAIL:"load-first-party-article-related-content-social-detail",LOAD_SOCIAL_DETAIL:"load-social-detail",LOAD_ARTICLE_LIST:"load-article-list",TOGGLE_FOLLOW:"toggle-follow",TOGGLE_SUBSCRIBE:"toggle-subscribe"})
|
|
function n(e){return new t.default(e,`failed-${e}`,{productName:"Voyager - Article Reader"})}e.DEGRADATION_TRACKING_METADATA=Object.freeze({LOAD_FIRST_PARTY_CONTENT:n(l.LOAD_FIRST_PARTY_CONTENT),LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT:n(l.LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT),LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT_SOCIAL_DETAIL:n(l.LOAD_FIRST_PARTY_ARTICLE_RELATED_CONTENT_SOCIAL_DETAIL),LOAD_SOCIAL_DETAIL:n(l.LOAD_SOCIAL_DETAIL),LOAD_ARTICLE_LIST:n(l.LOAD_ARTICLE_LIST),TOGGLE_FOLLOW:n(l.TOGGLE_FOLLOW),TOGGLE_SUBSCRIBE:n(l.TOGGLE_SUBSCRIBE)})
|
|
function a(e,t,r){return{degradations:[t],degradedEntityIDsToRemove:[r]}}}))
|
|
define("article-reader/utils/retry-op",["exports"],(function(e){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=void 0
|
|
const t=async function(e){let r=arguments.length>1&&void 0!==arguments[1]?arguments[1]:3,i=arguments.length>2&&void 0!==arguments[2]?arguments[2]:0
|
|
try{return await e()}catch(l){if(i>=r)throw l
|
|
return t(e,r,i+1)}}
|
|
e.default=t}))
|
|
define("article-reader/utils/series-translation-utils",["exports"],(function(e){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.default=function(e){const{duration:r,unit:i}=e
|
|
if("MONTH"===i&&2===r)return"i18n_biweekly_newsletter"
|
|
return t[i]}
|
|
const t={DAY:"i18n_daily_newsletter",WEEK:"i18n_weekly_newsletter",MONTH:"i18n_monthly_newsletter"}}))
|
|
define("article-reader/utils/shared-article-getters",["exports","global-utils/utils/urn-converter"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.getThirdPartyArticleId=e.getSeriesSubscriberCount=e.getNewsletterId=e.getImageType=void 0
|
|
e.getNewsletterId=e=>(e||"").split("/newsletters/")[1]
|
|
e.getSeriesSubscriberCount=e=>e??0
|
|
e.getThirdPartyArticleId=e=>(0,t.fromUrn)(e,!1).id
|
|
e.getImageType=e=>e?"square":"circle"}))
|
|
define("article-reader/utils/tracking-utils",["exports","@ember/debug"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
e.fireArticleReaderFeedActionEvent=function(){let{actionType:e,actionCategory:t,controlName:i,feedActionEventService:l,legacyTrackingId:n,update:a,updateUrn:o}=arguments.length>0&&void 0!==arguments[0]?arguments[0]:{}
|
|
const s={moduleKey:r,trackingId:a?a.entityTrackingId:n,updateUrn:o}
|
|
l.fireFAE(a||{},{controlName:i,actionType:e,actionCategory:t},s)}
|
|
e.fireFeedActionEventWithTrackingPayload=function(e,t,i,l){let n=arguments.length>4&&void 0!==arguments[4]?arguments[4]:r
|
|
if(t){const{actionCategory:r,actionType:a,controlName:o}=t,s={actionCategory:r,actionType:a,moduleKey:n,requestId:"",updateUrn:l,controlUrn:e.generateControlUrn(o),trackingId:i}
|
|
e.fireTrackingPayload("FeedActionEvent",s)}}
|
|
const r="article-reader:desktop"}))
|
|
define("article-reader/utils/uuid-generator",["exports","ember-uuid/utils/uuid-generator"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.defineProperty(e,"parse",{enumerable:!0,get:function(){return t.parse}})
|
|
Object.defineProperty(e,"unparse",{enumerable:!0,get:function(){return t.unparse}})
|
|
Object.defineProperty(e,"v1",{enumerable:!0,get:function(){return t.v1}})
|
|
Object.defineProperty(e,"v4",{enumerable:!0,get:function(){return t.v4}})}))
|
|
define("article-reader/utils/validation-helpers",["exports","ember-cloud-filepicker/utils/validation-helpers"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
define.alias("ember-vector-images/utils/vector-url","article-reader/utils/vector-url")
|
|
define("article-reader/utils/window-helpers",["exports","ember-cloud-filepicker/utils/window-helpers"],(function(e,t){"use strict"
|
|
Object.defineProperty(e,"__esModule",{value:!0})
|
|
var r={}
|
|
Object.defineProperty(e,"default",{enumerable:!0,get:function(){return t.default}})
|
|
Object.keys(t).forEach((function(i){"default"!==i&&"__esModule"!==i&&(Object.prototype.hasOwnProperty.call(r,i)||i in e&&e[i]===t[i]||Object.defineProperty(e,i,{enumerable:!0,get:function(){return t[i]}}))}))}))
|
|
|
|
//# sourceMappingURL=engine.map |